bundle.js

(function e(t,n,r){function s(o,u){if(!n[o]){if(!t[o]){var a=typeof require=="function"&&require;if(!u&&a)return a(o,!0);if(i)return i(o,!0);var f=new Error("Cannot find module '"+o+"'");throw f.code="MODULE_NOT_FOUND",f}var l=n[o]={exports:{}};t[o][0].call(l.exports,function(e){var n=t[o][1][e];return s(n?n:e)},l,l.exports,e,t,n,r)}return n[o].exports}var i=typeof require=="function"&&require;for(var o=0;o<r.length;o++)s(r[o]);return s})({1:[function(require,module,exports){
'use strict'

exports.byteLength = byteLength
exports.toByteArray = toByteArray
exports.fromByteArray = fromByteArray

var lookup = []
var revLookup = []
var Arr = typeof Uint8Array !== 'undefined' ? Uint8Array : Array

var code = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/'
for (var i = 0, len = code.length; i < len; ++i) {
  lookup[i] = code[i]
  revLookup[code.charCodeAt(i)] = i
}

revLookup['-'.charCodeAt(0)] = 62
revLookup['_'.charCodeAt(0)] = 63

function placeHoldersCount (b64) {
  var len = b64.length
  if (len % 4 > 0) {
    throw new Error('Invalid string. Length must be a multiple of 4')
  }

  // the number of equal signs (place holders)
  // if there are two placeholders, than the two characters before it
  // represent one byte
  // if there is only one, then the three characters before it represent 2 bytes
  // this is just a cheap hack to not do indexOf twice
  return b64[len - 2] === '=' ? 2 : b64[len - 1] === '=' ? 1 : 0
}

function byteLength (b64) {
  // base64 is 4/3 + up to two characters of the original data
  return b64.length * 3 / 4 - placeHoldersCount(b64)
}

function toByteArray (b64) {
  var i, j, l, tmp, placeHolders, arr
  var len = b64.length
  placeHolders = placeHoldersCount(b64)

  arr = new Arr(len * 3 / 4 - placeHolders)

  // if there are placeholders, only get up to the last complete 4 chars
  l = placeHolders > 0 ? len - 4 : len

  var L = 0

  for (i = 0, j = 0; i < l; i += 4, j += 3) {
    tmp = (revLookup[b64.charCodeAt(i)] << 18) | (revLookup[b64.charCodeAt(i + 1)] << 12) | (revLookup[b64.charCodeAt(i + 2)] << 6) | revLookup[b64.charCodeAt(i + 3)]
    arr[L++] = (tmp >> 16) & 0xFF
    arr[L++] = (tmp >> 8) & 0xFF
    arr[L++] = tmp & 0xFF
  }

  if (placeHolders === 2) {
    tmp = (revLookup[b64.charCodeAt(i)] << 2) | (revLookup[b64.charCodeAt(i + 1)] >> 4)
    arr[L++] = tmp & 0xFF
  } else if (placeHolders === 1) {
    tmp = (revLookup[b64.charCodeAt(i)] << 10) | (revLookup[b64.charCodeAt(i + 1)] << 4) | (revLookup[b64.charCodeAt(i + 2)] >> 2)
    arr[L++] = (tmp >> 8) & 0xFF
    arr[L++] = tmp & 0xFF
  }

  return arr
}

function tripletToBase64 (num) {
  return lookup[num >> 18 & 0x3F] + lookup[num >> 12 & 0x3F] + lookup[num >> 6 & 0x3F] + lookup[num & 0x3F]
}

function encodeChunk (uint8, start, end) {
  var tmp
  var output = []
  for (var i = start; i < end; i += 3) {
    tmp = (uint8[i] << 16) + (uint8[i + 1] << 8) + (uint8[i + 2])
    output.push(tripletToBase64(tmp))
  }
  return output.join('')
}

function fromByteArray (uint8) {
  var tmp
  var len = uint8.length
  var extraBytes = len % 3 // if we have 1 byte left, pad 2 bytes
  var output = ''
  var parts = []
  var maxChunkLength = 16383 // must be multiple of 3

  // go through the array every three bytes, we'll deal with trailing stuff later
  for (var i = 0, len2 = len - extraBytes; i < len2; i += maxChunkLength) {
    parts.push(encodeChunk(uint8, i, (i + maxChunkLength) > len2 ? len2 : (i + maxChunkLength)))
  }

  // pad the end with zeros, but make sure to not forget the extra bytes
  if (extraBytes === 1) {
    tmp = uint8[len - 1]
    output += lookup[tmp >> 2]
    output += lookup[(tmp << 4) & 0x3F]
    output += '=='
  } else if (extraBytes === 2) {
    tmp = (uint8[len - 2] << 8) + (uint8[len - 1])
    output += lookup[tmp >> 10]
    output += lookup[(tmp >> 4) & 0x3F]
    output += lookup[(tmp << 2) & 0x3F]
    output += '='
  }

  parts.push(output)

  return parts.join('')
}

},{}],2:[function(require,module,exports){

},{}],3:[function(require,module,exports){
/*!
 * The buffer module from node.js, for the browser.
 *
 * @author   Feross Aboukhadijeh <feross@feross.org> <http://feross.org>
 * @license  MIT
 */
/* eslint-disable no-proto */

'use strict'

var base64 = require('base64-js')
var ieee754 = require('ieee754')

exports.Buffer = Buffer
exports.SlowBuffer = SlowBuffer
exports.INSPECT_MAX_BYTES = 50

var K_MAX_LENGTH = 0x7fffffff
exports.kMaxLength = K_MAX_LENGTH

/**
 * If `Buffer.TYPED_ARRAY_SUPPORT`:
 *   === true    Use Uint8Array implementation (fastest)
 *   === false   Print warning and recommend using `buffer` v4.x which has an Object
 *               implementation (most compatible, even IE6)
 *
 * Browsers that support typed arrays are IE 10+, Firefox 4+, Chrome 7+, Safari 5.1+,
 * Opera 11.6+, iOS 4.2+.
 *
 * We report that the browser does not support typed arrays if the are not subclassable
 * using __proto__. Firefox 4-29 lacks support for adding new properties to `Uint8Array`
 * (See: https://bugzilla.mozilla.org/show_bug.cgi?id=695438). IE 10 lacks support
 * for __proto__ and has a buggy typed array implementation.
 */
Buffer.TYPED_ARRAY_SUPPORT = typedArraySupport()

if (!Buffer.TYPED_ARRAY_SUPPORT && typeof console !== 'undefined' &&
    typeof console.error === 'function') {
  console.error(
    'This browser lacks typed array (Uint8Array) support which is required by ' +
    '`buffer` v5.x. Use `buffer` v4.x if you require old browser support.'
  )
}

function typedArraySupport () {
  // Can typed array instances can be augmented?
  try {
    var arr = new Uint8Array(1)
    arr.__proto__ = {__proto__: Uint8Array.prototype, foo: function () { return 42 }}
    return arr.foo() === 42
  } catch (e) {
    return false
  }
}

function createBuffer (length) {
  if (length > K_MAX_LENGTH) {
    throw new RangeError('Invalid typed array length')
  }
  // Return an augmented `Uint8Array` instance
  var buf = new Uint8Array(length)
  buf.__proto__ = Buffer.prototype
  return buf
}

/**
 * The Buffer constructor returns instances of `Uint8Array` that have their
 * prototype changed to `Buffer.prototype`. Furthermore, `Buffer` is a subclass of
 * `Uint8Array`, so the returned instances will have all the node `Buffer` methods
 * and the `Uint8Array` methods. Square bracket notation works as expected -- it
 * returns a single octet.
 *
 * The `Uint8Array` prototype remains unmodified.
 */

function Buffer (arg, encodingOrOffset, length) {
  // Common case.
  if (typeof arg === 'number') {
    if (typeof encodingOrOffset === 'string') {
      throw new Error(
        'If encoding is specified then the first argument must be a string'
      )
    }
    return allocUnsafe(arg)
  }
  return from(arg, encodingOrOffset, length)
}

// Fix subarray() in ES2016. See: https://github.com/feross/buffer/pull/97
if (typeof Symbol !== 'undefined' && Symbol.species &&
    Buffer[Symbol.species] === Buffer) {
  Object.defineProperty(Buffer, Symbol.species, {
    value: null,
    configurable: true,
    enumerable: false,
    writable: false
  })
}

Buffer.poolSize = 8192 // not used by this implementation

function from (value, encodingOrOffset, length) {
  if (typeof value === 'number') {
    throw new TypeError('"value" argument must not be a number')
  }

  if (value instanceof ArrayBuffer) {
    return fromArrayBuffer(value, encodingOrOffset, length)
  }

  if (typeof value === 'string') {
    return fromString(value, encodingOrOffset)
  }

  return fromObject(value)
}

/**
 * Functionally equivalent to Buffer(arg, encoding) but throws a TypeError
 * if value is a number.
 * Buffer.from(str[, encoding])
 * Buffer.from(array)
 * Buffer.from(buffer)
 * Buffer.from(arrayBuffer[, byteOffset[, length]])
 **/
Buffer.from = function (value, encodingOrOffset, length) {
  return from(value, encodingOrOffset, length)
}

// Note: Change prototype *after* Buffer.from is defined to workaround Chrome bug:
// https://github.com/feross/buffer/pull/148
Buffer.prototype.__proto__ = Uint8Array.prototype
Buffer.__proto__ = Uint8Array

function assertSize (size) {
  if (typeof size !== 'number') {
    throw new TypeError('"size" argument must be a number')
  } else if (size < 0) {
    throw new RangeError('"size" argument must not be negative')
  }
}

function alloc (size, fill, encoding) {
  assertSize(size)
  if (size <= 0) {
    return createBuffer(size)
  }
  if (fill !== undefined) {
    // Only pay attention to encoding if it's a string. This
    // prevents accidentally sending in a number that would
    // be interpretted as a start offset.
    return typeof encoding === 'string'
      ? createBuffer(size).fill(fill, encoding)
      : createBuffer(size).fill(fill)
  }
  return createBuffer(size)
}

/**
 * Creates a new filled Buffer instance.
 * alloc(size[, fill[, encoding]])
 **/
Buffer.alloc = function (size, fill, encoding) {
  return alloc(size, fill, encoding)
}

function allocUnsafe (size) {
  assertSize(size)
  return createBuffer(size < 0 ? 0 : checked(size) | 0)
}

/**
 * Equivalent to Buffer(num), by default creates a non-zero-filled Buffer instance.
 * */
Buffer.allocUnsafe = function (size) {
  return allocUnsafe(size)
}
/**
 * Equivalent to SlowBuffer(num), by default creates a non-zero-filled Buffer instance.
 */
Buffer.allocUnsafeSlow = function (size) {
  return allocUnsafe(size)
}

function fromString (string, encoding) {
  if (typeof encoding !== 'string' || encoding === '') {
    encoding = 'utf8'
  }

  if (!Buffer.isEncoding(encoding)) {
    throw new TypeError('"encoding" must be a valid string encoding')
  }

  var length = byteLength(string, encoding) | 0
  var buf = createBuffer(length)

  var actual = buf.write(string, encoding)

  if (actual !== length) {
    // Writing a hex string, for example, that contains invalid characters will
    // cause everything after the first invalid character to be ignored. (e.g.
    // 'abxxcd' will be treated as 'ab')
    buf = buf.slice(0, actual)
  }

  return buf
}

function fromArrayLike (array) {
  var length = array.length < 0 ? 0 : checked(array.length) | 0
  var buf = createBuffer(length)
  for (var i = 0; i < length; i += 1) {
    buf[i] = array[i] & 255
  }
  return buf
}

function fromArrayBuffer (array, byteOffset, length) {
  if (byteOffset < 0 || array.byteLength < byteOffset) {
    throw new RangeError('\'offset\' is out of bounds')
  }

  if (array.byteLength < byteOffset + (length || 0)) {
    throw new RangeError('\'length\' is out of bounds')
  }

  var buf
  if (byteOffset === undefined && length === undefined) {
    buf = new Uint8Array(array)
  } else if (length === undefined) {
    buf = new Uint8Array(array, byteOffset)
  } else {
    buf = new Uint8Array(array, byteOffset, length)
  }

  // Return an augmented `Uint8Array` instance
  buf.__proto__ = Buffer.prototype
  return buf
}

function fromObject (obj) {
  if (Buffer.isBuffer(obj)) {
    var len = checked(obj.length) | 0
    var buf = createBuffer(len)

    if (buf.length === 0) {
      return buf
    }

    obj.copy(buf, 0, 0, len)
    return buf
  }

  if (obj) {
    if (ArrayBuffer.isView(obj) || 'length' in obj) {
      if (typeof obj.length !== 'number' || isnan(obj.length)) {
        return createBuffer(0)
      }
      return fromArrayLike(obj)
    }

    if (obj.type === 'Buffer' && Array.isArray(obj.data)) {
      return fromArrayLike(obj.data)
    }
  }

  throw new TypeError('First argument must be a string, Buffer, ArrayBuffer, Array, or array-like object.')
}

function checked (length) {
  // Note: cannot use `length < K_MAX_LENGTH` here because that fails when
  // length is NaN (which is otherwise coerced to zero.)
  if (length >= K_MAX_LENGTH) {
    throw new RangeError('Attempt to allocate Buffer larger than maximum ' +
                         'size: 0x' + K_MAX_LENGTH.toString(16) + ' bytes')
  }
  return length | 0
}

function SlowBuffer (length) {
  if (+length != length) { // eslint-disable-line eqeqeq
    length = 0
  }
  return Buffer.alloc(+length)
}

Buffer.isBuffer = function isBuffer (b) {
  return b != null && b._isBuffer === true
}

Buffer.compare = function compare (a, b) {
  if (!Buffer.isBuffer(a) || !Buffer.isBuffer(b)) {
    throw new TypeError('Arguments must be Buffers')
  }

  if (a === b) return 0

  var x = a.length
  var y = b.length

  for (var i = 0, len = Math.min(x, y); i < len; ++i) {
    if (a[i] !== b[i]) {
      x = a[i]
      y = b[i]
      break
    }
  }

  if (x < y) return -1
  if (y < x) return 1
  return 0
}

Buffer.isEncoding = function isEncoding (encoding) {
  switch (String(encoding).toLowerCase()) {
    case 'hex':
    case 'utf8':
    case 'utf-8':
    case 'ascii':
    case 'latin1':
    case 'binary':
    case 'base64':
    case 'ucs2':
    case 'ucs-2':
    case 'utf16le':
    case 'utf-16le':
      return true
    default:
      return false
  }
}

Buffer.concat = function concat (list, length) {
  if (!Array.isArray(list)) {
    throw new TypeError('"list" argument must be an Array of Buffers')
  }

  if (list.length === 0) {
    return Buffer.alloc(0)
  }

  var i
  if (length === undefined) {
    length = 0
    for (i = 0; i < list.length; ++i) {
      length += list[i].length
    }
  }

  var buffer = Buffer.allocUnsafe(length)
  var pos = 0
  for (i = 0; i < list.length; ++i) {
    var buf = list[i]
    if (!Buffer.isBuffer(buf)) {
      throw new TypeError('"list" argument must be an Array of Buffers')
    }
    buf.copy(buffer, pos)
    pos += buf.length
  }
  return buffer
}

function byteLength (string, encoding) {
  if (Buffer.isBuffer(string)) {
    return string.length
  }
  if (ArrayBuffer.isView(string) || string instanceof ArrayBuffer) {
    return string.byteLength
  }
  if (typeof string !== 'string') {
    string = '' + string
  }

  var len = string.length
  if (len === 0) return 0

  // Use a for loop to avoid recursion
  var loweredCase = false
  for (;;) {
    switch (encoding) {
      case 'ascii':
      case 'latin1':
      case 'binary':
        return len
      case 'utf8':
      case 'utf-8':
      case undefined:
        return utf8ToBytes(string).length
      case 'ucs2':
      case 'ucs-2':
      case 'utf16le':
      case 'utf-16le':
        return len * 2
      case 'hex':
        return len >>> 1
      case 'base64':
        return base64ToBytes(string).length
      default:
        if (loweredCase) return utf8ToBytes(string).length // assume utf8
        encoding = ('' + encoding).toLowerCase()
        loweredCase = true
    }
  }
}
Buffer.byteLength = byteLength

function slowToString (encoding, start, end) {
  var loweredCase = false

  // No need to verify that "this.length <= MAX_UINT32" since it's a read-only
  // property of a typed array.

  // This behaves neither like String nor Uint8Array in that we set start/end
  // to their upper/lower bounds if the value passed is out of range.
  // undefined is handled specially as per ECMA-262 6th Edition,
  // Section 13.3.3.7 Runtime Semantics: KeyedBindingInitialization.
  if (start === undefined || start < 0) {
    start = 0
  }
  // Return early if start > this.length. Done here to prevent potential uint32
  // coercion fail below.
  if (start > this.length) {
    return ''
  }

  if (end === undefined || end > this.length) {
    end = this.length
  }

  if (end <= 0) {
    return ''
  }

  // Force coersion to uint32. This will also coerce falsey/NaN values to 0.
  end >>>= 0
  start >>>= 0

  if (end <= start) {
    return ''
  }

  if (!encoding) encoding = 'utf8'

  while (true) {
    switch (encoding) {
      case 'hex':
        return hexSlice(this, start, end)

      case 'utf8':
      case 'utf-8':
        return utf8Slice(this, start, end)

      case 'ascii':
        return asciiSlice(this, start, end)

      case 'latin1':
      case 'binary':
        return latin1Slice(this, start, end)

      case 'base64':
        return base64Slice(this, start, end)

      case 'ucs2':
      case 'ucs-2':
      case 'utf16le':
      case 'utf-16le':
        return utf16leSlice(this, start, end)

      default:
        if (loweredCase) throw new TypeError('Unknown encoding: ' + encoding)
        encoding = (encoding + '').toLowerCase()
        loweredCase = true
    }
  }
}

// This property is used by `Buffer.isBuffer` (and the `is-buffer` npm package)
// to detect a Buffer instance. It's not possible to use `instanceof Buffer`
// reliably in a browserify context because there could be multiple different
// copies of the 'buffer' package in use. This method works even for Buffer
// instances that were created from another copy of the `buffer` package.
// See: https://github.com/feross/buffer/issues/154
Buffer.prototype._isBuffer = true

function swap (b, n, m) {
  var i = b[n]
  b[n] = b[m]
  b[m] = i
}

Buffer.prototype.swap16 = function swap16 () {
  var len = this.length
  if (len % 2 !== 0) {
    throw new RangeError('Buffer size must be a multiple of 16-bits')
  }
  for (var i = 0; i < len; i += 2) {
    swap(this, i, i + 1)
  }
  return this
}

Buffer.prototype.swap32 = function swap32 () {
  var len = this.length
  if (len % 4 !== 0) {
    throw new RangeError('Buffer size must be a multiple of 32-bits')
  }
  for (var i = 0; i < len; i += 4) {
    swap(this, i, i + 3)
    swap(this, i + 1, i + 2)
  }
  return this
}

Buffer.prototype.swap64 = function swap64 () {
  var len = this.length
  if (len % 8 !== 0) {
    throw new RangeError('Buffer size must be a multiple of 64-bits')
  }
  for (var i = 0; i < len; i += 8) {
    swap(this, i, i + 7)
    swap(this, i + 1, i + 6)
    swap(this, i + 2, i + 5)
    swap(this, i + 3, i + 4)
  }
  return this
}

Buffer.prototype.toString = function toString () {
  var length = this.length
  if (length === 0) return ''
  if (arguments.length === 0) return utf8Slice(this, 0, length)
  return slowToString.apply(this, arguments)
}

Buffer.prototype.equals = function equals (b) {
  if (!Buffer.isBuffer(b)) throw new TypeError('Argument must be a Buffer')
  if (this === b) return true
  return Buffer.compare(this, b) === 0
}

Buffer.prototype.inspect = function inspect () {
  var str = ''
  var max = exports.INSPECT_MAX_BYTES
  if (this.length > 0) {
    str = this.toString('hex', 0, max).match(/.{2}/g).join(' ')
    if (this.length > max) str += ' ... '
  }
  return '<Buffer ' + str + '>'
}

Buffer.prototype.compare = function compare (target, start, end, thisStart, thisEnd) {
  if (!Buffer.isBuffer(target)) {
    throw new TypeError('Argument must be a Buffer')
  }

  if (start === undefined) {
    start = 0
  }
  if (end === undefined) {
    end = target ? target.length : 0
  }
  if (thisStart === undefined) {
    thisStart = 0
  }
  if (thisEnd === undefined) {
    thisEnd = this.length
  }

  if (start < 0 || end > target.length || thisStart < 0 || thisEnd > this.length) {
    throw new RangeError('out of range index')
  }

  if (thisStart >= thisEnd && start >= end) {
    return 0
  }
  if (thisStart >= thisEnd) {
    return -1
  }
  if (start >= end) {
    return 1
  }

  start >>>= 0
  end >>>= 0
  thisStart >>>= 0
  thisEnd >>>= 0

  if (this === target) return 0

  var x = thisEnd - thisStart
  var y = end - start
  var len = Math.min(x, y)

  var thisCopy = this.slice(thisStart, thisEnd)
  var targetCopy = target.slice(start, end)

  for (var i = 0; i < len; ++i) {
    if (thisCopy[i] !== targetCopy[i]) {
      x = thisCopy[i]
      y = targetCopy[i]
      break
    }
  }

  if (x < y) return -1
  if (y < x) return 1
  return 0
}

// Finds either the first index of `val` in `buffer` at offset >= `byteOffset`,
// OR the last index of `val` in `buffer` at offset <= `byteOffset`.
//
// Arguments:
// - buffer - a Buffer to search
// - val - a string, Buffer, or number
// - byteOffset - an index into `buffer`; will be clamped to an int32
// - encoding - an optional encoding, relevant is val is a string
// - dir - true for indexOf, false for lastIndexOf
function bidirectionalIndexOf (buffer, val, byteOffset, encoding, dir) {
  // Empty buffer means no match
  if (buffer.length === 0) return -1

  // Normalize byteOffset
  if (typeof byteOffset === 'string') {
    encoding = byteOffset
    byteOffset = 0
  } else if (byteOffset > 0x7fffffff) {
    byteOffset = 0x7fffffff
  } else if (byteOffset < -0x80000000) {
    byteOffset = -0x80000000
  }
  byteOffset = +byteOffset  // Coerce to Number.
  if (isNaN(byteOffset)) {
    // byteOffset: it it's undefined, null, NaN, "foo", etc, search whole buffer
    byteOffset = dir ? 0 : (buffer.length - 1)
  }

  // Normalize byteOffset: negative offsets start from the end of the buffer
  if (byteOffset < 0) byteOffset = buffer.length + byteOffset
  if (byteOffset >= buffer.length) {
    if (dir) return -1
    else byteOffset = buffer.length - 1
  } else if (byteOffset < 0) {
    if (dir) byteOffset = 0
    else return -1
  }

  // Normalize val
  if (typeof val === 'string') {
    val = Buffer.from(val, encoding)
  }

  // Finally, search either indexOf (if dir is true) or lastIndexOf
  if (Buffer.isBuffer(val)) {
    // Special case: looking for empty string/buffer always fails
    if (val.length === 0) {
      return -1
    }
    return arrayIndexOf(buffer, val, byteOffset, encoding, dir)
  } else if (typeof val === 'number') {
    val = val & 0xFF // Search for a byte value [0-255]
    if (typeof Uint8Array.prototype.indexOf === 'function') {
      if (dir) {
        return Uint8Array.prototype.indexOf.call(buffer, val, byteOffset)
      } else {
        return Uint8Array.prototype.lastIndexOf.call(buffer, val, byteOffset)
      }
    }
    return arrayIndexOf(buffer, [ val ], byteOffset, encoding, dir)
  }

  throw new TypeError('val must be string, number or Buffer')
}

function arrayIndexOf (arr, val, byteOffset, encoding, dir) {
  var indexSize = 1
  var arrLength = arr.length
  var valLength = val.length

  if (encoding !== undefined) {
    encoding = String(encoding).toLowerCase()
    if (encoding === 'ucs2' || encoding === 'ucs-2' ||
        encoding === 'utf16le' || encoding === 'utf-16le') {
      if (arr.length < 2 || val.length < 2) {
        return -1
      }
      indexSize = 2
      arrLength /= 2
      valLength /= 2
      byteOffset /= 2
    }
  }

  function read (buf, i) {
    if (indexSize === 1) {
      return buf[i]
    } else {
      return buf.readUInt16BE(i * indexSize)
    }
  }

  var i
  if (dir) {
    var foundIndex = -1
    for (i = byteOffset; i < arrLength; i++) {
      if (read(arr, i) === read(val, foundIndex === -1 ? 0 : i - foundIndex)) {
        if (foundIndex === -1) foundIndex = i
        if (i - foundIndex + 1 === valLength) return foundIndex * indexSize
      } else {
        if (foundIndex !== -1) i -= i - foundIndex
        foundIndex = -1
      }
    }
  } else {
    if (byteOffset + valLength > arrLength) byteOffset = arrLength - valLength
    for (i = byteOffset; i >= 0; i--) {
      var found = true
      for (var j = 0; j < valLength; j++) {
        if (read(arr, i + j) !== read(val, j)) {
          found = false
          break
        }
      }
      if (found) return i
    }
  }

  return -1
}

Buffer.prototype.includes = function includes (val, byteOffset, encoding) {
  return this.indexOf(val, byteOffset, encoding) !== -1
}

Buffer.prototype.indexOf = function indexOf (val, byteOffset, encoding) {
  return bidirectionalIndexOf(this, val, byteOffset, encoding, true)
}

Buffer.prototype.lastIndexOf = function lastIndexOf (val, byteOffset, encoding) {
  return bidirectionalIndexOf(this, val, byteOffset, encoding, false)
}

function hexWrite (buf, string, offset, length) {
  offset = Number(offset) || 0
  var remaining = buf.length - offset
  if (!length) {
    length = remaining
  } else {
    length = Number(length)
    if (length > remaining) {
      length = remaining
    }
  }

  // must be an even number of digits
  var strLen = string.length
  if (strLen % 2 !== 0) throw new TypeError('Invalid hex string')

  if (length > strLen / 2) {
    length = strLen / 2
  }
  for (var i = 0; i < length; ++i) {
    var parsed = parseInt(string.substr(i * 2, 2), 16)
    if (isNaN(parsed)) return i
    buf[offset + i] = parsed
  }
  return i
}

function utf8Write (buf, string, offset, length) {
  return blitBuffer(utf8ToBytes(string, buf.length - offset), buf, offset, length)
}

function asciiWrite (buf, string, offset, length) {
  return blitBuffer(asciiToBytes(string), buf, offset, length)
}

function latin1Write (buf, string, offset, length) {
  return asciiWrite(buf, string, offset, length)
}

function base64Write (buf, string, offset, length) {
  return blitBuffer(base64ToBytes(string), buf, offset, length)
}

function ucs2Write (buf, string, offset, length) {
  return blitBuffer(utf16leToBytes(string, buf.length - offset), buf, offset, length)
}

Buffer.prototype.write = function write (string, offset, length, encoding) {
  // Buffer#write(string)
  if (offset === undefined) {
    encoding = 'utf8'
    length = this.length
    offset = 0
  // Buffer#write(string, encoding)
  } else if (length === undefined && typeof offset === 'string') {
    encoding = offset
    length = this.length
    offset = 0
  // Buffer#write(string, offset[, length][, encoding])
  } else if (isFinite(offset)) {
    offset = offset >>> 0
    if (isFinite(length)) {
      length = length >>> 0
      if (encoding === undefined) encoding = 'utf8'
    } else {
      encoding = length
      length = undefined
    }
  } else {
    throw new Error(
      'Buffer.write(string, encoding, offset[, length]) is no longer supported'
    )
  }

  var remaining = this.length - offset
  if (length === undefined || length > remaining) length = remaining

  if ((string.length > 0 && (length < 0 || offset < 0)) || offset > this.length) {
    throw new RangeError('Attempt to write outside buffer bounds')
  }

  if (!encoding) encoding = 'utf8'

  var loweredCase = false
  for (;;) {
    switch (encoding) {
      case 'hex':
        return hexWrite(this, string, offset, length)

      case 'utf8':
      case 'utf-8':
        return utf8Write(this, string, offset, length)

      case 'ascii':
        return asciiWrite(this, string, offset, length)

      case 'latin1':
      case 'binary':
        return latin1Write(this, string, offset, length)

      case 'base64':
        // Warning: maxLength not taken into account in base64Write
        return base64Write(this, string, offset, length)

      case 'ucs2':
      case 'ucs-2':
      case 'utf16le':
      case 'utf-16le':
        return ucs2Write(this, string, offset, length)

      default:
        if (loweredCase) throw new TypeError('Unknown encoding: ' + encoding)
        encoding = ('' + encoding).toLowerCase()
        loweredCase = true
    }
  }
}

Buffer.prototype.toJSON = function toJSON () {
  return {
    type: 'Buffer',
    data: Array.prototype.slice.call(this._arr || this, 0)
  }
}

function base64Slice (buf, start, end) {
  if (start === 0 && end === buf.length) {
    return base64.fromByteArray(buf)
  } else {
    return base64.fromByteArray(buf.slice(start, end))
  }
}

function utf8Slice (buf, start, end) {
  end = Math.min(buf.length, end)
  var res = []

  var i = start
  while (i < end) {
    var firstByte = buf[i]
    var codePoint = null
    var bytesPerSequence = (firstByte > 0xEF) ? 4
      : (firstByte > 0xDF) ? 3
      : (firstByte > 0xBF) ? 2
      : 1

    if (i + bytesPerSequence <= end) {
      var secondByte, thirdByte, fourthByte, tempCodePoint

      switch (bytesPerSequence) {
        case 1:
          if (firstByte < 0x80) {
            codePoint = firstByte
          }
          break
        case 2:
          secondByte = buf[i + 1]
          if ((secondByte & 0xC0) === 0x80) {
            tempCodePoint = (firstByte & 0x1F) << 0x6 | (secondByte & 0x3F)
            if (tempCodePoint > 0x7F) {
              codePoint = tempCodePoint
            }
          }
          break
        case 3:
          secondByte = buf[i + 1]
          thirdByte = buf[i + 2]
          if ((secondByte & 0xC0) === 0x80 && (thirdByte & 0xC0) === 0x80) {
            tempCodePoint = (firstByte & 0xF) << 0xC | (secondByte & 0x3F) << 0x6 | (thirdByte & 0x3F)
            if (tempCodePoint > 0x7FF && (tempCodePoint < 0xD800 || tempCodePoint > 0xDFFF)) {
              codePoint = tempCodePoint
            }
          }
          break
        case 4:
          secondByte = buf[i + 1]
          thirdByte = buf[i + 2]
          fourthByte = buf[i + 3]
          if ((secondByte & 0xC0) === 0x80 && (thirdByte & 0xC0) === 0x80 && (fourthByte & 0xC0) === 0x80) {
            tempCodePoint = (firstByte & 0xF) << 0x12 | (secondByte & 0x3F) << 0xC | (thirdByte & 0x3F) << 0x6 | (fourthByte & 0x3F)
            if (tempCodePoint > 0xFFFF && tempCodePoint < 0x110000) {
              codePoint = tempCodePoint
            }
          }
      }
    }

    if (codePoint === null) {
      // we did not generate a valid codePoint so insert a
      // replacement char (U+FFFD) and advance only 1 byte
      codePoint = 0xFFFD
      bytesPerSequence = 1
    } else if (codePoint > 0xFFFF) {
      // encode to utf16 (surrogate pair dance)
      codePoint -= 0x10000
      res.push(codePoint >>> 10 & 0x3FF | 0xD800)
      codePoint = 0xDC00 | codePoint & 0x3FF
    }

    res.push(codePoint)
    i += bytesPerSequence
  }

  return decodeCodePointsArray(res)
}

// Based on http://stackoverflow.com/a/22747272/680742, the browser with
// the lowest limit is Chrome, with 0x10000 args.
// We go 1 magnitude less, for safety
var MAX_ARGUMENTS_LENGTH = 0x1000

function decodeCodePointsArray (codePoints) {
  var len = codePoints.length
  if (len <= MAX_ARGUMENTS_LENGTH) {
    return String.fromCharCode.apply(String, codePoints) // avoid extra slice()
  }

  // Decode in chunks to avoid "call stack size exceeded".
  var res = ''
  var i = 0
  while (i < len) {
    res += String.fromCharCode.apply(
      String,
      codePoints.slice(i, i += MAX_ARGUMENTS_LENGTH)
    )
  }
  return res
}

function asciiSlice (buf, start, end) {
  var ret = ''
  end = Math.min(buf.length, end)

  for (var i = start; i < end; ++i) {
    ret += String.fromCharCode(buf[i] & 0x7F)
  }
  return ret
}

function latin1Slice (buf, start, end) {
  var ret = ''
  end = Math.min(buf.length, end)

  for (var i = start; i < end; ++i) {
    ret += String.fromCharCode(buf[i])
  }
  return ret
}

function hexSlice (buf, start, end) {
  var len = buf.length

  if (!start || start < 0) start = 0
  if (!end || end < 0 || end > len) end = len

  var out = ''
  for (var i = start; i < end; ++i) {
    out += toHex(buf[i])
  }
  return out
}

function utf16leSlice (buf, start, end) {
  var bytes = buf.slice(start, end)
  var res = ''
  for (var i = 0; i < bytes.length; i += 2) {
    res += String.fromCharCode(bytes[i] + (bytes[i + 1] * 256))
  }
  return res
}

Buffer.prototype.slice = function slice (start, end) {
  var len = this.length
  start = ~~start
  end = end === undefined ? len : ~~end

  if (start < 0) {
    start += len
    if (start < 0) start = 0
  } else if (start > len) {
    start = len
  }

  if (end < 0) {
    end += len
    if (end < 0) end = 0
  } else if (end > len) {
    end = len
  }

  if (end < start) end = start

  var newBuf = this.subarray(start, end)
  // Return an augmented `Uint8Array` instance
  newBuf.__proto__ = Buffer.prototype
  return newBuf
}

/*
 * Need to make sure that buffer isn't trying to write out of bounds.
 */
function checkOffset (offset, ext, length) {
  if ((offset % 1) !== 0 || offset < 0) throw new RangeError('offset is not uint')
  if (offset + ext > length) throw new RangeError('Trying to access beyond buffer length')
}

Buffer.prototype.readUIntLE = function readUIntLE (offset, byteLength, noAssert) {
  offset = offset >>> 0
  byteLength = byteLength >>> 0
  if (!noAssert) checkOffset(offset, byteLength, this.length)

  var val = this[offset]
  var mul = 1
  var i = 0
  while (++i < byteLength && (mul *= 0x100)) {
    val += this[offset + i] * mul
  }

  return val
}

Buffer.prototype.readUIntBE = function readUIntBE (offset, byteLength, noAssert) {
  offset = offset >>> 0
  byteLength = byteLength >>> 0
  if (!noAssert) {
    checkOffset(offset, byteLength, this.length)
  }

  var val = this[offset + --byteLength]
  var mul = 1
  while (byteLength > 0 && (mul *= 0x100)) {
    val += this[offset + --byteLength] * mul
  }

  return val
}

Buffer.prototype.readUInt8 = function readUInt8 (offset, noAssert) {
  offset = offset >>> 0
  if (!noAssert) checkOffset(offset, 1, this.length)
  return this[offset]
}

Buffer.prototype.readUInt16LE = function readUInt16LE (offset, noAssert) {
  offset = offset >>> 0
  if (!noAssert) checkOffset(offset, 2, this.length)
  return this[offset] | (this[offset + 1] << 8)
}

Buffer.prototype.readUInt16BE = function readUInt16BE (offset, noAssert) {
  offset = offset >>> 0
  if (!noAssert) checkOffset(offset, 2, this.length)
  return (this[offset] << 8) | this[offset + 1]
}

Buffer.prototype.readUInt32LE = function readUInt32LE (offset, noAssert) {
  offset = offset >>> 0
  if (!noAssert) checkOffset(offset, 4, this.length)

  return ((this[offset]) |
      (this[offset + 1] << 8) |
      (this[offset + 2] << 16)) +
      (this[offset + 3] * 0x1000000)
}

Buffer.prototype.readUInt32BE = function readUInt32BE (offset, noAssert) {
  offset = offset >>> 0
  if (!noAssert) checkOffset(offset, 4, this.length)

  return (this[offset] * 0x1000000) +
    ((this[offset + 1] << 16) |
    (this[offset + 2] << 8) |
    this[offset + 3])
}

Buffer.prototype.readIntLE = function readIntLE (offset, byteLength, noAssert) {
  offset = offset >>> 0
  byteLength = byteLength >>> 0
  if (!noAssert) checkOffset(offset, byteLength, this.length)

  var val = this[offset]
  var mul = 1
  var i = 0
  while (++i < byteLength && (mul *= 0x100)) {
    val += this[offset + i] * mul
  }
  mul *= 0x80

  if (val >= mul) val -= Math.pow(2, 8 * byteLength)

  return val
}

Buffer.prototype.readIntBE = function readIntBE (offset, byteLength, noAssert) {
  offset = offset >>> 0
  byteLength = byteLength >>> 0
  if (!noAssert) checkOffset(offset, byteLength, this.length)

  var i = byteLength
  var mul = 1
  var val = this[offset + --i]
  while (i > 0 && (mul *= 0x100)) {
    val += this[offset + --i] * mul
  }
  mul *= 0x80

  if (val >= mul) val -= Math.pow(2, 8 * byteLength)

  return val
}

Buffer.prototype.readInt8 = function readInt8 (offset, noAssert) {
  offset = offset >>> 0
  if (!noAssert) checkOffset(offset, 1, this.length)
  if (!(this[offset] & 0x80)) return (this[offset])
  return ((0xff - this[offset] + 1) * -1)
}

Buffer.prototype.readInt16LE = function readInt16LE (offset, noAssert) {
  offset = offset >>> 0
  if (!noAssert) checkOffset(offset, 2, this.length)
  var val = this[offset] | (this[offset + 1] << 8)
  return (val & 0x8000) ? val | 0xFFFF0000 : val
}

Buffer.prototype.readInt16BE = function readInt16BE (offset, noAssert) {
  offset = offset >>> 0
  if (!noAssert) checkOffset(offset, 2, this.length)
  var val = this[offset + 1] | (this[offset] << 8)
  return (val & 0x8000) ? val | 0xFFFF0000 : val
}

Buffer.prototype.readInt32LE = function readInt32LE (offset, noAssert) {
  offset = offset >>> 0
  if (!noAssert) checkOffset(offset, 4, this.length)

  return (this[offset]) |
    (this[offset + 1] << 8) |
    (this[offset + 2] << 16) |
    (this[offset + 3] << 24)
}

Buffer.prototype.readInt32BE = function readInt32BE (offset, noAssert) {
  offset = offset >>> 0
  if (!noAssert) checkOffset(offset, 4, this.length)

  return (this[offset] << 24) |
    (this[offset + 1] << 16) |
    (this[offset + 2] << 8) |
    (this[offset + 3])
}

Buffer.prototype.readFloatLE = function readFloatLE (offset, noAssert) {
  offset = offset >>> 0
  if (!noAssert) checkOffset(offset, 4, this.length)
  return ieee754.read(this, offset, true, 23, 4)
}

Buffer.prototype.readFloatBE = function readFloatBE (offset, noAssert) {
  offset = offset >>> 0
  if (!noAssert) checkOffset(offset, 4, this.length)
  return ieee754.read(this, offset, false, 23, 4)
}

Buffer.prototype.readDoubleLE = function readDoubleLE (offset, noAssert) {
  offset = offset >>> 0
  if (!noAssert) checkOffset(offset, 8, this.length)
  return ieee754.read(this, offset, true, 52, 8)
}

Buffer.prototype.readDoubleBE = function readDoubleBE (offset, noAssert) {
  offset = offset >>> 0
  if (!noAssert) checkOffset(offset, 8, this.length)
  return ieee754.read(this, offset, false, 52, 8)
}

function checkInt (buf, value, offset, ext, max, min) {
  if (!Buffer.isBuffer(buf)) throw new TypeError('"buffer" argument must be a Buffer instance')
  if (value > max || value < min) throw new RangeError('"value" argument is out of bounds')
  if (offset + ext > buf.length) throw new RangeError('Index out of range')
}

Buffer.prototype.writeUIntLE = function writeUIntLE (value, offset, byteLength, noAssert) {
  value = +value
  offset = offset >>> 0
  byteLength = byteLength >>> 0
  if (!noAssert) {
    var maxBytes = Math.pow(2, 8 * byteLength) - 1
    checkInt(this, value, offset, byteLength, maxBytes, 0)
  }

  var mul = 1
  var i = 0
  this[offset] = value & 0xFF
  while (++i < byteLength && (mul *= 0x100)) {
    this[offset + i] = (value / mul) & 0xFF
  }

  return offset + byteLength
}

Buffer.prototype.writeUIntBE = function writeUIntBE (value, offset, byteLength, noAssert) {
  value = +value
  offset = offset >>> 0
  byteLength = byteLength >>> 0
  if (!noAssert) {
    var maxBytes = Math.pow(2, 8 * byteLength) - 1
    checkInt(this, value, offset, byteLength, maxBytes, 0)
  }

  var i = byteLength - 1
  var mul = 1
  this[offset + i] = value & 0xFF
  while (--i >= 0 && (mul *= 0x100)) {
    this[offset + i] = (value / mul) & 0xFF
  }

  return offset + byteLength
}

Buffer.prototype.writeUInt8 = function writeUInt8 (value, offset, noAssert) {
  value = +value
  offset = offset >>> 0
  if (!noAssert) checkInt(this, value, offset, 1, 0xff, 0)
  this[offset] = (value & 0xff)
  return offset + 1
}

Buffer.prototype.writeUInt16LE = function writeUInt16LE (value, offset, noAssert) {
  value = +value
  offset = offset >>> 0
  if (!noAssert) checkInt(this, value, offset, 2, 0xffff, 0)
  this[offset] = (value & 0xff)
  this[offset + 1] = (value >>> 8)
  return offset + 2
}

Buffer.prototype.writeUInt16BE = function writeUInt16BE (value, offset, noAssert) {
  value = +value
  offset = offset >>> 0
  if (!noAssert) checkInt(this, value, offset, 2, 0xffff, 0)
  this[offset] = (value >>> 8)
  this[offset + 1] = (value & 0xff)
  return offset + 2
}

Buffer.prototype.writeUInt32LE = function writeUInt32LE (value, offset, noAssert) {
  value = +value
  offset = offset >>> 0
  if (!noAssert) checkInt(this, value, offset, 4, 0xffffffff, 0)
  this[offset + 3] = (value >>> 24)
  this[offset + 2] = (value >>> 16)
  this[offset + 1] = (value >>> 8)
  this[offset] = (value & 0xff)
  return offset + 4
}

Buffer.prototype.writeUInt32BE = function writeUInt32BE (value, offset, noAssert) {
  value = +value
  offset = offset >>> 0
  if (!noAssert) checkInt(this, value, offset, 4, 0xffffffff, 0)
  this[offset] = (value >>> 24)
  this[offset + 1] = (value >>> 16)
  this[offset + 2] = (value >>> 8)
  this[offset + 3] = (value & 0xff)
  return offset + 4
}

Buffer.prototype.writeIntLE = function writeIntLE (value, offset, byteLength, noAssert) {
  value = +value
  offset = offset >>> 0
  if (!noAssert) {
    var limit = Math.pow(2, (8 * byteLength) - 1)

    checkInt(this, value, offset, byteLength, limit - 1, -limit)
  }

  var i = 0
  var mul = 1
  var sub = 0
  this[offset] = value & 0xFF
  while (++i < byteLength && (mul *= 0x100)) {
    if (value < 0 && sub === 0 && this[offset + i - 1] !== 0) {
      sub = 1
    }
    this[offset + i] = ((value / mul) >> 0) - sub & 0xFF
  }

  return offset + byteLength
}

Buffer.prototype.writeIntBE = function writeIntBE (value, offset, byteLength, noAssert) {
  value = +value
  offset = offset >>> 0
  if (!noAssert) {
    var limit = Math.pow(2, (8 * byteLength) - 1)

    checkInt(this, value, offset, byteLength, limit - 1, -limit)
  }

  var i = byteLength - 1
  var mul = 1
  var sub = 0
  this[offset + i] = value & 0xFF
  while (--i >= 0 && (mul *= 0x100)) {
    if (value < 0 && sub === 0 && this[offset + i + 1] !== 0) {
      sub = 1
    }
    this[offset + i] = ((value / mul) >> 0) - sub & 0xFF
  }

  return offset + byteLength
}

Buffer.prototype.writeInt8 = function writeInt8 (value, offset, noAssert) {
  value = +value
  offset = offset >>> 0
  if (!noAssert) checkInt(this, value, offset, 1, 0x7f, -0x80)
  if (value < 0) value = 0xff + value + 1
  this[offset] = (value & 0xff)
  return offset + 1
}

Buffer.prototype.writeInt16LE = function writeInt16LE (value, offset, noAssert) {
  value = +value
  offset = offset >>> 0
  if (!noAssert) checkInt(this, value, offset, 2, 0x7fff, -0x8000)
  this[offset] = (value & 0xff)
  this[offset + 1] = (value >>> 8)
  return offset + 2
}

Buffer.prototype.writeInt16BE = function writeInt16BE (value, offset, noAssert) {
  value = +value
  offset = offset >>> 0
  if (!noAssert) checkInt(this, value, offset, 2, 0x7fff, -0x8000)
  this[offset] = (value >>> 8)
  this[offset + 1] = (value & 0xff)
  return offset + 2
}

Buffer.prototype.writeInt32LE = function writeInt32LE (value, offset, noAssert) {
  value = +value
  offset = offset >>> 0
  if (!noAssert) checkInt(this, value, offset, 4, 0x7fffffff, -0x80000000)
  this[offset] = (value & 0xff)
  this[offset + 1] = (value >>> 8)
  this[offset + 2] = (value >>> 16)
  this[offset + 3] = (value >>> 24)
  return offset + 4
}

Buffer.prototype.writeInt32BE = function writeInt32BE (value, offset, noAssert) {
  value = +value
  offset = offset >>> 0
  if (!noAssert) checkInt(this, value, offset, 4, 0x7fffffff, -0x80000000)
  if (value < 0) value = 0xffffffff + value + 1
  this[offset] = (value >>> 24)
  this[offset + 1] = (value >>> 16)
  this[offset + 2] = (value >>> 8)
  this[offset + 3] = (value & 0xff)
  return offset + 4
}

function checkIEEE754 (buf, value, offset, ext, max, min) {
  if (offset + ext > buf.length) throw new RangeError('Index out of range')
  if (offset < 0) throw new RangeError('Index out of range')
}

function writeFloat (buf, value, offset, littleEndian, noAssert) {
  value = +value
  offset = offset >>> 0
  if (!noAssert) {
    checkIEEE754(buf, value, offset, 4, 3.4028234663852886e+38, -3.4028234663852886e+38)
  }
  ieee754.write(buf, value, offset, littleEndian, 23, 4)
  return offset + 4
}

Buffer.prototype.writeFloatLE = function writeFloatLE (value, offset, noAssert) {
  return writeFloat(this, value, offset, true, noAssert)
}

Buffer.prototype.writeFloatBE = function writeFloatBE (value, offset, noAssert) {
  return writeFloat(this, value, offset, false, noAssert)
}

function writeDouble (buf, value, offset, littleEndian, noAssert) {
  value = +value
  offset = offset >>> 0
  if (!noAssert) {
    checkIEEE754(buf, value, offset, 8, 1.7976931348623157E+308, -1.7976931348623157E+308)
  }
  ieee754.write(buf, value, offset, littleEndian, 52, 8)
  return offset + 8
}

Buffer.prototype.writeDoubleLE = function writeDoubleLE (value, offset, noAssert) {
  return writeDouble(this, value, offset, true, noAssert)
}

Buffer.prototype.writeDoubleBE = function writeDoubleBE (value, offset, noAssert) {
  return writeDouble(this, value, offset, false, noAssert)
}

// copy(targetBuffer, targetStart=0, sourceStart=0, sourceEnd=buffer.length)
Buffer.prototype.copy = function copy (target, targetStart, start, end) {
  if (!start) start = 0
  if (!end && end !== 0) end = this.length
  if (targetStart >= target.length) targetStart = target.length
  if (!targetStart) targetStart = 0
  if (end > 0 && end < start) end = start

  // Copy 0 bytes; we're done
  if (end === start) return 0
  if (target.length === 0 || this.length === 0) return 0

  // Fatal error conditions
  if (targetStart < 0) {
    throw new RangeError('targetStart out of bounds')
  }
  if (start < 0 || start >= this.length) throw new RangeError('sourceStart out of bounds')
  if (end < 0) throw new RangeError('sourceEnd out of bounds')

  // Are we oob?
  if (end > this.length) end = this.length
  if (target.length - targetStart < end - start) {
    end = target.length - targetStart + start
  }

  var len = end - start
  var i

  if (this === target && start < targetStart && targetStart < end) {
    // descending copy from end
    for (i = len - 1; i >= 0; --i) {
      target[i + targetStart] = this[i + start]
    }
  } else if (len < 1000) {
    // ascending copy from start
    for (i = 0; i < len; ++i) {
      target[i + targetStart] = this[i + start]
    }
  } else {
    Uint8Array.prototype.set.call(
      target,
      this.subarray(start, start + len),
      targetStart
    )
  }

  return len
}

// Usage:
//    buffer.fill(number[, offset[, end]])
//    buffer.fill(buffer[, offset[, end]])
//    buffer.fill(string[, offset[, end]][, encoding])
Buffer.prototype.fill = function fill (val, start, end, encoding) {
  // Handle string cases:
  if (typeof val === 'string') {
    if (typeof start === 'string') {
      encoding = start
      start = 0
      end = this.length
    } else if (typeof end === 'string') {
      encoding = end
      end = this.length
    }
    if (val.length === 1) {
      var code = val.charCodeAt(0)
      if (code < 256) {
        val = code
      }
    }
    if (encoding !== undefined && typeof encoding !== 'string') {
      throw new TypeError('encoding must be a string')
    }
    if (typeof encoding === 'string' && !Buffer.isEncoding(encoding)) {
      throw new TypeError('Unknown encoding: ' + encoding)
    }
  } else if (typeof val === 'number') {
    val = val & 255
  }

  // Invalid ranges are not set to a default, so can range check early.
  if (start < 0 || this.length < start || this.length < end) {
    throw new RangeError('Out of range index')
  }

  if (end <= start) {
    return this
  }

  start = start >>> 0
  end = end === undefined ? this.length : end >>> 0

  if (!val) val = 0

  var i
  if (typeof val === 'number') {
    for (i = start; i < end; ++i) {
      this[i] = val
    }
  } else {
    var bytes = Buffer.isBuffer(val)
      ? val
      : new Buffer(val, encoding)
    var len = bytes.length
    for (i = 0; i < end - start; ++i) {
      this[i + start] = bytes[i % len]
    }
  }

  return this
}

// HELPER FUNCTIONS
// ================

var INVALID_BASE64_RE = /[^+/0-9A-Za-z-_]/g

function base64clean (str) {
  // Node strips out invalid characters like \n and \t from the string, base64-js does not
  str = stringtrim(str).replace(INVALID_BASE64_RE, '')
  // Node converts strings with length < 2 to ''
  if (str.length < 2) return ''
  // Node allows for non-padded base64 strings (missing trailing ===), base64-js does not
  while (str.length % 4 !== 0) {
    str = str + '='
  }
  return str
}

function stringtrim (str) {
  if (str.trim) return str.trim()
  return str.replace(/^\s+|\s+$/g, '')
}

function toHex (n) {
  if (n < 16) return '0' + n.toString(16)
  return n.toString(16)
}

function utf8ToBytes (string, units) {
  units = units || Infinity
  var codePoint
  var length = string.length
  var leadSurrogate = null
  var bytes = []

  for (var i = 0; i < length; ++i) {
    codePoint = string.charCodeAt(i)

    // is surrogate component
    if (codePoint > 0xD7FF && codePoint < 0xE000) {
      // last char was a lead
      if (!leadSurrogate) {
        // no lead yet
        if (codePoint > 0xDBFF) {
          // unexpected trail
          if ((units -= 3) > -1) bytes.push(0xEF, 0xBF, 0xBD)
          continue
        } else if (i + 1 === length) {
          // unpaired lead
          if ((units -= 3) > -1) bytes.push(0xEF, 0xBF, 0xBD)
          continue
        }

        // valid lead
        leadSurrogate = codePoint

        continue
      }

      // 2 leads in a row
      if (codePoint < 0xDC00) {
        if ((units -= 3) > -1) bytes.push(0xEF, 0xBF, 0xBD)
        leadSurrogate = codePoint
        continue
      }

      // valid surrogate pair
      codePoint = (leadSurrogate - 0xD800 << 10 | codePoint - 0xDC00) + 0x10000
    } else if (leadSurrogate) {
      // valid bmp char, but last char was a lead
      if ((units -= 3) > -1) bytes.push(0xEF, 0xBF, 0xBD)
    }

    leadSurrogate = null

    // encode utf8
    if (codePoint < 0x80) {
      if ((units -= 1) < 0) break
      bytes.push(codePoint)
    } else if (codePoint < 0x800) {
      if ((units -= 2) < 0) break
      bytes.push(
        codePoint >> 0x6 | 0xC0,
        codePoint & 0x3F | 0x80
      )
    } else if (codePoint < 0x10000) {
      if ((units -= 3) < 0) break
      bytes.push(
        codePoint >> 0xC | 0xE0,
        codePoint >> 0x6 & 0x3F | 0x80,
        codePoint & 0x3F | 0x80
      )
    } else if (codePoint < 0x110000) {
      if ((units -= 4) < 0) break
      bytes.push(
        codePoint >> 0x12 | 0xF0,
        codePoint >> 0xC & 0x3F | 0x80,
        codePoint >> 0x6 & 0x3F | 0x80,
        codePoint & 0x3F | 0x80
      )
    } else {
      throw new Error('Invalid code point')
    }
  }

  return bytes
}

function asciiToBytes (str) {
  var byteArray = []
  for (var i = 0; i < str.length; ++i) {
    // Node's code seems to be doing this and not & 0x7F..
    byteArray.push(str.charCodeAt(i) & 0xFF)
  }
  return byteArray
}

function utf16leToBytes (str, units) {
  var c, hi, lo
  var byteArray = []
  for (var i = 0; i < str.length; ++i) {
    if ((units -= 2) < 0) break

    c = str.charCodeAt(i)
    hi = c >> 8
    lo = c % 256
    byteArray.push(lo)
    byteArray.push(hi)
  }

  return byteArray
}

function base64ToBytes (str) {
  return base64.toByteArray(base64clean(str))
}

function blitBuffer (src, dst, offset, length) {
  for (var i = 0; i < length; ++i) {
    if ((i + offset >= dst.length) || (i >= src.length)) break
    dst[i + offset] = src[i]
  }
  return i
}

function isnan (val) {
  return val !== val // eslint-disable-line no-self-compare
}

},{"base64-js":1,"ieee754":4}],4:[function(require,module,exports){
exports.read = function (buffer, offset, isLE, mLen, nBytes) {
  var e, m
  var eLen = nBytes * 8 - mLen - 1
  var eMax = (1 << eLen) - 1
  var eBias = eMax >> 1
  var nBits = -7
  var i = isLE ? (nBytes - 1) : 0
  var d = isLE ? -1 : 1
  var s = buffer[offset + i]

  i += d

  e = s & ((1 << (-nBits)) - 1)
  s >>= (-nBits)
  nBits += eLen
  for (; nBits > 0; e = e * 256 + buffer[offset + i], i += d, nBits -= 8) {}

  m = e & ((1 << (-nBits)) - 1)
  e >>= (-nBits)
  nBits += mLen
  for (; nBits > 0; m = m * 256 + buffer[offset + i], i += d, nBits -= 8) {}

  if (e === 0) {
    e = 1 - eBias
  } else if (e === eMax) {
    return m ? NaN : ((s ? -1 : 1) * Infinity)
  } else {
    m = m + Math.pow(2, mLen)
    e = e - eBias
  }
  return (s ? -1 : 1) * m * Math.pow(2, e - mLen)
}

exports.write = function (buffer, value, offset, isLE, mLen, nBytes) {
  var e, m, c
  var eLen = nBytes * 8 - mLen - 1
  var eMax = (1 << eLen) - 1
  var eBias = eMax >> 1
  var rt = (mLen === 23 ? Math.pow(2, -24) - Math.pow(2, -77) : 0)
  var i = isLE ? 0 : (nBytes - 1)
  var d = isLE ? 1 : -1
  var s = value < 0 || (value === 0 && 1 / value < 0) ? 1 : 0

  value = Math.abs(value)

  if (isNaN(value) || value === Infinity) {
    m = isNaN(value) ? 1 : 0
    e = eMax
  } else {
    e = Math.floor(Math.log(value) / Math.LN2)
    if (value * (c = Math.pow(2, -e)) < 1) {
      e--
      c *= 2
    }
    if (e + eBias >= 1) {
      value += rt / c
    } else {
      value += rt * Math.pow(2, 1 - eBias)
    }
    if (value * c >= 2) {
      e++
      c /= 2
    }

    if (e + eBias >= eMax) {
      m = 0
      e = eMax
    } else if (e + eBias >= 1) {
      m = (value * c - 1) * Math.pow(2, mLen)
      e = e + eBias
    } else {
      m = value * Math.pow(2, eBias - 1) * Math.pow(2, mLen)
      e = 0
    }
  }

  for (; mLen >= 8; buffer[offset + i] = m & 0xff, i += d, m /= 256, mLen -= 8) {}

  e = (e << mLen) | m
  eLen += mLen
  for (; eLen > 0; buffer[offset + i] = e & 0xff, i += d, e /= 256, eLen -= 8) {}

  buffer[offset + i - d] |= s * 128
}

},{}],5:[function(require,module,exports){
(function (global){
/*! https://mths.be/punycode v1.4.1 by @mathias */
;(function(root) {

	/** Detect free variables */
	var freeExports = typeof exports == 'object' && exports &&
		!exports.nodeType && exports;
	var freeModule = typeof module == 'object' && module &&
		!module.nodeType && module;
	var freeGlobal = typeof global == 'object' && global;
	if (
		freeGlobal.global === freeGlobal ||
		freeGlobal.window === freeGlobal ||
		freeGlobal.self === freeGlobal
	) {
		root = freeGlobal;
	}

	/**
	 * The `punycode` object.
	 * @name punycode
	 * @type Object
	 */
	var punycode,

	/** Highest positive signed 32-bit float value */
	maxInt = 2147483647, // aka. 0x7FFFFFFF or 2^31-1

	/** Bootstring parameters */
	base = 36,
	tMin = 1,
	tMax = 26,
	skew = 38,
	damp = 700,
	initialBias = 72,
	initialN = 128, // 0x80
	delimiter = '-', // '\x2D'

	/** Regular expressions */
	regexPunycode = /^xn--/,
	regexNonASCII = /[^\x20-\x7E]/, // unprintable ASCII chars + non-ASCII chars
	regexSeparators = /[\x2E\u3002\uFF0E\uFF61]/g, // RFC 3490 separators

	/** Error messages */
	errors = {
		'overflow': 'Overflow: input needs wider integers to process',
		'not-basic': 'Illegal input >= 0x80 (not a basic code point)',
		'invalid-input': 'Invalid input'
	},

	/** Convenience shortcuts */
	baseMinusTMin = base - tMin,
	floor = Math.floor,
	stringFromCharCode = String.fromCharCode,

	/** Temporary variable */
	key;

	/*--------------------------------------------------------------------------*/

	/**
	 * A generic error utility function.
	 * @private
	 * @param {String} type The error type.
	 * @returns {Error} Throws a `RangeError` with the applicable error message.
	 */
	function error(type) {
		throw new RangeError(errors[type]);
	}

	/**
	 * A generic `Array#map` utility function.
	 * @private
	 * @param {Array} array The array to iterate over.
	 * @param {Function} callback The function that gets called for every array
	 * item.
	 * @returns {Array} A new array of values returned by the callback function.
	 */
	function map(array, fn) {
		var length = array.length;
		var result = [];
		while (length--) {
			result[length] = fn(array[length]);
		}
		return result;
	}

	/**
	 * A simple `Array#map`-like wrapper to work with domain name strings or email
	 * addresses.
	 * @private
	 * @param {String} domain The domain name or email address.
	 * @param {Function} callback The function that gets called for every
	 * character.
	 * @returns {Array} A new string of characters returned by the callback
	 * function.
	 */
	function mapDomain(string, fn) {
		var parts = string.split('@');
		var result = '';
		if (parts.length > 1) {
			// In email addresses, only the domain name should be punycoded. Leave
			// the local part (i.e. everything up to `@`) intact.
			result = parts[0] + '@';
			string = parts[1];
		}
		// Avoid `split(regex)` for IE8 compatibility. See #17.
		string = string.replace(regexSeparators, '\x2E');
		var labels = string.split('.');
		var encoded = map(labels, fn).join('.');
		return result + encoded;
	}

	/**
	 * Creates an array containing the numeric code points of each Unicode
	 * character in the string. While JavaScript uses UCS-2 internally,
	 * this function will convert a pair of surrogate halves (each of which
	 * UCS-2 exposes as separate characters) into a single code point,
	 * matching UTF-16.
	 * @see `punycode.ucs2.encode`
	 * @see <https://mathiasbynens.be/notes/javascript-encoding>
	 * @memberOf punycode.ucs2
	 * @name decode
	 * @param {String} string The Unicode input string (UCS-2).
	 * @returns {Array} The new array of code points.
	 */
	function ucs2decode(string) {
		var output = [],
		    counter = 0,
		    length = string.length,
		    value,
		    extra;
		while (counter < length) {
			value = string.charCodeAt(counter++);
			if (value >= 0xD800 && value <= 0xDBFF && counter < length) {
				// high surrogate, and there is a next character
				extra = string.charCodeAt(counter++);
				if ((extra & 0xFC00) == 0xDC00) { // low surrogate
					output.push(((value & 0x3FF) << 10) + (extra & 0x3FF) + 0x10000);
				} else {
					// unmatched surrogate; only append this code unit, in case the next
					// code unit is the high surrogate of a surrogate pair
					output.push(value);
					counter--;
				}
			} else {
				output.push(value);
			}
		}
		return output;
	}

	/**
	 * Creates a string based on an array of numeric code points.
	 * @see `punycode.ucs2.decode`
	 * @memberOf punycode.ucs2
	 * @name encode
	 * @param {Array} codePoints The array of numeric code points.
	 * @returns {String} The new Unicode string (UCS-2).
	 */
	function ucs2encode(array) {
		return map(array, function(value) {
			var output = '';
			if (value > 0xFFFF) {
				value -= 0x10000;
				output += stringFromCharCode(value >>> 10 & 0x3FF | 0xD800);
				value = 0xDC00 | value & 0x3FF;
			}
			output += stringFromCharCode(value);
			return output;
		}).join('');
	}

	/**
	 * Converts a basic code point into a digit/integer.
	 * @see `digitToBasic()`
	 * @private
	 * @param {Number} codePoint The basic numeric code point value.
	 * @returns {Number} The numeric value of a basic code point (for use in
	 * representing integers) in the range `0` to `base - 1`, or `base` if
	 * the code point does not represent a value.
	 */
	function basicToDigit(codePoint) {
		if (codePoint - 48 < 10) {
			return codePoint - 22;
		}
		if (codePoint - 65 < 26) {
			return codePoint - 65;
		}
		if (codePoint - 97 < 26) {
			return codePoint - 97;
		}
		return base;
	}

	/**
	 * Converts a digit/integer into a basic code point.
	 * @see `basicToDigit()`
	 * @private
	 * @param {Number} digit The numeric value of a basic code point.
	 * @returns {Number} The basic code point whose value (when used for
	 * representing integers) is `digit`, which needs to be in the range
	 * `0` to `base - 1`. If `flag` is non-zero, the uppercase form is
	 * used; else, the lowercase form is used. The behavior is undefined
	 * if `flag` is non-zero and `digit` has no uppercase form.
	 */
	function digitToBasic(digit, flag) {
		//  0..25 map to ASCII a..z or A..Z
		// 26..35 map to ASCII 0..9
		return digit + 22 + 75 * (digit < 26) - ((flag != 0) << 5);
	}

	/**
	 * Bias adaptation function as per section 3.4 of RFC 3492.
	 * https://tools.ietf.org/html/rfc3492#section-3.4
	 * @private
	 */
	function adapt(delta, numPoints, firstTime) {
		var k = 0;
		delta = firstTime ? floor(delta / damp) : delta >> 1;
		delta += floor(delta / numPoints);
		for (/* no initialization */; delta > baseMinusTMin * tMax >> 1; k += base) {
			delta = floor(delta / baseMinusTMin);
		}
		return floor(k + (baseMinusTMin + 1) * delta / (delta + skew));
	}

	/**
	 * Converts a Punycode string of ASCII-only symbols to a string of Unicode
	 * symbols.
	 * @memberOf punycode
	 * @param {String} input The Punycode string of ASCII-only symbols.
	 * @returns {String} The resulting string of Unicode symbols.
	 */
	function decode(input) {
		// Don't use UCS-2
		var output = [],
		    inputLength = input.length,
		    out,
		    i = 0,
		    n = initialN,
		    bias = initialBias,
		    basic,
		    j,
		    index,
		    oldi,
		    w,
		    k,
		    digit,
		    t,
		    /** Cached calculation results */
		    baseMinusT;

		// Handle the basic code points: let `basic` be the number of input code
		// points before the last delimiter, or `0` if there is none, then copy
		// the first basic code points to the output.

		basic = input.lastIndexOf(delimiter);
		if (basic < 0) {
			basic = 0;
		}

		for (j = 0; j < basic; ++j) {
			// if it's not a basic code point
			if (input.charCodeAt(j) >= 0x80) {
				error('not-basic');
			}
			output.push(input.charCodeAt(j));
		}

		// Main decoding loop: start just after the last delimiter if any basic code
		// points were copied; start at the beginning otherwise.

		for (index = basic > 0 ? basic + 1 : 0; index < inputLength; /* no final expression */) {

			// `index` is the index of the next character to be consumed.
			// Decode a generalized variable-length integer into `delta`,
			// which gets added to `i`. The overflow checking is easier
			// if we increase `i` as we go, then subtract off its starting
			// value at the end to obtain `delta`.
			for (oldi = i, w = 1, k = base; /* no condition */; k += base) {

				if (index >= inputLength) {
					error('invalid-input');
				}

				digit = basicToDigit(input.charCodeAt(index++));

				if (digit >= base || digit > floor((maxInt - i) / w)) {
					error('overflow');
				}

				i += digit * w;
				t = k <= bias ? tMin : (k >= bias + tMax ? tMax : k - bias);

				if (digit < t) {
					break;
				}

				baseMinusT = base - t;
				if (w > floor(maxInt / baseMinusT)) {
					error('overflow');
				}

				w *= baseMinusT;

			}

			out = output.length + 1;
			bias = adapt(i - oldi, out, oldi == 0);

			// `i` was supposed to wrap around from `out` to `0`,
			// incrementing `n` each time, so we'll fix that now:
			if (floor(i / out) > maxInt - n) {
				error('overflow');
			}

			n += floor(i / out);
			i %= out;

			// Insert `n` at position `i` of the output
			output.splice(i++, 0, n);

		}

		return ucs2encode(output);
	}

	/**
	 * Converts a string of Unicode symbols (e.g. a domain name label) to a
	 * Punycode string of ASCII-only symbols.
	 * @memberOf punycode
	 * @param {String} input The string of Unicode symbols.
	 * @returns {String} The resulting Punycode string of ASCII-only symbols.
	 */
	function encode(input) {
		var n,
		    delta,
		    handledCPCount,
		    basicLength,
		    bias,
		    j,
		    m,
		    q,
		    k,
		    t,
		    currentValue,
		    output = [],
		    /** `inputLength` will hold the number of code points in `input`. */
		    inputLength,
		    /** Cached calculation results */
		    handledCPCountPlusOne,
		    baseMinusT,
		    qMinusT;

		// Convert the input in UCS-2 to Unicode
		input = ucs2decode(input);

		// Cache the length
		inputLength = input.length;

		// Initialize the state
		n = initialN;
		delta = 0;
		bias = initialBias;

		// Handle the basic code points
		for (j = 0; j < inputLength; ++j) {
			currentValue = input[j];
			if (currentValue < 0x80) {
				output.push(stringFromCharCode(currentValue));
			}
		}

		handledCPCount = basicLength = output.length;

		// `handledCPCount` is the number of code points that have been handled;
		// `basicLength` is the number of basic code points.

		// Finish the basic string - if it is not empty - with a delimiter
		if (basicLength) {
			output.push(delimiter);
		}

		// Main encoding loop:
		while (handledCPCount < inputLength) {

			// All non-basic code points < n have been handled already. Find the next
			// larger one:
			for (m = maxInt, j = 0; j < inputLength; ++j) {
				currentValue = input[j];
				if (currentValue >= n && currentValue < m) {
					m = currentValue;
				}
			}

			// Increase `delta` enough to advance the decoder's <n,i> state to <m,0>,
			// but guard against overflow
			handledCPCountPlusOne = handledCPCount + 1;
			if (m - n > floor((maxInt - delta) / handledCPCountPlusOne)) {
				error('overflow');
			}

			delta += (m - n) * handledCPCountPlusOne;
			n = m;

			for (j = 0; j < inputLength; ++j) {
				currentValue = input[j];

				if (currentValue < n && ++delta > maxInt) {
					error('overflow');
				}

				if (currentValue == n) {
					// Represent delta as a generalized variable-length integer
					for (q = delta, k = base; /* no condition */; k += base) {
						t = k <= bias ? tMin : (k >= bias + tMax ? tMax : k - bias);
						if (q < t) {
							break;
						}
						qMinusT = q - t;
						baseMinusT = base - t;
						output.push(
							stringFromCharCode(digitToBasic(t + qMinusT % baseMinusT, 0))
						);
						q = floor(qMinusT / baseMinusT);
					}

					output.push(stringFromCharCode(digitToBasic(q, 0)));
					bias = adapt(delta, handledCPCountPlusOne, handledCPCount == basicLength);
					delta = 0;
					++handledCPCount;
				}
			}

			++delta;
			++n;

		}
		return output.join('');
	}

	/**
	 * Converts a Punycode string representing a domain name or an email address
	 * to Unicode. Only the Punycoded parts of the input will be converted, i.e.
	 * it doesn't matter if you call it on a string that has already been
	 * converted to Unicode.
	 * @memberOf punycode
	 * @param {String} input The Punycoded domain name or email address to
	 * convert to Unicode.
	 * @returns {String} The Unicode representation of the given Punycode
	 * string.
	 */
	function toUnicode(input) {
		return mapDomain(input, function(string) {
			return regexPunycode.test(string)
				? decode(string.slice(4).toLowerCase())
				: string;
		});
	}

	/**
	 * Converts a Unicode string representing a domain name or an email address to
	 * Punycode. Only the non-ASCII parts of the domain name will be converted,
	 * i.e. it doesn't matter if you call it with a domain that's already in
	 * ASCII.
	 * @memberOf punycode
	 * @param {String} input The domain name or email address to convert, as a
	 * Unicode string.
	 * @returns {String} The Punycode representation of the given domain name or
	 * email address.
	 */
	function toASCII(input) {
		return mapDomain(input, function(string) {
			return regexNonASCII.test(string)
				? 'xn--' + encode(string)
				: string;
		});
	}

	/*--------------------------------------------------------------------------*/

	/** Define the public API */
	punycode = {
		/**
		 * A string representing the current Punycode.js version number.
		 * @memberOf punycode
		 * @type String
		 */
		'version': '1.4.1',
		/**
		 * An object of methods to convert from JavaScript's internal character
		 * representation (UCS-2) to Unicode code points, and back.
		 * @see <https://mathiasbynens.be/notes/javascript-encoding>
		 * @memberOf punycode
		 * @type Object
		 */
		'ucs2': {
			'decode': ucs2decode,
			'encode': ucs2encode
		},
		'decode': decode,
		'encode': encode,
		'toASCII': toASCII,
		'toUnicode': toUnicode
	};

	/** Expose `punycode` */
	// Some AMD build optimizers, like r.js, check for specific condition patterns
	// like the following:
	if (
		typeof define == 'function' &&
		typeof define.amd == 'object' &&
		define.amd
	) {
		define('punycode', function() {
			return punycode;
		});
	} else if (freeExports && freeModule) {
		if (module.exports == freeExports) {
			// in Node.js, io.js, or RingoJS v0.8.0+
			freeModule.exports = punycode;
		} else {
			// in Narwhal or RingoJS v0.7.0-
			for (key in punycode) {
				punycode.hasOwnProperty(key) && (freeExports[key] = punycode[key]);
			}
		}
	} else {
		// in Rhino or a web browser
		root.punycode = punycode;
	}

}(this));

}).call(this,typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {})
},{}],6:[function(require,module,exports){
var javascriptserialize = require('javascript-serialize')
var escapehtml = require('escape-html')
var jsbeautify = require('js-beautify')
var type = require('component-type')
var bel = require('bel')
var csjs = require('csjs-inject')

var currentError

window.addEventListener('error', function (event) {
  currentError = new Error(event.message)
  currentError.timeStamp = event.timeStamp
  currentError.isTrusted = event.isTrusted
  currentError.filename = event.filename
  currentError.lineno = event.lineno
  currentError.colno = event.colno
  currentError.error = event.error
  currentError.type = event.type
})

window.onerror = function (msg, url, lineno, col, error) {
  error = error ? error : currentError
  var val = { msg: msg, url: url, lineno: lineno, col: col, error: error }
  console.error(val)
}

var KONSOLES = [{
  error       : console.error.bind(console),
  info        : console.info.bind(console),
  log         : console.log.bind(console)
}]
console.error = broadcast('error')
console.info = broadcast('info')
console.log = broadcast('log')

function broadcast (mode) {
  return function broadcastMode () {
    var args = arguments
    KONSOLES.forEach(function (api) { api[mode].apply(null, args) })
  }
}

module.exports = domconsole

var css = csjs`
  .wrapper            {
    position          : fixed;
    box-sizing        : border-box;
    background-color  : black;
    padding           : 15px 20px 15px 20px;
    border-radius     : 15px;
    bottom            : 0;
    width             : 98%;
    min-height        : 50px;
    display           : flex;
    flex-direction    : column;
  }
  @media screen and (min-width: 0px) {
    .konsole          {
      font-size       : calc(0.5em + 1vmin);
    }
  }
  .konsole            {
    font-family       : Courier;
    color             : white;
    overflow-y        : scroll;
    overflow          : auto;
    height            : 45vh;
    margin-bottom     : 30px;
  }
  .line               {
    margin            : 0;
    line-height       : 1.5em;
  }
  .seperator          {
    border            : 1px dashed #333
  }
  .error              {
    color             : red;
  }
  .info               {
    color             : blue;
  }
  .log                {
    color             : white;
  }
  .nav                {
    display           : flex;
    position          : absolute;
    bottom            : 0;
    padding-bottom    : 15px;
  }
  .btn                {
    margin-right      : 10px;
  }
  .dashboard          {
    display           : flex;
  }
  .stats              {
    padding           : 1px 10px;
    margin-left       : 10px;
    background-color  : white;
    color             : black;
    border-radius     : 5px;
  }
  .errorstats         {
    background-color  : red;
  }
  .infostats          {
    background-color  : blue;
  }
  .logstats           {
    background-color  : white;
  }
  .hidden             {
    display           : none;
  }
`

function domconsole (opts) {
  if (!opts) opts = { auto: true }
  if (!opts.lineLength) opts.lineLength = 60

  var konsole = bel`<div class=${css.konsole}></div>`
  var bToggle = bel`<button onclick=${flip} class=${css.btn}>minimize</button>`
  var error   = bel`
    <div title="error" class="${css.errorstats} ${css.stats}">0</div>
  `
  var info    = bel`
    <div title="info" class="${css.infostats} ${css.stats}">0</div>
  `
  var log     = bel`
    <div title="log" class="${css.logstats} ${css.stats}">0</div>
  `
  var stats   = bel`
    <div class="${css.dashboard} ${css.hidden}">
     ${error} ${info} ${log}
    </div>
  `
  stats.log   = log
  stats.info  = info
  stats.error = error
  var wrapper = bel`
    <div class=${css.wrapper}>
      ${konsole}
      <div class=${css.nav}>
        <button onclick=${cleanse} class=${css.btn}> clear </button>
        ${bToggle}
        ${stats}
      </div>
    </div>
  `

  var dispatch = dispatcher(konsole, stats, opts)

  var api = {
    log         : dispatch('log'),
    info        : dispatch('info'),
    error       : dispatch('error'),
    toggle      : flip,
    clear       : cleanse,
    serialize   : function serializeKonsole () { return konsole.innerText }
  }
  wrapper.api = api

  register(api)

  if (opts.auto) {
    flip() // start minimized
    document.body.appendChild(wrapper)
  }

  return wrapper

  function hide () {
    error.innerHTML = info.innerHTML = log.innerHTML = 0
    error.style.visibility = 'hidden'
    info.style.visibility = 'hidden'
    log.style.visibility = 'hidden'
  }
  function flip () {
    var hidden = konsole.classList.toggle(css.hidden)
    if (hidden) hide()
    stats.classList.toggle(css.hidden)
    bToggle.innerHTML = hidden ? 'expand' : 'minimize'
  }
  function cleanse () {
    konsole.innerHTML = ''
    hide()
  }
}

function register (api) { KONSOLES.push(api) }

function dispatcher (konsole, stats, opts) {
  return function dispatch (mode) {
    return function logger () {
      if (this !== window) KONSOLES[0][mode].apply(null, arguments)
      var types = [].slice.call(arguments).map(type)
      var isHidden = konsole.classList.contains(css.hidden)
      javascriptserialize.apply(null, arguments).forEach(function (val, idx) {
        if (types[idx] === 'element') val = jsbeautify.html(val)
        var lines = val.match(new RegExp('.{1,' + opts.lineLength + '}', 'g'))
        lines.forEach(function (line) {
          var el = bel`<pre class="${css.line} ${css[mode]}">${line}</pre>`
          konsole.appendChild(el)
        })
        var sep = bel`<hr class=${css.seperator}>`
        konsole.appendChild(sep)
        if (isHidden) {
          stats[mode].innerHTML = (stats[mode].innerHTML|0) + 1
          stats[mode].style.visibility = ''
        } else {
          sep.scrollIntoView()
        }
      })
    }
  }
}

},{"bel":7,"component-type":9,"csjs-inject":12,"escape-html":33,"javascript-serialize":41,"js-beautify":42}],7:[function(require,module,exports){
var document = require('global/document')
var hyperx = require('hyperx')
var onload = require('on-load')

var SVGNS = 'http://www.w3.org/2000/svg'
var XLINKNS = 'http://www.w3.org/1999/xlink'

var BOOL_PROPS = {
  autofocus: 1,
  checked: 1,
  defaultchecked: 1,
  disabled: 1,
  formnovalidate: 1,
  indeterminate: 1,
  readonly: 1,
  required: 1,
  selected: 1,
  willvalidate: 1
}
var COMMENT_TAG = '!--'
var SVG_TAGS = [
  'svg',
  'altGlyph', 'altGlyphDef', 'altGlyphItem', 'animate', 'animateColor',
  'animateMotion', 'animateTransform', 'circle', 'clipPath', 'color-profile',
  'cursor', 'defs', 'desc', 'ellipse', 'feBlend', 'feColorMatrix',
  'feComponentTransfer', 'feComposite', 'feConvolveMatrix', 'feDiffuseLighting',
  'feDisplacementMap', 'feDistantLight', 'feFlood', 'feFuncA', 'feFuncB',
  'feFuncG', 'feFuncR', 'feGaussianBlur', 'feImage', 'feMerge', 'feMergeNode',
  'feMorphology', 'feOffset', 'fePointLight', 'feSpecularLighting',
  'feSpotLight', 'feTile', 'feTurbulence', 'filter', 'font', 'font-face',
  'font-face-format', 'font-face-name', 'font-face-src', 'font-face-uri',
  'foreignObject', 'g', 'glyph', 'glyphRef', 'hkern', 'image', 'line',
  'linearGradient', 'marker', 'mask', 'metadata', 'missing-glyph', 'mpath',
  'path', 'pattern', 'polygon', 'polyline', 'radialGradient', 'rect',
  'set', 'stop', 'switch', 'symbol', 'text', 'textPath', 'title', 'tref',
  'tspan', 'use', 'view', 'vkern'
]

function belCreateElement (tag, props, children) {
  var el

  // If an svg tag, it needs a namespace
  if (SVG_TAGS.indexOf(tag) !== -1) {
    props.namespace = SVGNS
  }

  // If we are using a namespace
  var ns = false
  if (props.namespace) {
    ns = props.namespace
    delete props.namespace
  }

  // Create the element
  if (ns) {
    el = document.createElementNS(ns, tag)
  } else if (tag === COMMENT_TAG) {
    return document.createComment(props.comment)
  } else {
    el = document.createElement(tag)
  }

  // If adding onload events
  if (props.onload || props.onunload) {
    var load = props.onload || function () {}
    var unload = props.onunload || function () {}
    onload(el, function belOnload () {
      load(el)
    }, function belOnunload () {
      unload(el)
    },
    // We have to use non-standard `caller` to find who invokes `belCreateElement`
    belCreateElement.caller.caller.caller)
    delete props.onload
    delete props.onunload
  }

  // Create the properties
  for (var p in props) {
    if (props.hasOwnProperty(p)) {
      var key = p.toLowerCase()
      var val = props[p]
      // Normalize className
      if (key === 'classname') {
        key = 'class'
        p = 'class'
      }
      // The for attribute gets transformed to htmlFor, but we just set as for
      if (p === 'htmlFor') {
        p = 'for'
      }
      // If a property is boolean, set itself to the key
      if (BOOL_PROPS[key]) {
        if (val === 'true') val = key
        else if (val === 'false') continue
      }
      // If a property prefers being set directly vs setAttribute
      if (key.slice(0, 2) === 'on') {
        el[p] = val
      } else {
        if (ns) {
          if (p === 'xlink:href') {
            el.setAttributeNS(XLINKNS, p, val)
          } else if (/^xmlns($|:)/i.test(p)) {
            // skip xmlns definitions
          } else {
            el.setAttributeNS(null, p, val)
          }
        } else {
          el.setAttribute(p, val)
        }
      }
    }
  }

  function appendChild (childs) {
    if (!Array.isArray(childs)) return
    for (var i = 0; i < childs.length; i++) {
      var node = childs[i]
      if (Array.isArray(node)) {
        appendChild(node)
        continue
      }

      if (typeof node === 'number' ||
        typeof node === 'boolean' ||
        typeof node === 'function' ||
        node instanceof Date ||
        node instanceof RegExp) {
        node = node.toString()
      }

      if (typeof node === 'string') {
        if (el.lastChild && el.lastChild.nodeName === '#text') {
          el.lastChild.nodeValue += node
          continue
        }
        node = document.createTextNode(node)
      }

      if (node && node.nodeType) {
        el.appendChild(node)
      }
    }
  }
  appendChild(children)

  return el
}

module.exports = hyperx(belCreateElement, {comments: true})
module.exports.default = module.exports
module.exports.createElement = belCreateElement

},{"global/document":36,"hyperx":39,"on-load":46}],8:[function(require,module,exports){
/*!
Copyright (C) 2013 by WebReflection

Permission is hereby granted, free of charge, to any person obtaining a copy
of this software and associated documentation files (the "Software"), to deal
in the Software without restriction, including without limitation the rights
to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
copies of the Software, and to permit persons to whom the Software is
furnished to do so, subject to the following conditions:

The above copyright notice and this permission notice shall be included in
all copies or substantial portions of the Software.

THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
THE SOFTWARE.

*/
var
  // should be a not so common char
  // possibly one JSON does not encode
  // possibly one encodeURIComponent does not encode
  // right now this char is '~' but this might change in the future
  specialChar = '~',
  safeSpecialChar = '\\x' + (
    '0' + specialChar.charCodeAt(0).toString(16)
  ).slice(-2),
  escapedSafeSpecialChar = '\\' + safeSpecialChar,
  specialCharRG = new RegExp(safeSpecialChar, 'g'),
  safeSpecialCharRG = new RegExp(escapedSafeSpecialChar, 'g'),

  safeStartWithSpecialCharRG = new RegExp('(?:^|([^\\\\]))' + escapedSafeSpecialChar),

  indexOf = [].indexOf || function(v){
    for(var i=this.length;i--&&this[i]!==v;);
    return i;
  },
  $String = String  // there's no way to drop warnings in JSHint
                    // about new String ... well, I need that here!
                    // faked, and happy linter!
;

function generateReplacer(value, replacer, resolve) {
  var
    path = [],
    all  = [value],
    seen = [value],
    mapp = [resolve ? specialChar : '[Circular]'],
    last = value,
    lvl  = 1,
    i
  ;
  return function(key, value) {
    // the replacer has rights to decide
    // if a new object should be returned
    // or if there's some key to drop
    // let's call it here rather than "too late"
    if (replacer) value = replacer.call(this, key, value);

    // did you know ? Safari passes keys as integers for arrays
    // which means if (key) when key === 0 won't pass the check
    if (key !== '') {
      if (last !== this) {
        i = lvl - indexOf.call(all, this) - 1;
        lvl -= i;
        all.splice(lvl, all.length);
        path.splice(lvl - 1, path.length);
        last = this;
      }
      // console.log(lvl, key, path);
      if (typeof value === 'object' && value) {
    	// if object isn't referring to parent object, add to the
        // object path stack. Otherwise it is already there.
        if (indexOf.call(all, value) < 0) {
          all.push(last = value);
        }
        lvl = all.length;
        i = indexOf.call(seen, value);
        if (i < 0) {
          i = seen.push(value) - 1;
          if (resolve) {
            // key cannot contain specialChar but could be not a string
            path.push(('' + key).replace(specialCharRG, safeSpecialChar));
            mapp[i] = specialChar + path.join(specialChar);
          } else {
            mapp[i] = mapp[0];
          }
        } else {
          value = mapp[i];
        }
      } else {
        if (typeof value === 'string' && resolve) {
          // ensure no special char involved on deserialization
          // in this case only first char is important
          // no need to replace all value (better performance)
          value = value .replace(safeSpecialChar, escapedSafeSpecialChar)
                        .replace(specialChar, safeSpecialChar);
        }
      }
    }
    return value;
  };
}

function retrieveFromPath(current, keys) {
  for(var i = 0, length = keys.length; i < length; current = current[
    // keys should be normalized back here
    keys[i++].replace(safeSpecialCharRG, specialChar)
  ]);
  return current;
}

function generateReviver(reviver) {
  return function(key, value) {
    var isString = typeof value === 'string';
    if (isString && value.charAt(0) === specialChar) {
      return new $String(value.slice(1));
    }
    if (key === '') value = regenerate(value, value, {});
    // again, only one needed, do not use the RegExp for this replacement
    // only keys need the RegExp
    if (isString) value = value .replace(safeStartWithSpecialCharRG, '$1' + specialChar)
                                .replace(escapedSafeSpecialChar, safeSpecialChar);
    return reviver ? reviver.call(this, key, value) : value;
  };
}

function regenerateArray(root, current, retrieve) {
  for (var i = 0, length = current.length; i < length; i++) {
    current[i] = regenerate(root, current[i], retrieve);
  }
  return current;
}

function regenerateObject(root, current, retrieve) {
  for (var key in current) {
    if (current.hasOwnProperty(key)) {
      current[key] = regenerate(root, current[key], retrieve);
    }
  }
  return current;
}

function regenerate(root, current, retrieve) {
  return current instanceof Array ?
    // fast Array reconstruction
    regenerateArray(root, current, retrieve) :
    (
      current instanceof $String ?
        (
          // root is an empty string
          current.length ?
            (
              retrieve.hasOwnProperty(current) ?
                retrieve[current] :
                retrieve[current] = retrieveFromPath(
                  root, current.split(specialChar)
                )
            ) :
            root
        ) :
        (
          current instanceof Object ?
            // dedicated Object parser
            regenerateObject(root, current, retrieve) :
            // value as it is
            current
        )
    )
  ;
}

function stringifyRecursion(value, replacer, space, doNotResolve) {
  return JSON.stringify(value, generateReplacer(value, replacer, !doNotResolve), space);
}

function parseRecursion(text, reviver) {
  return JSON.parse(text, generateReviver(reviver));
}
this.stringify = stringifyRecursion;
this.parse = parseRecursion;
},{}],9:[function(require,module,exports){
(function (Buffer){
/**
 * toString ref.
 */

var toString = Object.prototype.toString;

/**
 * Return the type of `val`.
 *
 * @param {Mixed} val
 * @return {String}
 * @api public
 */

module.exports = function(val){
  switch (toString.call(val)) {
    case '[object Date]': return 'date';
    case '[object RegExp]': return 'regexp';
    case '[object Arguments]': return 'arguments';
    case '[object Array]': return 'array';
    case '[object Error]': return 'error';
  }

  if (val === null) return 'null';
  if (val === undefined) return 'undefined';
  if (val !== val) return 'nan';
  if (val && val.nodeType === 1) return 'element';

  if (typeof Buffer != 'undefined' && Buffer.isBuffer(val)) return 'buffer';

  val = val.valueOf
    ? val.valueOf()
    : Object.prototype.valueOf.apply(val)

  return typeof val;
};

}).call(this,require("buffer").Buffer)
},{"buffer":3}],10:[function(require,module,exports){
(function (global){
'use strict';

var csjs = require('csjs');
var insertCss = require('insert-css');

function csjsInserter() {
  var args = Array.prototype.slice.call(arguments);
  var result = csjs.apply(null, args);
  if (global.document) {
    insertCss(csjs.getCss(result));
  }
  return result;
}

module.exports = csjsInserter;

}).call(this,typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {})
},{"csjs":15,"insert-css":40}],11:[function(require,module,exports){
'use strict';

module.exports = require('csjs/get-css');

},{"csjs/get-css":14}],12:[function(require,module,exports){
'use strict';

var csjs = require('./csjs');

module.exports = csjs;
module.exports.csjs = csjs;
module.exports.getCss = require('./get-css');

},{"./csjs":10,"./get-css":11}],13:[function(require,module,exports){
'use strict';

module.exports = require('./lib/csjs');

},{"./lib/csjs":19}],14:[function(require,module,exports){
'use strict';

module.exports = require('./lib/get-css');

},{"./lib/get-css":23}],15:[function(require,module,exports){
'use strict';

var csjs = require('./csjs');

module.exports = csjs();
module.exports.csjs = csjs;
module.exports.noScope = csjs({ noscope: true });
module.exports.getCss = require('./get-css');

},{"./csjs":13,"./get-css":14}],16:[function(require,module,exports){
'use strict';

/**
 * base62 encode implementation based on base62 module:
 * https://github.com/andrew/base62.js
 */

var CHARS = '0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ';

module.exports = function encode(integer) {
  if (integer === 0) {
    return '0';
  }
  var str = '';
  while (integer > 0) {
    str = CHARS[integer % 62] + str;
    integer = Math.floor(integer / 62);
  }
  return str;
};

},{}],17:[function(require,module,exports){
'use strict';

var makeComposition = require('./composition').makeComposition;

module.exports = function createExports(classes, keyframes, compositions) {
  var keyframesObj = Object.keys(keyframes).reduce(function(acc, key) {
    var val = keyframes[key];
    acc[val] = makeComposition([key], [val], true);
    return acc;
  }, {});

  var exports = Object.keys(classes).reduce(function(acc, key) {
    var val = classes[key];
    var composition = compositions[key];
    var extended = composition ? getClassChain(composition) : [];
    var allClasses = [key].concat(extended);
    var unscoped = allClasses.map(function(name) {
      return classes[name] ? classes[name] : name;
    });
    acc[val] = makeComposition(allClasses, unscoped);
    return acc;
  }, keyframesObj);

  return exports;
}

function getClassChain(obj) {
  var visited = {}, acc = [];

  function traverse(obj) {
    return Object.keys(obj).forEach(function(key) {
      if (!visited[key]) {
        visited[key] = true;
        acc.push(key);
        traverse(obj[key]);
      }
    });
  }

  traverse(obj);
  return acc;
}

},{"./composition":18}],18:[function(require,module,exports){
'use strict';

module.exports = {
  makeComposition: makeComposition,
  isComposition: isComposition,
  ignoreComposition: ignoreComposition
};

/**
 * Returns an immutable composition object containing the given class names
 * @param  {array} classNames - The input array of class names
 * @return {Composition}      - An immutable object that holds multiple
 *                              representations of the class composition
 */
function makeComposition(classNames, unscoped, isAnimation) {
  var classString = classNames.join(' ');
  return Object.create(Composition.prototype, {
    classNames: { // the original array of class names
      value: Object.freeze(classNames),
      configurable: false,
      writable: false,
      enumerable: true
    },
    unscoped: { // the original array of class names
      value: Object.freeze(unscoped),
      configurable: false,
      writable: false,
      enumerable: true
    },
    className: { // space-separated class string for use in HTML
      value: classString,
      configurable: false,
      writable: false,
      enumerable: true
    },
    selector: { // comma-separated, period-prefixed string for use in CSS
      value: classNames.map(function(name) {
        return isAnimation ? name : '.' + name;
      }).join(', '),
      configurable: false,
      writable: false,
      enumerable: true
    },
    toString: { // toString() method, returns class string for use in HTML
      value: function() {
        return classString;
      },
      configurable: false,
      writeable: false,
      enumerable: false
    }
  });
}

/**
 * Returns whether the input value is a Composition
 * @param value      - value to check
 * @return {boolean} - whether value is a Composition or not
 */
function isComposition(value) {
  return value instanceof Composition;
}

function ignoreComposition(values) {
  return values.reduce(function(acc, val) {
    if (isComposition(val)) {
      val.classNames.forEach(function(name, i) {
        acc[name] = val.unscoped[i];
      });
    }
    return acc;
  }, {});
}

/**
 * Private constructor for use in `instanceof` checks
 */
function Composition() {}

},{}],19:[function(require,module,exports){
'use strict';

var extractExtends = require('./css-extract-extends');
var composition = require('./composition');
var isComposition = composition.isComposition;
var ignoreComposition = composition.ignoreComposition;
var buildExports = require('./build-exports');
var scopify = require('./scopeify');
var cssKey = require('./css-key');
var extractExports = require('./extract-exports');

module.exports = function csjsTemplate(opts) {
  opts = (typeof opts === 'undefined') ? {} : opts;
  var noscope = (typeof opts.noscope === 'undefined') ? false : opts.noscope;

  return function csjsHandler(strings, values) {
    // Fast path to prevent arguments deopt
    var values = Array(arguments.length - 1);
    for (var i = 1; i < arguments.length; i++) {
      values[i - 1] = arguments[i];
    }
    var css = joiner(strings, values.map(selectorize));
    var ignores = ignoreComposition(values);

    var scope = noscope ? extractExports(css) : scopify(css, ignores);
    var extracted = extractExtends(scope.css);
    var localClasses = without(scope.classes, ignores);
    var localKeyframes = without(scope.keyframes, ignores);
    var compositions = extracted.compositions;

    var exports = buildExports(localClasses, localKeyframes, compositions);

    return Object.defineProperty(exports, cssKey, {
      enumerable: false,
      configurable: false,
      writeable: false,
      value: extracted.css
    });
  }
}

/**
 * Replaces class compositions with comma seperated class selectors
 * @param  value - the potential class composition
 * @return       - the original value or the selectorized class composition
 */
function selectorize(value) {
  return isComposition(value) ? value.selector : value;
}

/**
 * Joins template string literals and values
 * @param  {array} strings - array of strings
 * @param  {array} values  - array of values
 * @return {string}        - strings and values joined
 */
function joiner(strings, values) {
  return strings.map(function(str, i) {
    return (i !== values.length) ? str + values[i] : str;
  }).join('');
}

/**
 * Returns first object without keys of second
 * @param  {object} obj      - source object
 * @param  {object} unwanted - object with unwanted keys
 * @return {object}          - first object without unwanted keys
 */
function without(obj, unwanted) {
  return Object.keys(obj).reduce(function(acc, key) {
    if (!unwanted[key]) {
      acc[key] = obj[key];
    }
    return acc;
  }, {});
}

},{"./build-exports":17,"./composition":18,"./css-extract-extends":20,"./css-key":21,"./extract-exports":22,"./scopeify":28}],20:[function(require,module,exports){
'use strict';

var makeComposition = require('./composition').makeComposition;

var regex = /\.([^\s]+)(\s+)(extends\s+)(\.[^{]+)/g;

module.exports = function extractExtends(css) {
  var found, matches = [];
  while (found = regex.exec(css)) {
    matches.unshift(found);
  }

  function extractCompositions(acc, match) {
    var extendee = getClassName(match[1]);
    var keyword = match[3];
    var extended = match[4];

    // remove from output css
    var index = match.index + match[1].length + match[2].length;
    var len = keyword.length + extended.length;
    acc.css = acc.css.slice(0, index) + " " + acc.css.slice(index + len + 1);

    var extendedClasses = splitter(extended);

    extendedClasses.forEach(function(className) {
      if (!acc.compositions[extendee]) {
        acc.compositions[extendee] = {};
      }
      if (!acc.compositions[className]) {
        acc.compositions[className] = {};
      }
      acc.compositions[extendee][className] = acc.compositions[className];
    });
    return acc;
  }

  return matches.reduce(extractCompositions, {
    css: css,
    compositions: {}
  });

};

function splitter(match) {
  return match.split(',').map(getClassName);
}

function getClassName(str) {
  var trimmed = str.trim();
  return trimmed[0] === '.' ? trimmed.substr(1) : trimmed;
}

},{"./composition":18}],21:[function(require,module,exports){
'use strict';

/**
 * CSS identifiers with whitespace are invalid
 * Hence this key will not cause a collision
 */

module.exports = ' css ';

},{}],22:[function(require,module,exports){
'use strict';

var regex = require('./regex');
var classRegex = regex.classRegex;
var keyframesRegex = regex.keyframesRegex;

module.exports = extractExports;

function extractExports(css) {
  return {
    css: css,
    keyframes: getExport(css, keyframesRegex),
    classes: getExport(css, classRegex)
  };
}

function getExport(css, regex) {
  var prop = {};
  var match;
  while((match = regex.exec(css)) !== null) {
    var name = match[2];
    prop[name] = name;
  }
  return prop;
}

},{"./regex":25}],23:[function(require,module,exports){
'use strict';

var cssKey = require('./css-key');

module.exports = function getCss(csjs) {
  return csjs[cssKey];
};

},{"./css-key":21}],24:[function(require,module,exports){
'use strict';

/**
 * djb2 string hash implementation based on string-hash module:
 * https://github.com/darkskyapp/string-hash
 */

module.exports = function hashStr(str) {
  var hash = 5381;
  var i = str.length;

  while (i) {
    hash = (hash * 33) ^ str.charCodeAt(--i)
  }
  return hash >>> 0;
};

},{}],25:[function(require,module,exports){
'use strict';

var findClasses = /(\.)(?!\d)([^\s\.,{\[>+~#:)]*)(?![^{]*})/.source;
var findKeyframes = /(@\S*keyframes\s*)([^{\s]*)/.source;
var ignoreComments = /(?!(?:[^*/]|\*[^/]|\/[^*])*\*+\/)/.source;

var classRegex = new RegExp(findClasses + ignoreComments, 'g');
var keyframesRegex = new RegExp(findKeyframes + ignoreComments, 'g');

module.exports = {
  classRegex: classRegex,
  keyframesRegex: keyframesRegex,
  ignoreComments: ignoreComments,
};

},{}],26:[function(require,module,exports){
var ignoreComments = require('./regex').ignoreComments;

module.exports = replaceAnimations;

function replaceAnimations(result) {
  var animations = Object.keys(result.keyframes).reduce(function(acc, key) {
    acc[result.keyframes[key]] = key;
    return acc;
  }, {});
  var unscoped = Object.keys(animations);

  if (unscoped.length) {
    var regexStr = '((?:animation|animation-name)\\s*:[^};]*)('
      + unscoped.join('|') + ')([;\\s])' + ignoreComments;
    var regex = new RegExp(regexStr, 'g');

    var replaced = result.css.replace(regex, function(match, preamble, name, ending) {
      return preamble + animations[name] + ending;
    });

    return {
      css: replaced,
      keyframes: result.keyframes,
      classes: result.classes
    }
  }

  return result;
}

},{"./regex":25}],27:[function(require,module,exports){
'use strict';

var encode = require('./base62-encode');
var hash = require('./hash-string');

module.exports = function fileScoper(fileSrc) {
  var suffix = encode(hash(fileSrc));

  return function scopedName(name) {
    return name + '_' + suffix;
  }
};

},{"./base62-encode":16,"./hash-string":24}],28:[function(require,module,exports){
'use strict';

var fileScoper = require('./scoped-name');
var replaceAnimations = require('./replace-animations');
var regex = require('./regex');
var classRegex = regex.classRegex;
var keyframesRegex = regex.keyframesRegex;

module.exports = scopify;

function scopify(css, ignores) {
  var makeScopedName = fileScoper(css);
  var replacers = {
    classes: classRegex,
    keyframes: keyframesRegex
  };

  function scopeCss(result, key) {
    var replacer = replacers[key];
    function replaceFn(fullMatch, prefix, name) {
      var scopedName = ignores[name] ? name : makeScopedName(name);
      result[key][scopedName] = name;
      return prefix + scopedName;
    }
    return {
      css: result.css.replace(replacer, replaceFn),
      keyframes: result.keyframes,
      classes: result.classes
    };
  }

  var result = Object.keys(replacers).reduce(scopeCss, {
    css: css,
    keyframes: {},
    classes: {}
  });

  return replaceAnimations(result);
}

},{"./regex":25,"./replace-animations":26,"./scoped-name":27}],29:[function(require,module,exports){
(function (global){

var NativeCustomEvent = global.CustomEvent;

function useNative () {
  try {
    var p = new NativeCustomEvent('cat', { detail: { foo: 'bar' } });
    return  'cat' === p.type && 'bar' === p.detail.foo;
  } catch (e) {
  }
  return false;
}

/**
 * Cross-browser `CustomEvent` constructor.
 *
 * https://developer.mozilla.org/en-US/docs/Web/API/CustomEvent.CustomEvent
 *
 * @public
 */

module.exports = useNative() ? NativeCustomEvent :

// IE >= 9
'function' === typeof document.createEvent ? function CustomEvent (type, params) {
  var e = document.createEvent('CustomEvent');
  if (params) {
    e.initCustomEvent(type, params.bubbles, params.cancelable, params.detail);
  } else {
    e.initCustomEvent(type, false, false, void 0);
  }
  return e;
} :

// IE <= 8
function CustomEvent (type, params) {
  var e = document.createEventObject();
  e.type = type;
  if (params) {
    e.bubbles = Boolean(params.bubbles);
    e.cancelable = Boolean(params.cancelable);
    e.detail = params.detail;
  } else {
    e.bubbles = false;
    e.cancelable = false;
    e.detail = void 0;
  }
  return e;
}

}).call(this,typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {})
},{}],30:[function(require,module,exports){

/**
 * Module dependencies.
 */

var extend = require('extend');
var encode = require('ent/encode');
var CustomEvent = require('custom-event');
var voidElements = require('void-elements');

/**
 * Module exports.
 */

exports = module.exports = serialize;
exports.serializeElement = serializeElement;
exports.serializeAttribute = serializeAttribute;
exports.serializeText = serializeText;
exports.serializeComment = serializeComment;
exports.serializeDocument = serializeDocument;
exports.serializeDoctype = serializeDoctype;
exports.serializeDocumentFragment = serializeDocumentFragment;
exports.serializeNodeList = serializeNodeList;

/**
 * Serializes any DOM node. Returns a string.
 *
 * @param {Node} node - DOM Node to serialize
 * @param {String} [context] - optional arbitrary "context" string to use (useful for event listeners)
 * @param {Function} [fn] - optional callback function to use in the "serialize" event for this call
 * @param {EventTarget} [eventTarget] - optional EventTarget instance to emit the "serialize" event on (defaults to `node`)
 * return {String}
 * @public
 */

function serialize (node, context, fn, eventTarget) {
  if (!node) return '';
  if ('function' === typeof context) {
    fn = context;
    context = null;
  }
  if (!context) context = null;

  var rtn;
  var nodeType = node.nodeType;

  if (!nodeType && 'number' === typeof node.length) {
    // assume it's a NodeList or Array of Nodes
    rtn = exports.serializeNodeList(node, context, fn);
  } else {

    if ('function' === typeof fn) {
      // one-time "serialize" event listener
      node.addEventListener('serialize', fn, false);
    }

    // emit a custom "serialize" event on `node`, in case there
    // are event listeners for custom serialization of this node
    var e = new CustomEvent('serialize', {
      bubbles: true,
      cancelable: true,
      detail: {
        serialize: null,
        context: context
      }
    });

    e.serializeTarget = node;

    var target = eventTarget || node;
    var cancelled = !target.dispatchEvent(e);

    // `e.detail.serialize` can be set to a:
    //   String - returned directly
    //   Node   - goes through serializer logic instead of `node`
    //   Anything else - get Stringified first, and then returned directly
    var s = e.detail.serialize;
    if (s != null) {
      if ('string' === typeof s) {
        rtn = s;
      } else if ('number' === typeof s.nodeType) {
        // make it go through the serialization logic
        rtn = serialize(s, context, null, target);
      } else {
        rtn = String(s);
      }
    } else if (!cancelled) {
      // default serialization logic
      switch (nodeType) {
        case 1 /* element */:
          rtn = exports.serializeElement(node, context, eventTarget);
          break;
        case 2 /* attribute */:
          rtn = exports.serializeAttribute(node);
          break;
        case 3 /* text */:
          rtn = exports.serializeText(node);
          break;
        case 8 /* comment */:
          rtn = exports.serializeComment(node);
          break;
        case 9 /* document */:
          rtn = exports.serializeDocument(node, context, eventTarget);
          break;
        case 10 /* doctype */:
          rtn = exports.serializeDoctype(node);
          break;
        case 11 /* document fragment */:
          rtn = exports.serializeDocumentFragment(node, context, eventTarget);
          break;
      }
    }

    if ('function' === typeof fn) {
      node.removeEventListener('serialize', fn, false);
    }
  }

  return rtn || '';
}

/**
 * Serialize an Attribute node.
 */

function serializeAttribute (node, opts) {
  return node.name + '="' + encode(node.value, extend({
    named: true
  }, opts)) + '"';
}

/**
 * Serialize a DOM element.
 */

function serializeElement (node, context, eventTarget) {
  var c, i, l;
  var name = node.nodeName.toLowerCase();

  // opening tag
  var r = '<' + name;

  // attributes
  for (i = 0, c = node.attributes, l = c.length; i < l; i++) {
    r += ' ' + exports.serializeAttribute(c[i]);
  }

  r += '>';

  // child nodes
  r += exports.serializeNodeList(node.childNodes, context, null, eventTarget);

  // closing tag, only for non-void elements
  if (!voidElements[name]) {
    r += '</' + name + '>';
  }

  return r;
}

/**
 * Serialize a text node.
 */

function serializeText (node, opts) {
  return encode(node.nodeValue, extend({
    named: true,
    special: { '<': true, '>': true, '&': true }
  }, opts));
}

/**
 * Serialize a comment node.
 */

function serializeComment (node) {
  return '<!--' + node.nodeValue + '-->';
}

/**
 * Serialize a Document node.
 */

function serializeDocument (node, context, eventTarget) {
  return exports.serializeNodeList(node.childNodes, context, null, eventTarget);
}

/**
 * Serialize a DOCTYPE node.
 * See: http://stackoverflow.com/a/10162353
 */

function serializeDoctype (node) {
  var r = '<!DOCTYPE ' + node.name;

  if (node.publicId) {
    r += ' PUBLIC "' + node.publicId + '"';
  }

  if (!node.publicId && node.systemId) {
    r += ' SYSTEM';
  }

  if (node.systemId) {
    r += ' "' + node.systemId + '"';
  }

  r += '>';
  return r;
}

/**
 * Serialize a DocumentFragment instance.
 */

function serializeDocumentFragment (node, context, eventTarget) {
  return exports.serializeNodeList(node.childNodes, context, null, eventTarget);
}

/**
 * Serialize a NodeList/Array of nodes.
 */

function serializeNodeList (list, context, fn, eventTarget) {
  var r = '';
  for (var i = 0, l = list.length; i < l; i++) {
    r += serialize(list[i], context, fn, eventTarget);
  }
  return r;
}

},{"custom-event":29,"ent/encode":31,"extend":34,"void-elements":47}],31:[function(require,module,exports){
var punycode = require('punycode');
var revEntities = require('./reversed.json');

module.exports = encode;

function encode (str, opts) {
    if (typeof str !== 'string') {
        throw new TypeError('Expected a String');
    }
    if (!opts) opts = {};

    var numeric = true;
    if (opts.named) numeric = false;
    if (opts.numeric !== undefined) numeric = opts.numeric;

    var special = opts.special || {
        '"': true, "'": true,
        '<': true, '>': true,
        '&': true
    };

    var codePoints = punycode.ucs2.decode(str);
    var chars = [];
    for (var i = 0; i < codePoints.length; i++) {
        var cc = codePoints[i];
        var c = punycode.ucs2.encode([ cc ]);
        var e = revEntities[cc];
        if (e && (cc >= 127 || special[c]) && !numeric) {
            chars.push('&' + (/;$/.test(e) ? e : e + ';'));
        }
        else if (cc < 32 || cc >= 127 || special[c]) {
            chars.push('&#' + cc + ';');
        }
        else {
            chars.push(c);
        }
    }
    return chars.join('');
}

},{"./reversed.json":32,"punycode":5}],32:[function(require,module,exports){
module.exports={
    "9": "Tab;",
    "10": "NewLine;",
    "33": "excl;",
    "34": "quot;",
    "35": "num;",
    "36": "dollar;",
    "37": "percnt;",
    "38": "amp;",
    "39": "apos;",
    "40": "lpar;",
    "41": "rpar;",
    "42": "midast;",
    "43": "plus;",
    "44": "comma;",
    "46": "period;",
    "47": "sol;",
    "58": "colon;",
    "59": "semi;",
    "60": "lt;",
    "61": "equals;",
    "62": "gt;",
    "63": "quest;",
    "64": "commat;",
    "91": "lsqb;",
    "92": "bsol;",
    "93": "rsqb;",
    "94": "Hat;",
    "95": "UnderBar;",
    "96": "grave;",
    "123": "lcub;",
    "124": "VerticalLine;",
    "125": "rcub;",
    "160": "NonBreakingSpace;",
    "161": "iexcl;",
    "162": "cent;",
    "163": "pound;",
    "164": "curren;",
    "165": "yen;",
    "166": "brvbar;",
    "167": "sect;",
    "168": "uml;",
    "169": "copy;",
    "170": "ordf;",
    "171": "laquo;",
    "172": "not;",
    "173": "shy;",
    "174": "reg;",
    "175": "strns;",
    "176": "deg;",
    "177": "pm;",
    "178": "sup2;",
    "179": "sup3;",
    "180": "DiacriticalAcute;",
    "181": "micro;",
    "182": "para;",
    "183": "middot;",
    "184": "Cedilla;",
    "185": "sup1;",
    "186": "ordm;",
    "187": "raquo;",
    "188": "frac14;",
    "189": "half;",
    "190": "frac34;",
    "191": "iquest;",
    "192": "Agrave;",
    "193": "Aacute;",
    "194": "Acirc;",
    "195": "Atilde;",
    "196": "Auml;",
    "197": "Aring;",
    "198": "AElig;",
    "199": "Ccedil;",
    "200": "Egrave;",
    "201": "Eacute;",
    "202": "Ecirc;",
    "203": "Euml;",
    "204": "Igrave;",
    "205": "Iacute;",
    "206": "Icirc;",
    "207": "Iuml;",
    "208": "ETH;",
    "209": "Ntilde;",
    "210": "Ograve;",
    "211": "Oacute;",
    "212": "Ocirc;",
    "213": "Otilde;",
    "214": "Ouml;",
    "215": "times;",
    "216": "Oslash;",
    "217": "Ugrave;",
    "218": "Uacute;",
    "219": "Ucirc;",
    "220": "Uuml;",
    "221": "Yacute;",
    "222": "THORN;",
    "223": "szlig;",
    "224": "agrave;",
    "225": "aacute;",
    "226": "acirc;",
    "227": "atilde;",
    "228": "auml;",
    "229": "aring;",
    "230": "aelig;",
    "231": "ccedil;",
    "232": "egrave;",
    "233": "eacute;",
    "234": "ecirc;",
    "235": "euml;",
    "236": "igrave;",
    "237": "iacute;",
    "238": "icirc;",
    "239": "iuml;",
    "240": "eth;",
    "241": "ntilde;",
    "242": "ograve;",
    "243": "oacute;",
    "244": "ocirc;",
    "245": "otilde;",
    "246": "ouml;",
    "247": "divide;",
    "248": "oslash;",
    "249": "ugrave;",
    "250": "uacute;",
    "251": "ucirc;",
    "252": "uuml;",
    "253": "yacute;",
    "254": "thorn;",
    "255": "yuml;",
    "256": "Amacr;",
    "257": "amacr;",
    "258": "Abreve;",
    "259": "abreve;",
    "260": "Aogon;",
    "261": "aogon;",
    "262": "Cacute;",
    "263": "cacute;",
    "264": "Ccirc;",
    "265": "ccirc;",
    "266": "Cdot;",
    "267": "cdot;",
    "268": "Ccaron;",
    "269": "ccaron;",
    "270": "Dcaron;",
    "271": "dcaron;",
    "272": "Dstrok;",
    "273": "dstrok;",
    "274": "Emacr;",
    "275": "emacr;",
    "278": "Edot;",
    "279": "edot;",
    "280": "Eogon;",
    "281": "eogon;",
    "282": "Ecaron;",
    "283": "ecaron;",
    "284": "Gcirc;",
    "285": "gcirc;",
    "286": "Gbreve;",
    "287": "gbreve;",
    "288": "Gdot;",
    "289": "gdot;",
    "290": "Gcedil;",
    "292": "Hcirc;",
    "293": "hcirc;",
    "294": "Hstrok;",
    "295": "hstrok;",
    "296": "Itilde;",
    "297": "itilde;",
    "298": "Imacr;",
    "299": "imacr;",
    "302": "Iogon;",
    "303": "iogon;",
    "304": "Idot;",
    "305": "inodot;",
    "306": "IJlig;",
    "307": "ijlig;",
    "308": "Jcirc;",
    "309": "jcirc;",
    "310": "Kcedil;",
    "311": "kcedil;",
    "312": "kgreen;",
    "313": "Lacute;",
    "314": "lacute;",
    "315": "Lcedil;",
    "316": "lcedil;",
    "317": "Lcaron;",
    "318": "lcaron;",
    "319": "Lmidot;",
    "320": "lmidot;",
    "321": "Lstrok;",
    "322": "lstrok;",
    "323": "Nacute;",
    "324": "nacute;",
    "325": "Ncedil;",
    "326": "ncedil;",
    "327": "Ncaron;",
    "328": "ncaron;",
    "329": "napos;",
    "330": "ENG;",
    "331": "eng;",
    "332": "Omacr;",
    "333": "omacr;",
    "336": "Odblac;",
    "337": "odblac;",
    "338": "OElig;",
    "339": "oelig;",
    "340": "Racute;",
    "341": "racute;",
    "342": "Rcedil;",
    "343": "rcedil;",
    "344": "Rcaron;",
    "345": "rcaron;",
    "346": "Sacute;",
    "347": "sacute;",
    "348": "Scirc;",
    "349": "scirc;",
    "350": "Scedil;",
    "351": "scedil;",
    "352": "Scaron;",
    "353": "scaron;",
    "354": "Tcedil;",
    "355": "tcedil;",
    "356": "Tcaron;",
    "357": "tcaron;",
    "358": "Tstrok;",
    "359": "tstrok;",
    "360": "Utilde;",
    "361": "utilde;",
    "362": "Umacr;",
    "363": "umacr;",
    "364": "Ubreve;",
    "365": "ubreve;",
    "366": "Uring;",
    "367": "uring;",
    "368": "Udblac;",
    "369": "udblac;",
    "370": "Uogon;",
    "371": "uogon;",
    "372": "Wcirc;",
    "373": "wcirc;",
    "374": "Ycirc;",
    "375": "ycirc;",
    "376": "Yuml;",
    "377": "Zacute;",
    "378": "zacute;",
    "379": "Zdot;",
    "380": "zdot;",
    "381": "Zcaron;",
    "382": "zcaron;",
    "402": "fnof;",
    "437": "imped;",
    "501": "gacute;",
    "567": "jmath;",
    "710": "circ;",
    "711": "Hacek;",
    "728": "breve;",
    "729": "dot;",
    "730": "ring;",
    "731": "ogon;",
    "732": "tilde;",
    "733": "DiacriticalDoubleAcute;",
    "785": "DownBreve;",
    "913": "Alpha;",
    "914": "Beta;",
    "915": "Gamma;",
    "916": "Delta;",
    "917": "Epsilon;",
    "918": "Zeta;",
    "919": "Eta;",
    "920": "Theta;",
    "921": "Iota;",
    "922": "Kappa;",
    "923": "Lambda;",
    "924": "Mu;",
    "925": "Nu;",
    "926": "Xi;",
    "927": "Omicron;",
    "928": "Pi;",
    "929": "Rho;",
    "931": "Sigma;",
    "932": "Tau;",
    "933": "Upsilon;",
    "934": "Phi;",
    "935": "Chi;",
    "936": "Psi;",
    "937": "Omega;",
    "945": "alpha;",
    "946": "beta;",
    "947": "gamma;",
    "948": "delta;",
    "949": "epsilon;",
    "950": "zeta;",
    "951": "eta;",
    "952": "theta;",
    "953": "iota;",
    "954": "kappa;",
    "955": "lambda;",
    "956": "mu;",
    "957": "nu;",
    "958": "xi;",
    "959": "omicron;",
    "960": "pi;",
    "961": "rho;",
    "962": "varsigma;",
    "963": "sigma;",
    "964": "tau;",
    "965": "upsilon;",
    "966": "phi;",
    "967": "chi;",
    "968": "psi;",
    "969": "omega;",
    "977": "vartheta;",
    "978": "upsih;",
    "981": "varphi;",
    "982": "varpi;",
    "988": "Gammad;",
    "989": "gammad;",
    "1008": "varkappa;",
    "1009": "varrho;",
    "1013": "varepsilon;",
    "1014": "bepsi;",
    "1025": "IOcy;",
    "1026": "DJcy;",
    "1027": "GJcy;",
    "1028": "Jukcy;",
    "1029": "DScy;",
    "1030": "Iukcy;",
    "1031": "YIcy;",
    "1032": "Jsercy;",
    "1033": "LJcy;",
    "1034": "NJcy;",
    "1035": "TSHcy;",
    "1036": "KJcy;",
    "1038": "Ubrcy;",
    "1039": "DZcy;",
    "1040": "Acy;",
    "1041": "Bcy;",
    "1042": "Vcy;",
    "1043": "Gcy;",
    "1044": "Dcy;",
    "1045": "IEcy;",
    "1046": "ZHcy;",
    "1047": "Zcy;",
    "1048": "Icy;",
    "1049": "Jcy;",
    "1050": "Kcy;",
    "1051": "Lcy;",
    "1052": "Mcy;",
    "1053": "Ncy;",
    "1054": "Ocy;",
    "1055": "Pcy;",
    "1056": "Rcy;",
    "1057": "Scy;",
    "1058": "Tcy;",
    "1059": "Ucy;",
    "1060": "Fcy;",
    "1061": "KHcy;",
    "1062": "TScy;",
    "1063": "CHcy;",
    "1064": "SHcy;",
    "1065": "SHCHcy;",
    "1066": "HARDcy;",
    "1067": "Ycy;",
    "1068": "SOFTcy;",
    "1069": "Ecy;",
    "1070": "YUcy;",
    "1071": "YAcy;",
    "1072": "acy;",
    "1073": "bcy;",
    "1074": "vcy;",
    "1075": "gcy;",
    "1076": "dcy;",
    "1077": "iecy;",
    "1078": "zhcy;",
    "1079": "zcy;",
    "1080": "icy;",
    "1081": "jcy;",
    "1082": "kcy;",
    "1083": "lcy;",
    "1084": "mcy;",
    "1085": "ncy;",
    "1086": "ocy;",
    "1087": "pcy;",
    "1088": "rcy;",
    "1089": "scy;",
    "1090": "tcy;",
    "1091": "ucy;",
    "1092": "fcy;",
    "1093": "khcy;",
    "1094": "tscy;",
    "1095": "chcy;",
    "1096": "shcy;",
    "1097": "shchcy;",
    "1098": "hardcy;",
    "1099": "ycy;",
    "1100": "softcy;",
    "1101": "ecy;",
    "1102": "yucy;",
    "1103": "yacy;",
    "1105": "iocy;",
    "1106": "djcy;",
    "1107": "gjcy;",
    "1108": "jukcy;",
    "1109": "dscy;",
    "1110": "iukcy;",
    "1111": "yicy;",
    "1112": "jsercy;",
    "1113": "ljcy;",
    "1114": "njcy;",
    "1115": "tshcy;",
    "1116": "kjcy;",
    "1118": "ubrcy;",
    "1119": "dzcy;",
    "8194": "ensp;",
    "8195": "emsp;",
    "8196": "emsp13;",
    "8197": "emsp14;",
    "8199": "numsp;",
    "8200": "puncsp;",
    "8201": "ThinSpace;",
    "8202": "VeryThinSpace;",
    "8203": "ZeroWidthSpace;",
    "8204": "zwnj;",
    "8205": "zwj;",
    "8206": "lrm;",
    "8207": "rlm;",
    "8208": "hyphen;",
    "8211": "ndash;",
    "8212": "mdash;",
    "8213": "horbar;",
    "8214": "Vert;",
    "8216": "OpenCurlyQuote;",
    "8217": "rsquor;",
    "8218": "sbquo;",
    "8220": "OpenCurlyDoubleQuote;",
    "8221": "rdquor;",
    "8222": "ldquor;",
    "8224": "dagger;",
    "8225": "ddagger;",
    "8226": "bullet;",
    "8229": "nldr;",
    "8230": "mldr;",
    "8240": "permil;",
    "8241": "pertenk;",
    "8242": "prime;",
    "8243": "Prime;",
    "8244": "tprime;",
    "8245": "bprime;",
    "8249": "lsaquo;",
    "8250": "rsaquo;",
    "8254": "OverBar;",
    "8257": "caret;",
    "8259": "hybull;",
    "8260": "frasl;",
    "8271": "bsemi;",
    "8279": "qprime;",
    "8287": "MediumSpace;",
    "8288": "NoBreak;",
    "8289": "ApplyFunction;",
    "8290": "it;",
    "8291": "InvisibleComma;",
    "8364": "euro;",
    "8411": "TripleDot;",
    "8412": "DotDot;",
    "8450": "Copf;",
    "8453": "incare;",
    "8458": "gscr;",
    "8459": "Hscr;",
    "8460": "Poincareplane;",
    "8461": "quaternions;",
    "8462": "planckh;",
    "8463": "plankv;",
    "8464": "Iscr;",
    "8465": "imagpart;",
    "8466": "Lscr;",
    "8467": "ell;",
    "8469": "Nopf;",
    "8470": "numero;",
    "8471": "copysr;",
    "8472": "wp;",
    "8473": "primes;",
    "8474": "rationals;",
    "8475": "Rscr;",
    "8476": "Rfr;",
    "8477": "Ropf;",
    "8478": "rx;",
    "8482": "trade;",
    "8484": "Zopf;",
    "8487": "mho;",
    "8488": "Zfr;",
    "8489": "iiota;",
    "8492": "Bscr;",
    "8493": "Cfr;",
    "8495": "escr;",
    "8496": "expectation;",
    "8497": "Fscr;",
    "8499": "phmmat;",
    "8500": "oscr;",
    "8501": "aleph;",
    "8502": "beth;",
    "8503": "gimel;",
    "8504": "daleth;",
    "8517": "DD;",
    "8518": "DifferentialD;",
    "8519": "exponentiale;",
    "8520": "ImaginaryI;",
    "8531": "frac13;",
    "8532": "frac23;",
    "8533": "frac15;",
    "8534": "frac25;",
    "8535": "frac35;",
    "8536": "frac45;",
    "8537": "frac16;",
    "8538": "frac56;",
    "8539": "frac18;",
    "8540": "frac38;",
    "8541": "frac58;",
    "8542": "frac78;",
    "8592": "slarr;",
    "8593": "uparrow;",
    "8594": "srarr;",
    "8595": "ShortDownArrow;",
    "8596": "leftrightarrow;",
    "8597": "varr;",
    "8598": "UpperLeftArrow;",
    "8599": "UpperRightArrow;",
    "8600": "searrow;",
    "8601": "swarrow;",
    "8602": "nleftarrow;",
    "8603": "nrightarrow;",
    "8605": "rightsquigarrow;",
    "8606": "twoheadleftarrow;",
    "8607": "Uarr;",
    "8608": "twoheadrightarrow;",
    "8609": "Darr;",
    "8610": "leftarrowtail;",
    "8611": "rightarrowtail;",
    "8612": "mapstoleft;",
    "8613": "UpTeeArrow;",
    "8614": "RightTeeArrow;",
    "8615": "mapstodown;",
    "8617": "larrhk;",
    "8618": "rarrhk;",
    "8619": "looparrowleft;",
    "8620": "rarrlp;",
    "8621": "leftrightsquigarrow;",
    "8622": "nleftrightarrow;",
    "8624": "lsh;",
    "8625": "rsh;",
    "8626": "ldsh;",
    "8627": "rdsh;",
    "8629": "crarr;",
    "8630": "curvearrowleft;",
    "8631": "curvearrowright;",
    "8634": "olarr;",
    "8635": "orarr;",
    "8636": "lharu;",
    "8637": "lhard;",
    "8638": "upharpoonright;",
    "8639": "upharpoonleft;",
    "8640": "RightVector;",
    "8641": "rightharpoondown;",
    "8642": "RightDownVector;",
    "8643": "LeftDownVector;",
    "8644": "rlarr;",
    "8645": "UpArrowDownArrow;",
    "8646": "lrarr;",
    "8647": "llarr;",
    "8648": "uuarr;",
    "8649": "rrarr;",
    "8650": "downdownarrows;",
    "8651": "ReverseEquilibrium;",
    "8652": "rlhar;",
    "8653": "nLeftarrow;",
    "8654": "nLeftrightarrow;",
    "8655": "nRightarrow;",
    "8656": "Leftarrow;",
    "8657": "Uparrow;",
    "8658": "Rightarrow;",
    "8659": "Downarrow;",
    "8660": "Leftrightarrow;",
    "8661": "vArr;",
    "8662": "nwArr;",
    "8663": "neArr;",
    "8664": "seArr;",
    "8665": "swArr;",
    "8666": "Lleftarrow;",
    "8667": "Rrightarrow;",
    "8669": "zigrarr;",
    "8676": "LeftArrowBar;",
    "8677": "RightArrowBar;",
    "8693": "duarr;",
    "8701": "loarr;",
    "8702": "roarr;",
    "8703": "hoarr;",
    "8704": "forall;",
    "8705": "complement;",
    "8706": "PartialD;",
    "8707": "Exists;",
    "8708": "NotExists;",
    "8709": "varnothing;",
    "8711": "nabla;",
    "8712": "isinv;",
    "8713": "notinva;",
    "8715": "SuchThat;",
    "8716": "NotReverseElement;",
    "8719": "Product;",
    "8720": "Coproduct;",
    "8721": "sum;",
    "8722": "minus;",
    "8723": "mp;",
    "8724": "plusdo;",
    "8726": "ssetmn;",
    "8727": "lowast;",
    "8728": "SmallCircle;",
    "8730": "Sqrt;",
    "8733": "vprop;",
    "8734": "infin;",
    "8735": "angrt;",
    "8736": "angle;",
    "8737": "measuredangle;",
    "8738": "angsph;",
    "8739": "VerticalBar;",
    "8740": "nsmid;",
    "8741": "spar;",
    "8742": "nspar;",
    "8743": "wedge;",
    "8744": "vee;",
    "8745": "cap;",
    "8746": "cup;",
    "8747": "Integral;",
    "8748": "Int;",
    "8749": "tint;",
    "8750": "oint;",
    "8751": "DoubleContourIntegral;",
    "8752": "Cconint;",
    "8753": "cwint;",
    "8754": "cwconint;",
    "8755": "CounterClockwiseContourIntegral;",
    "8756": "therefore;",
    "8757": "because;",
    "8758": "ratio;",
    "8759": "Proportion;",
    "8760": "minusd;",
    "8762": "mDDot;",
    "8763": "homtht;",
    "8764": "Tilde;",
    "8765": "bsim;",
    "8766": "mstpos;",
    "8767": "acd;",
    "8768": "wreath;",
    "8769": "nsim;",
    "8770": "esim;",
    "8771": "TildeEqual;",
    "8772": "nsimeq;",
    "8773": "TildeFullEqual;",
    "8774": "simne;",
    "8775": "NotTildeFullEqual;",
    "8776": "TildeTilde;",
    "8777": "NotTildeTilde;",
    "8778": "approxeq;",
    "8779": "apid;",
    "8780": "bcong;",
    "8781": "CupCap;",
    "8782": "HumpDownHump;",
    "8783": "HumpEqual;",
    "8784": "esdot;",
    "8785": "eDot;",
    "8786": "fallingdotseq;",
    "8787": "risingdotseq;",
    "8788": "coloneq;",
    "8789": "eqcolon;",
    "8790": "eqcirc;",
    "8791": "cire;",
    "8793": "wedgeq;",
    "8794": "veeeq;",
    "8796": "trie;",
    "8799": "questeq;",
    "8800": "NotEqual;",
    "8801": "equiv;",
    "8802": "NotCongruent;",
    "8804": "leq;",
    "8805": "GreaterEqual;",
    "8806": "LessFullEqual;",
    "8807": "GreaterFullEqual;",
    "8808": "lneqq;",
    "8809": "gneqq;",
    "8810": "NestedLessLess;",
    "8811": "NestedGreaterGreater;",
    "8812": "twixt;",
    "8813": "NotCupCap;",
    "8814": "NotLess;",
    "8815": "NotGreater;",
    "8816": "NotLessEqual;",
    "8817": "NotGreaterEqual;",
    "8818": "lsim;",
    "8819": "gtrsim;",
    "8820": "NotLessTilde;",
    "8821": "NotGreaterTilde;",
    "8822": "lg;",
    "8823": "gtrless;",
    "8824": "ntlg;",
    "8825": "ntgl;",
    "8826": "Precedes;",
    "8827": "Succeeds;",
    "8828": "PrecedesSlantEqual;",
    "8829": "SucceedsSlantEqual;",
    "8830": "prsim;",
    "8831": "succsim;",
    "8832": "nprec;",
    "8833": "nsucc;",
    "8834": "subset;",
    "8835": "supset;",
    "8836": "nsub;",
    "8837": "nsup;",
    "8838": "SubsetEqual;",
    "8839": "supseteq;",
    "8840": "nsubseteq;",
    "8841": "nsupseteq;",
    "8842": "subsetneq;",
    "8843": "supsetneq;",
    "8845": "cupdot;",
    "8846": "uplus;",
    "8847": "SquareSubset;",
    "8848": "SquareSuperset;",
    "8849": "SquareSubsetEqual;",
    "8850": "SquareSupersetEqual;",
    "8851": "SquareIntersection;",
    "8852": "SquareUnion;",
    "8853": "oplus;",
    "8854": "ominus;",
    "8855": "otimes;",
    "8856": "osol;",
    "8857": "odot;",
    "8858": "ocir;",
    "8859": "oast;",
    "8861": "odash;",
    "8862": "plusb;",
    "8863": "minusb;",
    "8864": "timesb;",
    "8865": "sdotb;",
    "8866": "vdash;",
    "8867": "LeftTee;",
    "8868": "top;",
    "8869": "UpTee;",
    "8871": "models;",
    "8872": "vDash;",
    "8873": "Vdash;",
    "8874": "Vvdash;",
    "8875": "VDash;",
    "8876": "nvdash;",
    "8877": "nvDash;",
    "8878": "nVdash;",
    "8879": "nVDash;",
    "8880": "prurel;",
    "8882": "vltri;",
    "8883": "vrtri;",
    "8884": "trianglelefteq;",
    "8885": "trianglerighteq;",
    "8886": "origof;",
    "8887": "imof;",
    "8888": "mumap;",
    "8889": "hercon;",
    "8890": "intercal;",
    "8891": "veebar;",
    "8893": "barvee;",
    "8894": "angrtvb;",
    "8895": "lrtri;",
    "8896": "xwedge;",
    "8897": "xvee;",
    "8898": "xcap;",
    "8899": "xcup;",
    "8900": "diamond;",
    "8901": "sdot;",
    "8902": "Star;",
    "8903": "divonx;",
    "8904": "bowtie;",
    "8905": "ltimes;",
    "8906": "rtimes;",
    "8907": "lthree;",
    "8908": "rthree;",
    "8909": "bsime;",
    "8910": "cuvee;",
    "8911": "cuwed;",
    "8912": "Subset;",
    "8913": "Supset;",
    "8914": "Cap;",
    "8915": "Cup;",
    "8916": "pitchfork;",
    "8917": "epar;",
    "8918": "ltdot;",
    "8919": "gtrdot;",
    "8920": "Ll;",
    "8921": "ggg;",
    "8922": "LessEqualGreater;",
    "8923": "gtreqless;",
    "8926": "curlyeqprec;",
    "8927": "curlyeqsucc;",
    "8928": "nprcue;",
    "8929": "nsccue;",
    "8930": "nsqsube;",
    "8931": "nsqsupe;",
    "8934": "lnsim;",
    "8935": "gnsim;",
    "8936": "prnsim;",
    "8937": "succnsim;",
    "8938": "ntriangleleft;",
    "8939": "ntriangleright;",
    "8940": "ntrianglelefteq;",
    "8941": "ntrianglerighteq;",
    "8942": "vellip;",
    "8943": "ctdot;",
    "8944": "utdot;",
    "8945": "dtdot;",
    "8946": "disin;",
    "8947": "isinsv;",
    "8948": "isins;",
    "8949": "isindot;",
    "8950": "notinvc;",
    "8951": "notinvb;",
    "8953": "isinE;",
    "8954": "nisd;",
    "8955": "xnis;",
    "8956": "nis;",
    "8957": "notnivc;",
    "8958": "notnivb;",
    "8965": "barwedge;",
    "8966": "doublebarwedge;",
    "8968": "LeftCeiling;",
    "8969": "RightCeiling;",
    "8970": "lfloor;",
    "8971": "RightFloor;",
    "8972": "drcrop;",
    "8973": "dlcrop;",
    "8974": "urcrop;",
    "8975": "ulcrop;",
    "8976": "bnot;",
    "8978": "profline;",
    "8979": "profsurf;",
    "8981": "telrec;",
    "8982": "target;",
    "8988": "ulcorner;",
    "8989": "urcorner;",
    "8990": "llcorner;",
    "8991": "lrcorner;",
    "8994": "sfrown;",
    "8995": "ssmile;",
    "9005": "cylcty;",
    "9006": "profalar;",
    "9014": "topbot;",
    "9021": "ovbar;",
    "9023": "solbar;",
    "9084": "angzarr;",
    "9136": "lmoustache;",
    "9137": "rmoustache;",
    "9140": "tbrk;",
    "9141": "UnderBracket;",
    "9142": "bbrktbrk;",
    "9180": "OverParenthesis;",
    "9181": "UnderParenthesis;",
    "9182": "OverBrace;",
    "9183": "UnderBrace;",
    "9186": "trpezium;",
    "9191": "elinters;",
    "9251": "blank;",
    "9416": "oS;",
    "9472": "HorizontalLine;",
    "9474": "boxv;",
    "9484": "boxdr;",
    "9488": "boxdl;",
    "9492": "boxur;",
    "9496": "boxul;",
    "9500": "boxvr;",
    "9508": "boxvl;",
    "9516": "boxhd;",
    "9524": "boxhu;",
    "9532": "boxvh;",
    "9552": "boxH;",
    "9553": "boxV;",
    "9554": "boxdR;",
    "9555": "boxDr;",
    "9556": "boxDR;",
    "9557": "boxdL;",
    "9558": "boxDl;",
    "9559": "boxDL;",
    "9560": "boxuR;",
    "9561": "boxUr;",
    "9562": "boxUR;",
    "9563": "boxuL;",
    "9564": "boxUl;",
    "9565": "boxUL;",
    "9566": "boxvR;",
    "9567": "boxVr;",
    "9568": "boxVR;",
    "9569": "boxvL;",
    "9570": "boxVl;",
    "9571": "boxVL;",
    "9572": "boxHd;",
    "9573": "boxhD;",
    "9574": "boxHD;",
    "9575": "boxHu;",
    "9576": "boxhU;",
    "9577": "boxHU;",
    "9578": "boxvH;",
    "9579": "boxVh;",
    "9580": "boxVH;",
    "9600": "uhblk;",
    "9604": "lhblk;",
    "9608": "block;",
    "9617": "blk14;",
    "9618": "blk12;",
    "9619": "blk34;",
    "9633": "square;",
    "9642": "squf;",
    "9643": "EmptyVerySmallSquare;",
    "9645": "rect;",
    "9646": "marker;",
    "9649": "fltns;",
    "9651": "xutri;",
    "9652": "utrif;",
    "9653": "utri;",
    "9656": "rtrif;",
    "9657": "triangleright;",
    "9661": "xdtri;",
    "9662": "dtrif;",
    "9663": "triangledown;",
    "9666": "ltrif;",
    "9667": "triangleleft;",
    "9674": "lozenge;",
    "9675": "cir;",
    "9708": "tridot;",
    "9711": "xcirc;",
    "9720": "ultri;",
    "9721": "urtri;",
    "9722": "lltri;",
    "9723": "EmptySmallSquare;",
    "9724": "FilledSmallSquare;",
    "9733": "starf;",
    "9734": "star;",
    "9742": "phone;",
    "9792": "female;",
    "9794": "male;",
    "9824": "spadesuit;",
    "9827": "clubsuit;",
    "9829": "heartsuit;",
    "9830": "diams;",
    "9834": "sung;",
    "9837": "flat;",
    "9838": "natural;",
    "9839": "sharp;",
    "10003": "checkmark;",
    "10007": "cross;",
    "10016": "maltese;",
    "10038": "sext;",
    "10072": "VerticalSeparator;",
    "10098": "lbbrk;",
    "10099": "rbbrk;",
    "10184": "bsolhsub;",
    "10185": "suphsol;",
    "10214": "lobrk;",
    "10215": "robrk;",
    "10216": "LeftAngleBracket;",
    "10217": "RightAngleBracket;",
    "10218": "Lang;",
    "10219": "Rang;",
    "10220": "loang;",
    "10221": "roang;",
    "10229": "xlarr;",
    "10230": "xrarr;",
    "10231": "xharr;",
    "10232": "xlArr;",
    "10233": "xrArr;",
    "10234": "xhArr;",
    "10236": "xmap;",
    "10239": "dzigrarr;",
    "10498": "nvlArr;",
    "10499": "nvrArr;",
    "10500": "nvHarr;",
    "10501": "Map;",
    "10508": "lbarr;",
    "10509": "rbarr;",
    "10510": "lBarr;",
    "10511": "rBarr;",
    "10512": "RBarr;",
    "10513": "DDotrahd;",
    "10514": "UpArrowBar;",
    "10515": "DownArrowBar;",
    "10518": "Rarrtl;",
    "10521": "latail;",
    "10522": "ratail;",
    "10523": "lAtail;",
    "10524": "rAtail;",
    "10525": "larrfs;",
    "10526": "rarrfs;",
    "10527": "larrbfs;",
    "10528": "rarrbfs;",
    "10531": "nwarhk;",
    "10532": "nearhk;",
    "10533": "searhk;",
    "10534": "swarhk;",
    "10535": "nwnear;",
    "10536": "toea;",
    "10537": "tosa;",
    "10538": "swnwar;",
    "10547": "rarrc;",
    "10549": "cudarrr;",
    "10550": "ldca;",
    "10551": "rdca;",
    "10552": "cudarrl;",
    "10553": "larrpl;",
    "10556": "curarrm;",
    "10557": "cularrp;",
    "10565": "rarrpl;",
    "10568": "harrcir;",
    "10569": "Uarrocir;",
    "10570": "lurdshar;",
    "10571": "ldrushar;",
    "10574": "LeftRightVector;",
    "10575": "RightUpDownVector;",
    "10576": "DownLeftRightVector;",
    "10577": "LeftUpDownVector;",
    "10578": "LeftVectorBar;",
    "10579": "RightVectorBar;",
    "10580": "RightUpVectorBar;",
    "10581": "RightDownVectorBar;",
    "10582": "DownLeftVectorBar;",
    "10583": "DownRightVectorBar;",
    "10584": "LeftUpVectorBar;",
    "10585": "LeftDownVectorBar;",
    "10586": "LeftTeeVector;",
    "10587": "RightTeeVector;",
    "10588": "RightUpTeeVector;",
    "10589": "RightDownTeeVector;",
    "10590": "DownLeftTeeVector;",
    "10591": "DownRightTeeVector;",
    "10592": "LeftUpTeeVector;",
    "10593": "LeftDownTeeVector;",
    "10594": "lHar;",
    "10595": "uHar;",
    "10596": "rHar;",
    "10597": "dHar;",
    "10598": "luruhar;",
    "10599": "ldrdhar;",
    "10600": "ruluhar;",
    "10601": "rdldhar;",
    "10602": "lharul;",
    "10603": "llhard;",
    "10604": "rharul;",
    "10605": "lrhard;",
    "10606": "UpEquilibrium;",
    "10607": "ReverseUpEquilibrium;",
    "10608": "RoundImplies;",
    "10609": "erarr;",
    "10610": "simrarr;",
    "10611": "larrsim;",
    "10612": "rarrsim;",
    "10613": "rarrap;",
    "10614": "ltlarr;",
    "10616": "gtrarr;",
    "10617": "subrarr;",
    "10619": "suplarr;",
    "10620": "lfisht;",
    "10621": "rfisht;",
    "10622": "ufisht;",
    "10623": "dfisht;",
    "10629": "lopar;",
    "10630": "ropar;",
    "10635": "lbrke;",
    "10636": "rbrke;",
    "10637": "lbrkslu;",
    "10638": "rbrksld;",
    "10639": "lbrksld;",
    "10640": "rbrkslu;",
    "10641": "langd;",
    "10642": "rangd;",
    "10643": "lparlt;",
    "10644": "rpargt;",
    "10645": "gtlPar;",
    "10646": "ltrPar;",
    "10650": "vzigzag;",
    "10652": "vangrt;",
    "10653": "angrtvbd;",
    "10660": "ange;",
    "10661": "range;",
    "10662": "dwangle;",
    "10663": "uwangle;",
    "10664": "angmsdaa;",
    "10665": "angmsdab;",
    "10666": "angmsdac;",
    "10667": "angmsdad;",
    "10668": "angmsdae;",
    "10669": "angmsdaf;",
    "10670": "angmsdag;",
    "10671": "angmsdah;",
    "10672": "bemptyv;",
    "10673": "demptyv;",
    "10674": "cemptyv;",
    "10675": "raemptyv;",
    "10676": "laemptyv;",
    "10677": "ohbar;",
    "10678": "omid;",
    "10679": "opar;",
    "10681": "operp;",
    "10683": "olcross;",
    "10684": "odsold;",
    "10686": "olcir;",
    "10687": "ofcir;",
    "10688": "olt;",
    "10689": "ogt;",
    "10690": "cirscir;",
    "10691": "cirE;",
    "10692": "solb;",
    "10693": "bsolb;",
    "10697": "boxbox;",
    "10701": "trisb;",
    "10702": "rtriltri;",
    "10703": "LeftTriangleBar;",
    "10704": "RightTriangleBar;",
    "10716": "iinfin;",
    "10717": "infintie;",
    "10718": "nvinfin;",
    "10723": "eparsl;",
    "10724": "smeparsl;",
    "10725": "eqvparsl;",
    "10731": "lozf;",
    "10740": "RuleDelayed;",
    "10742": "dsol;",
    "10752": "xodot;",
    "10753": "xoplus;",
    "10754": "xotime;",
    "10756": "xuplus;",
    "10758": "xsqcup;",
    "10764": "qint;",
    "10765": "fpartint;",
    "10768": "cirfnint;",
    "10769": "awint;",
    "10770": "rppolint;",
    "10771": "scpolint;",
    "10772": "npolint;",
    "10773": "pointint;",
    "10774": "quatint;",
    "10775": "intlarhk;",
    "10786": "pluscir;",
    "10787": "plusacir;",
    "10788": "simplus;",
    "10789": "plusdu;",
    "10790": "plussim;",
    "10791": "plustwo;",
    "10793": "mcomma;",
    "10794": "minusdu;",
    "10797": "loplus;",
    "10798": "roplus;",
    "10799": "Cross;",
    "10800": "timesd;",
    "10801": "timesbar;",
    "10803": "smashp;",
    "10804": "lotimes;",
    "10805": "rotimes;",
    "10806": "otimesas;",
    "10807": "Otimes;",
    "10808": "odiv;",
    "10809": "triplus;",
    "10810": "triminus;",
    "10811": "tritime;",
    "10812": "iprod;",
    "10815": "amalg;",
    "10816": "capdot;",
    "10818": "ncup;",
    "10819": "ncap;",
    "10820": "capand;",
    "10821": "cupor;",
    "10822": "cupcap;",
    "10823": "capcup;",
    "10824": "cupbrcap;",
    "10825": "capbrcup;",
    "10826": "cupcup;",
    "10827": "capcap;",
    "10828": "ccups;",
    "10829": "ccaps;",
    "10832": "ccupssm;",
    "10835": "And;",
    "10836": "Or;",
    "10837": "andand;",
    "10838": "oror;",
    "10839": "orslope;",
    "10840": "andslope;",
    "10842": "andv;",
    "10843": "orv;",
    "10844": "andd;",
    "10845": "ord;",
    "10847": "wedbar;",
    "10854": "sdote;",
    "10858": "simdot;",
    "10861": "congdot;",
    "10862": "easter;",
    "10863": "apacir;",
    "10864": "apE;",
    "10865": "eplus;",
    "10866": "pluse;",
    "10867": "Esim;",
    "10868": "Colone;",
    "10869": "Equal;",
    "10871": "eDDot;",
    "10872": "equivDD;",
    "10873": "ltcir;",
    "10874": "gtcir;",
    "10875": "ltquest;",
    "10876": "gtquest;",
    "10877": "LessSlantEqual;",
    "10878": "GreaterSlantEqual;",
    "10879": "lesdot;",
    "10880": "gesdot;",
    "10881": "lesdoto;",
    "10882": "gesdoto;",
    "10883": "lesdotor;",
    "10884": "gesdotol;",
    "10885": "lessapprox;",
    "10886": "gtrapprox;",
    "10887": "lneq;",
    "10888": "gneq;",
    "10889": "lnapprox;",
    "10890": "gnapprox;",
    "10891": "lesseqqgtr;",
    "10892": "gtreqqless;",
    "10893": "lsime;",
    "10894": "gsime;",
    "10895": "lsimg;",
    "10896": "gsiml;",
    "10897": "lgE;",
    "10898": "glE;",
    "10899": "lesges;",
    "10900": "gesles;",
    "10901": "eqslantless;",
    "10902": "eqslantgtr;",
    "10903": "elsdot;",
    "10904": "egsdot;",
    "10905": "el;",
    "10906": "eg;",
    "10909": "siml;",
    "10910": "simg;",
    "10911": "simlE;",
    "10912": "simgE;",
    "10913": "LessLess;",
    "10914": "GreaterGreater;",
    "10916": "glj;",
    "10917": "gla;",
    "10918": "ltcc;",
    "10919": "gtcc;",
    "10920": "lescc;",
    "10921": "gescc;",
    "10922": "smt;",
    "10923": "lat;",
    "10924": "smte;",
    "10925": "late;",
    "10926": "bumpE;",
    "10927": "preceq;",
    "10928": "succeq;",
    "10931": "prE;",
    "10932": "scE;",
    "10933": "prnE;",
    "10934": "succneqq;",
    "10935": "precapprox;",
    "10936": "succapprox;",
    "10937": "prnap;",
    "10938": "succnapprox;",
    "10939": "Pr;",
    "10940": "Sc;",
    "10941": "subdot;",
    "10942": "supdot;",
    "10943": "subplus;",
    "10944": "supplus;",
    "10945": "submult;",
    "10946": "supmult;",
    "10947": "subedot;",
    "10948": "supedot;",
    "10949": "subseteqq;",
    "10950": "supseteqq;",
    "10951": "subsim;",
    "10952": "supsim;",
    "10955": "subsetneqq;",
    "10956": "supsetneqq;",
    "10959": "csub;",
    "10960": "csup;",
    "10961": "csube;",
    "10962": "csupe;",
    "10963": "subsup;",
    "10964": "supsub;",
    "10965": "subsub;",
    "10966": "supsup;",
    "10967": "suphsub;",
    "10968": "supdsub;",
    "10969": "forkv;",
    "10970": "topfork;",
    "10971": "mlcp;",
    "10980": "DoubleLeftTee;",
    "10982": "Vdashl;",
    "10983": "Barv;",
    "10984": "vBar;",
    "10985": "vBarv;",
    "10987": "Vbar;",
    "10988": "Not;",
    "10989": "bNot;",
    "10990": "rnmid;",
    "10991": "cirmid;",
    "10992": "midcir;",
    "10993": "topcir;",
    "10994": "nhpar;",
    "10995": "parsim;",
    "11005": "parsl;",
    "64256": "fflig;",
    "64257": "filig;",
    "64258": "fllig;",
    "64259": "ffilig;",
    "64260": "ffllig;"
}
},{}],33:[function(require,module,exports){
/*!
 * escape-html
 * Copyright(c) 2012-2013 TJ Holowaychuk
 * Copyright(c) 2015 Andreas Lubbe
 * Copyright(c) 2015 Tiancheng "Timothy" Gu
 * MIT Licensed
 */

'use strict';

/**
 * Module variables.
 * @private
 */

var matchHtmlRegExp = /["'&<>]/;

/**
 * Module exports.
 * @public
 */

module.exports = escapeHtml;

/**
 * Escape special characters in the given string of html.
 *
 * @param  {string} string The string to escape for inserting into HTML
 * @return {string}
 * @public
 */

function escapeHtml(string) {
  var str = '' + string;
  var match = matchHtmlRegExp.exec(str);

  if (!match) {
    return str;
  }

  var escape;
  var html = '';
  var index = 0;
  var lastIndex = 0;

  for (index = match.index; index < str.length; index++) {
    switch (str.charCodeAt(index)) {
      case 34: // "
        escape = '&quot;';
        break;
      case 38: // &
        escape = '&amp;';
        break;
      case 39: // '
        escape = '&#39;';
        break;
      case 60: // <
        escape = '&lt;';
        break;
      case 62: // >
        escape = '&gt;';
        break;
      default:
        continue;
    }

    if (lastIndex !== index) {
      html += str.substring(lastIndex, index);
    }

    lastIndex = index + 1;
    html += escape;
  }

  return lastIndex !== index
    ? html + str.substring(lastIndex, index)
    : html;
}

},{}],34:[function(require,module,exports){
'use strict';

var hasOwn = Object.prototype.hasOwnProperty;
var toStr = Object.prototype.toString;

var isArray = function isArray(arr) {
	if (typeof Array.isArray === 'function') {
		return Array.isArray(arr);
	}

	return toStr.call(arr) === '[object Array]';
};

var isPlainObject = function isPlainObject(obj) {
	if (!obj || toStr.call(obj) !== '[object Object]') {
		return false;
	}

	var hasOwnConstructor = hasOwn.call(obj, 'constructor');
	var hasIsPrototypeOf = obj.constructor && obj.constructor.prototype && hasOwn.call(obj.constructor.prototype, 'isPrototypeOf');
	// Not own constructor property must be Object
	if (obj.constructor && !hasOwnConstructor && !hasIsPrototypeOf) {
		return false;
	}

	// Own properties are enumerated firstly, so to speed up,
	// if last one is own, then all properties are own.
	var key;
	for (key in obj) {/**/}

	return typeof key === 'undefined' || hasOwn.call(obj, key);
};

module.exports = function extend() {
	var options, name, src, copy, copyIsArray, clone,
		target = arguments[0],
		i = 1,
		length = arguments.length,
		deep = false;

	// Handle a deep copy situation
	if (typeof target === 'boolean') {
		deep = target;
		target = arguments[1] || {};
		// skip the boolean and the target
		i = 2;
	} else if ((typeof target !== 'object' && typeof target !== 'function') || target == null) {
		target = {};
	}

	for (; i < length; ++i) {
		options = arguments[i];
		// Only deal with non-null/undefined values
		if (options != null) {
			// Extend the base object
			for (name in options) {
				src = target[name];
				copy = options[name];

				// Prevent never-ending loop
				if (target !== copy) {
					// Recurse if we're merging plain objects or arrays
					if (deep && copy && (isPlainObject(copy) || (copyIsArray = isArray(copy)))) {
						if (copyIsArray) {
							copyIsArray = false;
							clone = src && isArray(src) ? src : [];
						} else {
							clone = src && isPlainObject(src) ? src : {};
						}

						// Never move original objects, clone them
						target[name] = extend(deep, clone, copy);

					// Don't bring in undefined values
					} else if (typeof copy !== 'undefined') {
						target[name] = copy;
					}
				}
			}
		}
	}

	// Return the modified object
	return target;
};


},{}],35:[function(require,module,exports){
module.exports = stringify
function stringify (obj) {
  return JSON.stringify(obj, function (key, value) {
    if (value instanceof Function || typeof value == 'function') {
      return value.toString()
    }
    if (value instanceof RegExp) {
      return '_PxEgEr_' + value
    }
    return value
  })
}

},{}],36:[function(require,module,exports){
(function (global){
var topLevel = typeof global !== 'undefined' ? global :
    typeof window !== 'undefined' ? window : {}
var minDoc = require('min-document');

if (typeof document !== 'undefined') {
    module.exports = document;
} else {
    var doccy = topLevel['__GLOBAL_DOCUMENT_CACHE@4'];

    if (!doccy) {
        doccy = topLevel['__GLOBAL_DOCUMENT_CACHE@4'] = minDoc;
    }

    module.exports = doccy;
}

}).call(this,typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {})
},{"min-document":2}],37:[function(require,module,exports){
(function (global){
if (typeof window !== "undefined") {
    module.exports = window;
} else if (typeof global !== "undefined") {
    module.exports = global;
} else if (typeof self !== "undefined"){
    module.exports = self;
} else {
    module.exports = {};
}

}).call(this,typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {})
},{}],38:[function(require,module,exports){
module.exports = attributeToProperty

var transform = {
  'class': 'className',
  'for': 'htmlFor',
  'http-equiv': 'httpEquiv'
}

function attributeToProperty (h) {
  return function (tagName, attrs, children) {
    for (var attr in attrs) {
      if (attr in transform) {
        attrs[transform[attr]] = attrs[attr]
        delete attrs[attr]
      }
    }
    return h(tagName, attrs, children)
  }
}

},{}],39:[function(require,module,exports){
var attrToProp = require('hyperscript-attribute-to-property')

var VAR = 0, TEXT = 1, OPEN = 2, CLOSE = 3, ATTR = 4
var ATTR_KEY = 5, ATTR_KEY_W = 6
var ATTR_VALUE_W = 7, ATTR_VALUE = 8
var ATTR_VALUE_SQ = 9, ATTR_VALUE_DQ = 10
var ATTR_EQ = 11, ATTR_BREAK = 12
var COMMENT = 13

module.exports = function (h, opts) {
  if (!opts) opts = {}
  var concat = opts.concat || function (a, b) {
    return String(a) + String(b)
  }
  if (opts.attrToProp !== false) {
    h = attrToProp(h)
  }

  return function (strings) {
    var state = TEXT, reg = ''
    var arglen = arguments.length
    var parts = []

    for (var i = 0; i < strings.length; i++) {
      if (i < arglen - 1) {
        var arg = arguments[i+1]
        var p = parse(strings[i])
        var xstate = state
        if (xstate === ATTR_VALUE_DQ) xstate = ATTR_VALUE
        if (xstate === ATTR_VALUE_SQ) xstate = ATTR_VALUE
        if (xstate === ATTR_VALUE_W) xstate = ATTR_VALUE
        if (xstate === ATTR) xstate = ATTR_KEY
        p.push([ VAR, xstate, arg ])
        parts.push.apply(parts, p)
      } else parts.push.apply(parts, parse(strings[i]))
    }

    var tree = [null,{},[]]
    var stack = [[tree,-1]]
    for (var i = 0; i < parts.length; i++) {
      var cur = stack[stack.length-1][0]
      var p = parts[i], s = p[0]
      if (s === OPEN && /^\//.test(p[1])) {
        var ix = stack[stack.length-1][1]
        if (stack.length > 1) {
          stack.pop()
          stack[stack.length-1][0][2][ix] = h(
            cur[0], cur[1], cur[2].length ? cur[2] : undefined
          )
        }
      } else if (s === OPEN) {
        var c = [p[1],{},[]]
        cur[2].push(c)
        stack.push([c,cur[2].length-1])
      } else if (s === ATTR_KEY || (s === VAR && p[1] === ATTR_KEY)) {
        var key = ''
        var copyKey
        for (; i < parts.length; i++) {
          if (parts[i][0] === ATTR_KEY) {
            key = concat(key, parts[i][1])
          } else if (parts[i][0] === VAR && parts[i][1] === ATTR_KEY) {
            if (typeof parts[i][2] === 'object' && !key) {
              for (copyKey in parts[i][2]) {
                if (parts[i][2].hasOwnProperty(copyKey) && !cur[1][copyKey]) {
                  cur[1][copyKey] = parts[i][2][copyKey]
                }
              }
            } else {
              key = concat(key, parts[i][2])
            }
          } else break
        }
        if (parts[i][0] === ATTR_EQ) i++
        var j = i
        for (; i < parts.length; i++) {
          if (parts[i][0] === ATTR_VALUE || parts[i][0] === ATTR_KEY) {
            if (!cur[1][key]) cur[1][key] = strfn(parts[i][1])
            else cur[1][key] = concat(cur[1][key], parts[i][1])
          } else if (parts[i][0] === VAR
          && (parts[i][1] === ATTR_VALUE || parts[i][1] === ATTR_KEY)) {
            if (!cur[1][key]) cur[1][key] = strfn(parts[i][2])
            else cur[1][key] = concat(cur[1][key], parts[i][2])
          } else {
            if (key.length && !cur[1][key] && i === j
            && (parts[i][0] === CLOSE || parts[i][0] === ATTR_BREAK)) {
              // https://html.spec.whatwg.org/multipage/infrastructure.html#boolean-attributes
              // empty string is falsy, not well behaved value in browser
              cur[1][key] = key.toLowerCase()
            }
            break
          }
        }
      } else if (s === ATTR_KEY) {
        cur[1][p[1]] = true
      } else if (s === VAR && p[1] === ATTR_KEY) {
        cur[1][p[2]] = true
      } else if (s === CLOSE) {
        if (selfClosing(cur[0]) && stack.length) {
          var ix = stack[stack.length-1][1]
          stack.pop()
          stack[stack.length-1][0][2][ix] = h(
            cur[0], cur[1], cur[2].length ? cur[2] : undefined
          )
        }
      } else if (s === VAR && p[1] === TEXT) {
        if (p[2] === undefined || p[2] === null) p[2] = ''
        else if (!p[2]) p[2] = concat('', p[2])
        if (Array.isArray(p[2][0])) {
          cur[2].push.apply(cur[2], p[2])
        } else {
          cur[2].push(p[2])
        }
      } else if (s === TEXT) {
        cur[2].push(p[1])
      } else if (s === ATTR_EQ || s === ATTR_BREAK) {
        // no-op
      } else {
        throw new Error('unhandled: ' + s)
      }
    }

    if (tree[2].length > 1 && /^\s*$/.test(tree[2][0])) {
      tree[2].shift()
    }

    if (tree[2].length > 2
    || (tree[2].length === 2 && /\S/.test(tree[2][1]))) {
      throw new Error(
        'multiple root elements must be wrapped in an enclosing tag'
      )
    }
    if (Array.isArray(tree[2][0]) && typeof tree[2][0][0] === 'string'
    && Array.isArray(tree[2][0][2])) {
      tree[2][0] = h(tree[2][0][0], tree[2][0][1], tree[2][0][2])
    }
    return tree[2][0]

    function parse (str) {
      var res = []
      if (state === ATTR_VALUE_W) state = ATTR
      for (var i = 0; i < str.length; i++) {
        var c = str.charAt(i)
        if (state === TEXT && c === '<') {
          if (reg.length) res.push([TEXT, reg])
          reg = ''
          state = OPEN
        } else if (c === '>' && !quot(state) && state !== COMMENT) {
          if (state === OPEN) {
            res.push([OPEN,reg])
          } else if (state === ATTR_KEY) {
            res.push([ATTR_KEY,reg])
          } else if (state === ATTR_VALUE && reg.length) {
            res.push([ATTR_VALUE,reg])
          }
          res.push([CLOSE])
          reg = ''
          state = TEXT
        } else if (state === COMMENT && /-$/.test(reg) && c === '-') {
          if (opts.comments) {
            res.push([ATTR_VALUE,reg.substr(0, reg.length - 1)],[CLOSE])
          }
          reg = ''
          state = TEXT
        } else if (state === OPEN && /^!--$/.test(reg)) {
          if (opts.comments) {
            res.push([OPEN, reg],[ATTR_KEY,'comment'],[ATTR_EQ])
          }
          reg = c
          state = COMMENT
        } else if (state === TEXT || state === COMMENT) {
          reg += c
        } else if (state === OPEN && /\s/.test(c)) {
          res.push([OPEN, reg])
          reg = ''
          state = ATTR
        } else if (state === OPEN) {
          reg += c
        } else if (state === ATTR && /[^\s"'=/]/.test(c)) {
          state = ATTR_KEY
          reg = c
        } else if (state === ATTR && /\s/.test(c)) {
          if (reg.length) res.push([ATTR_KEY,reg])
          res.push([ATTR_BREAK])
        } else if (state === ATTR_KEY && /\s/.test(c)) {
          res.push([ATTR_KEY,reg])
          reg = ''
          state = ATTR_KEY_W
        } else if (state === ATTR_KEY && c === '=') {
          res.push([ATTR_KEY,reg],[ATTR_EQ])
          reg = ''
          state = ATTR_VALUE_W
        } else if (state === ATTR_KEY) {
          reg += c
        } else if ((state === ATTR_KEY_W || state === ATTR) && c === '=') {
          res.push([ATTR_EQ])
          state = ATTR_VALUE_W
        } else if ((state === ATTR_KEY_W || state === ATTR) && !/\s/.test(c)) {
          res.push([ATTR_BREAK])
          if (/[\w-]/.test(c)) {
            reg += c
            state = ATTR_KEY
          } else state = ATTR
        } else if (state === ATTR_VALUE_W && c === '"') {
          state = ATTR_VALUE_DQ
        } else if (state === ATTR_VALUE_W && c === "'") {
          state = ATTR_VALUE_SQ
        } else if (state === ATTR_VALUE_DQ && c === '"') {
          res.push([ATTR_VALUE,reg],[ATTR_BREAK])
          reg = ''
          state = ATTR
        } else if (state === ATTR_VALUE_SQ && c === "'") {
          res.push([ATTR_VALUE,reg],[ATTR_BREAK])
          reg = ''
          state = ATTR
        } else if (state === ATTR_VALUE_W && !/\s/.test(c)) {
          state = ATTR_VALUE
          i--
        } else if (state === ATTR_VALUE && /\s/.test(c)) {
          res.push([ATTR_VALUE,reg],[ATTR_BREAK])
          reg = ''
          state = ATTR
        } else if (state === ATTR_VALUE || state === ATTR_VALUE_SQ
        || state === ATTR_VALUE_DQ) {
          reg += c
        }
      }
      if (state === TEXT && reg.length) {
        res.push([TEXT,reg])
        reg = ''
      } else if (state === ATTR_VALUE && reg.length) {
        res.push([ATTR_VALUE,reg])
        reg = ''
      } else if (state === ATTR_VALUE_DQ && reg.length) {
        res.push([ATTR_VALUE,reg])
        reg = ''
      } else if (state === ATTR_VALUE_SQ && reg.length) {
        res.push([ATTR_VALUE,reg])
        reg = ''
      } else if (state === ATTR_KEY) {
        res.push([ATTR_KEY,reg])
        reg = ''
      }
      return res
    }
  }

  function strfn (x) {
    if (typeof x === 'function') return x
    else if (typeof x === 'string') return x
    else if (x && typeof x === 'object') return x
    else return concat('', x)
  }
}

function quot (state) {
  return state === ATTR_VALUE_SQ || state === ATTR_VALUE_DQ
}

var hasOwn = Object.prototype.hasOwnProperty
function has (obj, key) { return hasOwn.call(obj, key) }

var closeRE = RegExp('^(' + [
  'area', 'base', 'basefont', 'bgsound', 'br', 'col', 'command', 'embed',
  'frame', 'hr', 'img', 'input', 'isindex', 'keygen', 'link', 'meta', 'param',
  'source', 'track', 'wbr', '!--',
  // SVG TAGS
  'animate', 'animateTransform', 'circle', 'cursor', 'desc', 'ellipse',
  'feBlend', 'feColorMatrix', 'feComposite',
  'feConvolveMatrix', 'feDiffuseLighting', 'feDisplacementMap',
  'feDistantLight', 'feFlood', 'feFuncA', 'feFuncB', 'feFuncG', 'feFuncR',
  'feGaussianBlur', 'feImage', 'feMergeNode', 'feMorphology',
  'feOffset', 'fePointLight', 'feSpecularLighting', 'feSpotLight', 'feTile',
  'feTurbulence', 'font-face-format', 'font-face-name', 'font-face-uri',
  'glyph', 'glyphRef', 'hkern', 'image', 'line', 'missing-glyph', 'mpath',
  'path', 'polygon', 'polyline', 'rect', 'set', 'stop', 'tref', 'use', 'view',
  'vkern'
].join('|') + ')(?:[\.#][a-zA-Z0-9\u007F-\uFFFF_:-]+)*$')
function selfClosing (tag) { return closeRE.test(tag) }

},{"hyperscript-attribute-to-property":38}],40:[function(require,module,exports){
var inserted = {};

module.exports = function (css, options) {
    if (inserted[css]) return;
    inserted[css] = true;
    
    var elem = document.createElement('style');
    elem.setAttribute('type', 'text/css');

    if ('textContent' in elem) {
      elem.textContent = css;
    } else {
      elem.styleSheet.cssText = css;
    }
    
    var head = document.getElementsByTagName('head')[0];
    if (options && options.prepend) {
        head.insertBefore(elem, head.childNodes[0]);
    } else {
        head.appendChild(elem);
    }
};

},{}],41:[function(require,module,exports){
'use strict'
var type = require('component-type')
var CircularJSON = require('circular-json')
var domserialize = typeof window !== 'undefined' ?
  require('dom-serialize')
  : noop
var stringify = require('fnjson/source/node_modules/_stringify')

function noop () {}
var m = 'Converting circular structure to JSON'

module.exports = javascriptserialize

function javascriptserialize () {
  return [].slice.call(arguments).map(function (item) {
    try {
      if (type(item) === 'arguments') item = [].slice.call(item)
      else if (type(item) === 'element') item = domserialize(item)
      else if (type(item) === 'nan') item = 'NaN'
      else if (type(item) === 'regexp') item = item+''
      else if (type(item) === 'error') {
        item._message = item.message
        item._stack = item.stack
        item._name = item.name
      }
      var x = JSON.parse(stringify(item))
      x = CircularJSON.stringify(x)
      if (x === undefined) throw new Error()
      else item = JSON.stringify(JSON.parse(x), null, 2)
    } catch (e) {
      if (m === e.message) {
        try {
         x = CircularJSON.stringify(item)
         if (x === undefined) throw new Error()
         else item = JSON.stringify(JSON.parse(x), null, 2)
        } catch (e) {}
      }
      item = item+''
    } finally { return item }
  })
}

},{"circular-json":8,"component-type":9,"dom-serialize":30,"fnjson/source/node_modules/_stringify":35}],42:[function(require,module,exports){
/**
The following batches are equivalent:

var beautify_js = require('js-beautify');
var beautify_js = require('js-beautify').js;
var beautify_js = require('js-beautify').js_beautify;

var beautify_css = require('js-beautify').css;
var beautify_css = require('js-beautify').css_beautify;

var beautify_html = require('js-beautify').html;
var beautify_html = require('js-beautify').html_beautify;

All methods returned accept two arguments, the source string and an options object.
**/

function get_beautify(js_beautify, css_beautify, html_beautify) {
    // the default is js
    var beautify = function (src, config) {
        return js_beautify.js_beautify(src, config);
    };

    // short aliases
    beautify.js   = js_beautify.js_beautify;
    beautify.css  = css_beautify.css_beautify;
    beautify.html = html_beautify.html_beautify;

    // legacy aliases
    beautify.js_beautify   = js_beautify.js_beautify;
    beautify.css_beautify  = css_beautify.css_beautify;
    beautify.html_beautify = html_beautify.html_beautify;

    return beautify;
}

if (typeof define === "function" && define.amd) {
    // Add support for AMD ( https://github.com/amdjs/amdjs-api/wiki/AMD#defineamd-property- )
    define([
        "./lib/beautify",
        "./lib/beautify-css",
        "./lib/beautify-html"
    ], function(js_beautify, css_beautify, html_beautify) {
        return get_beautify(js_beautify, css_beautify, html_beautify);
    });
} else {
    (function(mod) {
        var js_beautify = require('./lib/beautify');
        var css_beautify = require('./lib/beautify-css');
        var html_beautify = require('./lib/beautify-html');

        mod.exports = get_beautify(js_beautify, css_beautify, html_beautify);

    })(module);
}


},{"./lib/beautify":45,"./lib/beautify-css":43,"./lib/beautify-html":44}],43:[function(require,module,exports){
(function (global){
/*jshint curly:true, eqeqeq:true, laxbreak:true, noempty:false */
/*

  The MIT License (MIT)

  Copyright (c) 2007-2013 Einar Lielmanis and contributors.

  Permission is hereby granted, free of charge, to any person
  obtaining a copy of this software and associated documentation files
  (the "Software"), to deal in the Software without restriction,
  including without limitation the rights to use, copy, modify, merge,
  publish, distribute, sublicense, and/or sell copies of the Software,
  and to permit persons to whom the Software is furnished to do so,
  subject to the following conditions:

  The above copyright notice and this permission notice shall be
  included in all copies or substantial portions of the Software.

  THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
  EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
  MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND
  NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS
  BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN
  ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN
  CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
  SOFTWARE.


 CSS Beautifier
---------------

    Written by Harutyun Amirjanyan, (amirjanyan@gmail.com)

    Based on code initially developed by: Einar Lielmanis, <einar@jsbeautifier.org>
        http://jsbeautifier.org/

    Usage:
        css_beautify(source_text);
        css_beautify(source_text, options);

    The options are (default in brackets):
        indent_size (4)                   — indentation size,
        indent_char (space)               — character to indent with,
        selector_separator_newline (true) - separate selectors with newline or
                                            not (e.g. "a,\nbr" or "a, br")
        end_with_newline (false)          - end with a newline
        newline_between_rules (true)      - add a new line after every css rule

    e.g

    css_beautify(css_source_text, {
      'indent_size': 1,
      'indent_char': '\t',
      'selector_separator': ' ',
      'end_with_newline': false,
      'newline_between_rules': true
    });
*/

// http://www.w3.org/TR/CSS21/syndata.html#tokenization
// http://www.w3.org/TR/css3-syntax/

(function() {
    function css_beautify(source_text, options) {
        options = options || {};
        source_text = source_text || '';
        // HACK: newline parsing inconsistent. This brute force normalizes the input.
        source_text = source_text.replace(/\r\n|[\r\u2028\u2029]/g, '\n')

        var indentSize = options.indent_size || 4;
        var indentCharacter = options.indent_char || ' ';
        var selectorSeparatorNewline = (options.selector_separator_newline === undefined) ? true : options.selector_separator_newline;
        var end_with_newline = (options.end_with_newline === undefined) ? false : options.end_with_newline;
        var newline_between_rules = (options.newline_between_rules === undefined) ? true : options.newline_between_rules;
        var eol = options.eol ? options.eol : '\n';

        // compatibility
        if (typeof indentSize === "string") {
            indentSize = parseInt(indentSize, 10);
        }

        if(options.indent_with_tabs){
            indentCharacter = '\t';
            indentSize = 1;
        }

        eol = eol.replace(/\\r/, '\r').replace(/\\n/, '\n')


        // tokenizer
        var whiteRe = /^\s+$/;
        var wordRe = /[\w$\-_]/;

        var pos = -1,
            ch;
        var parenLevel = 0;

        function next() {
            ch = source_text.charAt(++pos);
            return ch || '';
        }

        function peek(skipWhitespace) {
            var result = '';
            var prev_pos = pos;
            if (skipWhitespace) {
                eatWhitespace();
            }
            result = source_text.charAt(pos + 1) || '';
            pos = prev_pos - 1;
            next();
            return result;
        }

        function eatString(endChars) {
            var start = pos;
            while (next()) {
                if (ch === "\\") {
                    next();
                } else if (endChars.indexOf(ch) !== -1) {
                    break;
                } else if (ch === "\n") {
                    break;
                }
            }
            return source_text.substring(start, pos + 1);
        }

        function peekString(endChar) {
            var prev_pos = pos;
            var str = eatString(endChar);
            pos = prev_pos - 1;
            next();
            return str;
        }

        function eatWhitespace() {
            var result = '';
            while (whiteRe.test(peek())) {
                next();
                result += ch;
            }
            return result;
        }

        function skipWhitespace() {
            var result = '';
            if (ch && whiteRe.test(ch)) {
                result = ch;
            }
            while (whiteRe.test(next())) {
                result += ch;
            }
            return result;
        }

        function eatComment(singleLine) {
            var start = pos;
            singleLine = peek() === "/";
            next();
            while (next()) {
                if (!singleLine && ch === "*" && peek() === "/") {
                    next();
                    break;
                } else if (singleLine && ch === "\n") {
                    return source_text.substring(start, pos);
                }
            }

            return source_text.substring(start, pos) + ch;
        }


        function lookBack(str) {
            return source_text.substring(pos - str.length, pos).toLowerCase() ===
                str;
        }

        // Nested pseudo-class if we are insideRule
        // and the next special character found opens
        // a new block
        function foundNestedPseudoClass() {
            var openParen = 0;
            for (var i = pos + 1; i < source_text.length; i++) {
                var ch = source_text.charAt(i);
                if (ch === "{") {
                    return true;
                } else if (ch === '(') {
                    // pseudoclasses can contain ()
                    openParen += 1;
                } else if (ch === ')') {
                    if (openParen == 0) {
                        return false;
                    }
                    openParen -= 1;
                } else if (ch === ";" || ch === "}") {
                    return false;
                }
            }
            return false;
        }

        // printer
        var basebaseIndentString = source_text.match(/^[\t ]*/)[0];
        var singleIndent = new Array(indentSize + 1).join(indentCharacter);
        var indentLevel = 0;
        var nestedLevel = 0;

        function indent() {
            indentLevel++;
            basebaseIndentString += singleIndent;
        }

        function outdent() {
            indentLevel--;
            basebaseIndentString = basebaseIndentString.slice(0, -indentSize);
        }

        var print = {};
        print["{"] = function(ch) {
            print.singleSpace();
            output.push(ch);
            print.newLine();
        };
        print["}"] = function(ch) {
            print.newLine();
            output.push(ch);
            print.newLine();
        };

        print._lastCharWhitespace = function() {
            return whiteRe.test(output[output.length - 1]);
        };

        print.newLine = function(keepWhitespace) {
            if (output.length) {
                if (!keepWhitespace && output[output.length - 1] !== '\n') {
                    print.trim();
                }

                output.push('\n');

                if (basebaseIndentString) {
                    output.push(basebaseIndentString);
                }
            }
        };
        print.singleSpace = function() {
            if (output.length && !print._lastCharWhitespace()) {
                output.push(' ');
            }
        };

        print.preserveSingleSpace = function() {
            if (isAfterSpace) {
                print.singleSpace();
            }
        };

        print.trim = function() {
            while (print._lastCharWhitespace()) {
                output.pop();
            }
        };


        var output = [];
        /*_____________________--------------------_____________________*/

        var insideRule = false;
        var insidePropertyValue = false;
        var enteringConditionalGroup = false;
        var top_ch = '';
        var last_top_ch = '';

        while (true) {
            var whitespace = skipWhitespace();
            var isAfterSpace = whitespace !== '';
            var isAfterNewline = whitespace.indexOf('\n') !== -1;
            last_top_ch = top_ch;
            top_ch = ch;

            if (!ch) {
                break;
            } else if (ch === '/' && peek() === '*') { /* css comment */
                var header = indentLevel === 0;

                if (isAfterNewline || header) {
                    print.newLine();
                }

                output.push(eatComment());
                print.newLine();
                if (header) {
                    print.newLine(true);
                }
            } else if (ch === '/' && peek() === '/') { // single line comment
                if (!isAfterNewline && last_top_ch !== '{' ) {
                    print.trim();
                }
                print.singleSpace();
                output.push(eatComment());
                print.newLine();
            } else if (ch === '@') {
                print.preserveSingleSpace();
                output.push(ch);

                // strip trailing space, if present, for hash property checks
                var variableOrRule = peekString(": ,;{}()[]/='\"");

                if (variableOrRule.match(/[ :]$/)) {
                    // we have a variable or pseudo-class, add it and insert one space before continuing
                    next();
                    variableOrRule = eatString(": ").replace(/\s$/, '');
                    output.push(variableOrRule);
                    print.singleSpace();
                }

                variableOrRule = variableOrRule.replace(/\s$/, '')

                // might be a nesting at-rule
                if (variableOrRule in css_beautify.NESTED_AT_RULE) {
                    nestedLevel += 1;
                    if (variableOrRule in css_beautify.CONDITIONAL_GROUP_RULE) {
                        enteringConditionalGroup = true;
                    }
                }
            } else if (ch === '#' && peek() === '{') {
              print.preserveSingleSpace();
              output.push(eatString('}'));
            } else if (ch === '{') {
                if (peek(true) === '}') {
                    eatWhitespace();
                    next();
                    print.singleSpace();
                    output.push("{}");
                    print.newLine();
                    if (newline_between_rules && indentLevel === 0) {
                        print.newLine(true);
                    }
                } else {
                    indent();
                    print["{"](ch);
                    // when entering conditional groups, only rulesets are allowed
                    if (enteringConditionalGroup) {
                        enteringConditionalGroup = false;
                        insideRule = (indentLevel > nestedLevel);
                    } else {
                        // otherwise, declarations are also allowed
                        insideRule = (indentLevel >= nestedLevel);
                    }
                }
            } else if (ch === '}') {
                outdent();
                print["}"](ch);
                insideRule = false;
                insidePropertyValue = false;
                if (nestedLevel) {
                    nestedLevel--;
                }
                if (newline_between_rules && indentLevel === 0) {
                    print.newLine(true);
                }
            } else if (ch === ":") {
                eatWhitespace();
                if ((insideRule || enteringConditionalGroup) &&
                    !(lookBack("&") || foundNestedPseudoClass())) {
                    // 'property: value' delimiter
                    // which could be in a conditional group query
                    insidePropertyValue = true;
                    output.push(':');
                    print.singleSpace();
                } else {
                    // sass/less parent reference don't use a space
                    // sass nested pseudo-class don't use a space
                    if (peek() === ":") {
                        // pseudo-element
                        next();
                        output.push("::");
                    } else {
                        // pseudo-class
                        output.push(':');
                    }
                }
            } else if (ch === '"' || ch === '\'') {
                print.preserveSingleSpace();
                output.push(eatString(ch));
            } else if (ch === ';') {
                insidePropertyValue = false;
                output.push(ch);
                print.newLine();
            } else if (ch === '(') { // may be a url
                if (lookBack("url")) {
                    output.push(ch);
                    eatWhitespace();
                    if (next()) {
                        if (ch !== ')' && ch !== '"' && ch !== '\'') {
                            output.push(eatString(')'));
                        } else {
                            pos--;
                        }
                    }
                } else {
                    parenLevel++;
                    print.preserveSingleSpace();
                    output.push(ch);
                    eatWhitespace();
                }
            } else if (ch === ')') {
                output.push(ch);
                parenLevel--;
            } else if (ch === ',') {
                output.push(ch);
                eatWhitespace();
                if (selectorSeparatorNewline && !insidePropertyValue && parenLevel < 1) {
                    print.newLine();
                } else {
                    print.singleSpace();
                }
            } else if (ch === ']') {
                output.push(ch);
            } else if (ch === '[') {
                print.preserveSingleSpace();
                output.push(ch);
            } else if (ch === '=') { // no whitespace before or after
                eatWhitespace()
                ch = '=';
                output.push(ch);
            } else {
                print.preserveSingleSpace();
                output.push(ch);
            }
        }


        var sweetCode = '';
        if (basebaseIndentString) {
            sweetCode += basebaseIndentString;
        }

        sweetCode += output.join('').replace(/[\r\n\t ]+$/, '');

        // establish end_with_newline
        if (end_with_newline) {
            sweetCode += '\n';
        }

        if (eol != '\n') {
            sweetCode = sweetCode.replace(/[\n]/g, eol);
        }

        return sweetCode;
    }

    // https://developer.mozilla.org/en-US/docs/Web/CSS/At-rule
    css_beautify.NESTED_AT_RULE = {
        "@page": true,
        "@font-face": true,
        "@keyframes": true,
        // also in CONDITIONAL_GROUP_RULE below
        "@media": true,
        "@supports": true,
        "@document": true
    };
    css_beautify.CONDITIONAL_GROUP_RULE = {
        "@media": true,
        "@supports": true,
        "@document": true
    };

    /*global define */
    if (typeof define === "function" && define.amd) {
        // Add support for AMD ( https://github.com/amdjs/amdjs-api/wiki/AMD#defineamd-property- )
        define([], function() {
            return {
                css_beautify: css_beautify
            };
        });
    } else if (typeof exports !== "undefined") {
        // Add support for CommonJS. Just put this file somewhere on your require.paths
        // and you will be able to `var html_beautify = require("beautify").html_beautify`.
        exports.css_beautify = css_beautify;
    } else if (typeof window !== "undefined") {
        // If we're running a web page and don't have either of the above, add our one global
        window.css_beautify = css_beautify;
    } else if (typeof global !== "undefined") {
        // If we don't even have window, try global.
        global.css_beautify = css_beautify;
    }

}());

}).call(this,typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {})
},{}],44:[function(require,module,exports){
(function (global){
/*jshint curly:true, eqeqeq:true, laxbreak:true, noempty:false */
/*

  The MIT License (MIT)

  Copyright (c) 2007-2013 Einar Lielmanis and contributors.

  Permission is hereby granted, free of charge, to any person
  obtaining a copy of this software and associated documentation files
  (the "Software"), to deal in the Software without restriction,
  including without limitation the rights to use, copy, modify, merge,
  publish, distribute, sublicense, and/or sell copies of the Software,
  and to permit persons to whom the Software is furnished to do so,
  subject to the following conditions:

  The above copyright notice and this permission notice shall be
  included in all copies or substantial portions of the Software.

  THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
  EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
  MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND
  NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS
  BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN
  ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN
  CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
  SOFTWARE.


 Style HTML
---------------

  Written by Nochum Sossonko, (nsossonko@hotmail.com)

  Based on code initially developed by: Einar Lielmanis, <einar@jsbeautifier.org>
    http://jsbeautifier.org/

  Usage:
    style_html(html_source);

    style_html(html_source, options);

  The options are:
    indent_inner_html (default false)  — indent <head> and <body> sections,
    indent_size (default 4)          — indentation size,
    indent_char (default space)      — character to indent with,
    wrap_line_length (default 250)            -  maximum amount of characters per line (0 = disable)
    brace_style (default "collapse") - "collapse" | "expand" | "end-expand" | "none"
            put braces on the same line as control statements (default), or put braces on own line (Allman / ANSI style), or just put end braces on own line, or attempt to keep them where they are.
    unformatted (defaults to inline tags) - list of tags, that shouldn't be reformatted
    indent_scripts (default normal)  - "keep"|"separate"|"normal"
    preserve_newlines (default true) - whether existing line breaks before elements should be preserved
                                        Only works before elements, not inside tags or for text.
    max_preserve_newlines (default unlimited) - maximum number of line breaks to be preserved in one chunk
    indent_handlebars (default false) - format and indent {{#foo}} and {{/foo}}
    end_with_newline (false)          - end with a newline
    extra_liners (default [head,body,/html]) -List of tags that should have an extra newline before them.

    e.g.

    style_html(html_source, {
      'indent_inner_html': false,
      'indent_size': 2,
      'indent_char': ' ',
      'wrap_line_length': 78,
      'brace_style': 'expand',
      'preserve_newlines': true,
      'max_preserve_newlines': 5,
      'indent_handlebars': false,
      'extra_liners': ['/html']
    });
*/

(function() {

    function trim(s) {
        return s.replace(/^\s+|\s+$/g, '');
    }

    function ltrim(s) {
        return s.replace(/^\s+/g, '');
    }

    function rtrim(s) {
        return s.replace(/\s+$/g,'');
    }

    function style_html(html_source, options, js_beautify, css_beautify) {
        //Wrapper function to invoke all the necessary constructors and deal with the output.

        var multi_parser,
            indent_inner_html,
            indent_size,
            indent_character,
            wrap_line_length,
            brace_style,
            unformatted,
            preserve_newlines,
            max_preserve_newlines,
            indent_handlebars,
            wrap_attributes,
            wrap_attributes_indent_size,
            end_with_newline,
            extra_liners,
            eol;

        options = options || {};

        // backwards compatibility to 1.3.4
        if ((options.wrap_line_length === undefined || parseInt(options.wrap_line_length, 10) === 0) &&
                (options.max_char !== undefined && parseInt(options.max_char, 10) !== 0)) {
            options.wrap_line_length = options.max_char;
        }

        indent_inner_html = (options.indent_inner_html === undefined) ? false : options.indent_inner_html;
        indent_size = (options.indent_size === undefined) ? 4 : parseInt(options.indent_size, 10);
        indent_character = (options.indent_char === undefined) ? ' ' : options.indent_char;
        brace_style = (options.brace_style === undefined) ? 'collapse' : options.brace_style;
        wrap_line_length =  parseInt(options.wrap_line_length, 10) === 0 ? 32786 : parseInt(options.wrap_line_length || 250, 10);
        unformatted = options.unformatted || [
            // https://www.w3.org/TR/html5/dom.html#phrasing-content
            'a', 'abbr', 'area', 'audio', 'b', 'bdi', 'bdo', 'br', 'button', 'canvas', 'cite',
            'code', 'data', 'datalist', 'del', 'dfn', 'em', 'embed', 'i', 'iframe', 'img',
            'input', 'ins', 'kbd', 'keygen', 'label', 'map', 'mark', 'math', 'meter', 'noscript',
            'object', 'output', 'progress', 'q', 'ruby', 's', 'samp', /* 'script', */ 'select', 'small',
            'span', 'strong', 'sub', 'sup', 'svg', 'template', 'textarea', 'time', 'u', 'var',
            'video', 'wbr', 'text',
            // prexisting - not sure of full effect of removing, leaving in
            'acronym', 'address', 'big', 'dt', 'ins', 'small', 'strike', 'tt',
            'pre',
            'h1', 'h2', 'h3', 'h4', 'h5', 'h6'
        ];
        preserve_newlines = (options.preserve_newlines === undefined) ? true : options.preserve_newlines;
        max_preserve_newlines = preserve_newlines ?
            (isNaN(parseInt(options.max_preserve_newlines, 10)) ? 32786 : parseInt(options.max_preserve_newlines, 10))
            : 0;
        indent_handlebars = (options.indent_handlebars === undefined) ? false : options.indent_handlebars;
        wrap_attributes = (options.wrap_attributes === undefined) ? 'auto' : options.wrap_attributes;
        wrap_attributes_indent_size = (isNaN(parseInt(options.wrap_attributes_indent_size, 10))) ? indent_size : parseInt(options.wrap_attributes_indent_size, 10);
        end_with_newline = (options.end_with_newline === undefined) ? false : options.end_with_newline;
        extra_liners = (typeof options.extra_liners == 'object') && options.extra_liners ?
            options.extra_liners.concat() : (typeof options.extra_liners === 'string') ?
            options.extra_liners.split(',') : 'head,body,/html'.split(',');
        eol = options.eol ? options.eol : '\n';

        if(options.indent_with_tabs){
            indent_character = '\t';
            indent_size = 1;
        }

        eol = eol.replace(/\\r/, '\r').replace(/\\n/, '\n')

        function Parser() {

            this.pos = 0; //Parser position
            this.token = '';
            this.current_mode = 'CONTENT'; //reflects the current Parser mode: TAG/CONTENT
            this.tags = { //An object to hold tags, their position, and their parent-tags, initiated with default values
                parent: 'parent1',
                parentcount: 1,
                parent1: ''
            };
            this.tag_type = '';
            this.token_text = this.last_token = this.last_text = this.token_type = '';
            this.newlines = 0;
            this.indent_content = indent_inner_html;

            this.Utils = { //Uilities made available to the various functions
                whitespace: "\n\r\t ".split(''),

                single_token: [
                    // HTLM void elements - aka self-closing tags - aka singletons
                    // https://www.w3.org/html/wg/drafts/html/master/syntax.html#void-elements
                    'area', 'base', 'br', 'col', 'embed', 'hr', 'img', 'input', 'keygen',
                    'link', 'menuitem', 'meta', 'param', 'source', 'track', 'wbr',
                    // NOTE: Optional tags - are not understood.
                    // https://www.w3.org/TR/html5/syntax.html#optional-tags
                    // The rules for optional tags are too complex for a simple list
                    // Also, the content of these tags should still be indented in many cases.
                    // 'li' is a good exmple.

                    // Doctype and xml elements
                    '!doctype', '?xml',
                    // ?php tag
                    '?php',
                    // other tags that were in this list, keeping just in case
                    'basefont', 'isindex'
                ],
                extra_liners: extra_liners, //for tags that need a line of whitespace before them
                in_array: function(what, arr) {
                    for (var i = 0; i < arr.length; i++) {
                        if (what === arr[i]) {
                            return true;
                        }
                    }
                    return false;
                }
            };

            // Return true if the given text is composed entirely of whitespace.
            this.is_whitespace = function(text) {
                for (var n = 0; n < text.length; n++) {
                    if (!this.Utils.in_array(text.charAt(n), this.Utils.whitespace)) {
                        return false;
                    }
                }
                return true;
            };

            this.traverse_whitespace = function() {
                var input_char = '';

                input_char = this.input.charAt(this.pos);
                if (this.Utils.in_array(input_char, this.Utils.whitespace)) {
                    this.newlines = 0;
                    while (this.Utils.in_array(input_char, this.Utils.whitespace)) {
                        if (preserve_newlines && input_char === '\n' && this.newlines <= max_preserve_newlines) {
                            this.newlines += 1;
                        }

                        this.pos++;
                        input_char = this.input.charAt(this.pos);
                    }
                    return true;
                }
                return false;
            };

            // Append a space to the given content (string array) or, if we are
            // at the wrap_line_length, append a newline/indentation.
            // return true if a newline was added, false if a space was added
            this.space_or_wrap = function(content) {
                if (this.line_char_count >= this.wrap_line_length) { //insert a line when the wrap_line_length is reached
                    this.print_newline(false, content);
                    this.print_indentation(content);
                    return true;
                } else {
                    this.line_char_count++;
                    content.push(' ');
                    return false;
                }
            };

            this.get_content = function() { //function to capture regular content between tags
                var input_char = '',
                    content = [],
                    space = false; //if a space is needed

                while (this.input.charAt(this.pos) !== '<') {
                    if (this.pos >= this.input.length) {
                        return content.length ? content.join('') : ['', 'TK_EOF'];
                    }

                    if (this.traverse_whitespace()) {
                        this.space_or_wrap(content);
                        continue;
                    }

                    if (indent_handlebars) {
                        // Handlebars parsing is complicated.
                        // {{#foo}} and {{/foo}} are formatted tags.
                        // {{something}} should get treated as content, except:
                        // {{else}} specifically behaves like {{#if}} and {{/if}}
                        var peek3 = this.input.substr(this.pos, 3);
                        if (peek3 === '{{#' || peek3 === '{{/') {
                            // These are tags and not content.
                            break;
                        } else if (peek3 === '{{!') {
                            return [this.get_tag(), 'TK_TAG_HANDLEBARS_COMMENT'];
                        } else if (this.input.substr(this.pos, 2) === '{{') {
                            if (this.get_tag(true) === '{{else}}') {
                                break;
                            }
                        }
                    }

                    input_char = this.input.charAt(this.pos);
                    this.pos++;
                    this.line_char_count++;
                    content.push(input_char); //letter at-a-time (or string) inserted to an array
                }
                return content.length ? content.join('') : '';
            };

            this.get_contents_to = function(name) { //get the full content of a script or style to pass to js_beautify
                if (this.pos === this.input.length) {
                    return ['', 'TK_EOF'];
                }
                var input_char = '';
                var content = '';
                var reg_match = new RegExp('</' + name + '\\s*>', 'igm');
                reg_match.lastIndex = this.pos;
                var reg_array = reg_match.exec(this.input);
                var end_script = reg_array ? reg_array.index : this.input.length; //absolute end of script
                if (this.pos < end_script) { //get everything in between the script tags
                    content = this.input.substring(this.pos, end_script);
                    this.pos = end_script;
                }
                return content;
            };

            this.record_tag = function(tag) { //function to record a tag and its parent in this.tags Object
                if (this.tags[tag + 'count']) { //check for the existence of this tag type
                    this.tags[tag + 'count']++;
                    this.tags[tag + this.tags[tag + 'count']] = this.indent_level; //and record the present indent level
                } else { //otherwise initialize this tag type
                    this.tags[tag + 'count'] = 1;
                    this.tags[tag + this.tags[tag + 'count']] = this.indent_level; //and record the present indent level
                }
                this.tags[tag + this.tags[tag + 'count'] + 'parent'] = this.tags.parent; //set the parent (i.e. in the case of a div this.tags.div1parent)
                this.tags.parent = tag + this.tags[tag + 'count']; //and make this the current parent (i.e. in the case of a div 'div1')
            };

            this.retrieve_tag = function(tag) { //function to retrieve the opening tag to the corresponding closer
                if (this.tags[tag + 'count']) { //if the openener is not in the Object we ignore it
                    var temp_parent = this.tags.parent; //check to see if it's a closable tag.
                    while (temp_parent) { //till we reach '' (the initial value);
                        if (tag + this.tags[tag + 'count'] === temp_parent) { //if this is it use it
                            break;
                        }
                        temp_parent = this.tags[temp_parent + 'parent']; //otherwise keep on climbing up the DOM Tree
                    }
                    if (temp_parent) { //if we caught something
                        this.indent_level = this.tags[tag + this.tags[tag + 'count']]; //set the indent_level accordingly
                        this.tags.parent = this.tags[temp_parent + 'parent']; //and set the current parent
                    }
                    delete this.tags[tag + this.tags[tag + 'count'] + 'parent']; //delete the closed tags parent reference...
                    delete this.tags[tag + this.tags[tag + 'count']]; //...and the tag itself
                    if (this.tags[tag + 'count'] === 1) {
                        delete this.tags[tag + 'count'];
                    } else {
                        this.tags[tag + 'count']--;
                    }
                }
            };

            this.indent_to_tag = function(tag) {
                // Match the indentation level to the last use of this tag, but don't remove it.
                if (!this.tags[tag + 'count']) {
                    return;
                }
                var temp_parent = this.tags.parent;
                while (temp_parent) {
                    if (tag + this.tags[tag + 'count'] === temp_parent) {
                        break;
                    }
                    temp_parent = this.tags[temp_parent + 'parent'];
                }
                if (temp_parent) {
                    this.indent_level = this.tags[tag + this.tags[tag + 'count']];
                }
            };

            this.get_tag = function(peek) { //function to get a full tag and parse its type
                var input_char = '',
                    content = [],
                    comment = '',
                    space = false,
                    first_attr = true,
                    tag_start, tag_end,
                    tag_start_char,
                    orig_pos = this.pos,
                    orig_line_char_count = this.line_char_count;

                peek = peek !== undefined ? peek : false;

                do {
                    if (this.pos >= this.input.length) {
                        if (peek) {
                            this.pos = orig_pos;
                            this.line_char_count = orig_line_char_count;
                        }
                        return content.length ? content.join('') : ['', 'TK_EOF'];
                    }

                    input_char = this.input.charAt(this.pos);
                    this.pos++;

                    if (this.Utils.in_array(input_char, this.Utils.whitespace)) { //don't want to insert unnecessary space
                        space = true;
                        continue;
                    }

                    if (input_char === "'" || input_char === '"') {
                        input_char += this.get_unformatted(input_char);
                        space = true;

                    }

                    if (input_char === '=') { //no space before =
                        space = false;
                    }

                    if (content.length && content[content.length - 1] !== '=' && input_char !== '>' && space) {
                        //no space after = or before >
                        var wrapped = this.space_or_wrap(content);
                        var indentAttrs = wrapped && input_char !== '/' && wrap_attributes !== 'force';
                        space = false;
                        if (!first_attr && wrap_attributes === 'force' &&  input_char !== '/') {
                            this.print_newline(false, content);
                            this.print_indentation(content);
                            indentAttrs = true;
                        }
                        if (indentAttrs) {
                            //indent attributes an auto or forced line-wrap
                            for (var count = 0; count < wrap_attributes_indent_size; count++) {
                                content.push(indent_character);
                            }
                        }
                        for (var i = 0; i < content.length; i++) {
                          if (content[i] === ' ') {
                            first_attr = false;
                            break;
                          }
                        }
                    }

                    if (indent_handlebars && tag_start_char === '<') {
                        // When inside an angle-bracket tag, put spaces around
                        // handlebars not inside of strings.
                        if ((input_char + this.input.charAt(this.pos)) === '{{') {
                            input_char += this.get_unformatted('}}');
                            if (content.length && content[content.length - 1] !== ' ' && content[content.length - 1] !== '<') {
                                input_char = ' ' + input_char;
                            }
                            space = true;
                        }
                    }

                    if (input_char === '<' && !tag_start_char) {
                        tag_start = this.pos - 1;
                        tag_start_char = '<';
                    }

                    if (indent_handlebars && !tag_start_char) {
                        if (content.length >= 2 && content[content.length - 1] === '{' && content[content.length - 2] === '{') {
                            if (input_char === '#' || input_char === '/' || input_char === '!') {
                                tag_start = this.pos - 3;
                            } else {
                                tag_start = this.pos - 2;
                            }
                            tag_start_char = '{';
                        }
                    }

                    this.line_char_count++;
                    content.push(input_char); //inserts character at-a-time (or string)

                    if (content[1] && (content[1] === '!' || content[1] === '?' || content[1] === '%')) { //if we're in a comment, do something special
                        // We treat all comments as literals, even more than preformatted tags
                        // we just look for the appropriate close tag
                        content = [this.get_comment(tag_start)];
                        break;
                    }

                    if (indent_handlebars && content[1] && content[1] === '{' && content[2] && content[2] === '!') { //if we're in a comment, do something special
                        // We treat all comments as literals, even more than preformatted tags
                        // we just look for the appropriate close tag
                        content = [this.get_comment(tag_start)];
                        break;
                    }

                    if (indent_handlebars && tag_start_char === '{' && content.length > 2 && content[content.length - 2] === '}' && content[content.length - 1] === '}') {
                        break;
                    }
                } while (input_char !== '>');

                var tag_complete = content.join('');
                var tag_index;
                var tag_offset;

                if (tag_complete.indexOf(' ') !== -1) { //if there's whitespace, thats where the tag name ends
                    tag_index = tag_complete.indexOf(' ');
                } else if (tag_complete.charAt(0) === '{') {
                    tag_index = tag_complete.indexOf('}');
                } else { //otherwise go with the tag ending
                    tag_index = tag_complete.indexOf('>');
                }
                if (tag_complete.charAt(0) === '<' || !indent_handlebars) {
                    tag_offset = 1;
                } else {
                    tag_offset = tag_complete.charAt(2) === '#' ? 3 : 2;
                }
                var tag_check = tag_complete.substring(tag_offset, tag_index).toLowerCase();
                if (tag_complete.charAt(tag_complete.length - 2) === '/' ||
                    this.Utils.in_array(tag_check, this.Utils.single_token)) { //if this tag name is a single tag type (either in the list or has a closing /)
                    if (!peek) {
                        this.tag_type = 'SINGLE';
                    }
                } else if (indent_handlebars && tag_complete.charAt(0) === '{' && tag_check === 'else') {
                    if (!peek) {
                        this.indent_to_tag('if');
                        this.tag_type = 'HANDLEBARS_ELSE';
                        this.indent_content = true;
                        this.traverse_whitespace();
                    }
                } else if (this.is_unformatted(tag_check, unformatted)) { // do not reformat the "unformatted" tags
                    comment = this.get_unformatted('</' + tag_check + '>', tag_complete); //...delegate to get_unformatted function
                    content.push(comment);
                    tag_end = this.pos - 1;
                    this.tag_type = 'SINGLE';
                } else if (tag_check === 'script' &&
                    (tag_complete.search('type') === -1 ||
                    (tag_complete.search('type') > -1 &&
                    tag_complete.search(/\b(text|application)\/(x-)?(javascript|ecmascript|jscript|livescript|(ld\+)?json)/) > -1))) {
                    if (!peek) {
                        this.record_tag(tag_check);
                        this.tag_type = 'SCRIPT';
                    }
                } else if (tag_check === 'style' &&
                    (tag_complete.search('type') === -1 ||
                    (tag_complete.search('type') > -1 && tag_complete.search('text/css') > -1))) {
                    if (!peek) {
                        this.record_tag(tag_check);
                        this.tag_type = 'STYLE';
                    }
                } else if (tag_check.charAt(0) === '!') { //peek for <! comment
                    // for comments content is already correct.
                    if (!peek) {
                        this.tag_type = 'SINGLE';
                        this.traverse_whitespace();
                    }
                } else if (!peek) {
                    if (tag_check.charAt(0) === '/') { //this tag is a double tag so check for tag-ending
                        this.retrieve_tag(tag_check.substring(1)); //remove it and all ancestors
                        this.tag_type = 'END';
                    } else { //otherwise it's a start-tag
                        this.record_tag(tag_check); //push it on the tag stack
                        if (tag_check.toLowerCase() !== 'html') {
                            this.indent_content = true;
                        }
                        this.tag_type = 'START';
                    }

                    // Allow preserving of newlines after a start or end tag
                    if (this.traverse_whitespace()) {
                        this.space_or_wrap(content);
                    }

                    if (this.Utils.in_array(tag_check, this.Utils.extra_liners)) { //check if this double needs an extra line
                        this.print_newline(false, this.output);
                        if (this.output.length && this.output[this.output.length - 2] !== '\n') {
                            this.print_newline(true, this.output);
                        }
                    }
                }

                if (peek) {
                    this.pos = orig_pos;
                    this.line_char_count = orig_line_char_count;
                }

                return content.join(''); //returns fully formatted tag
            };

            this.get_comment = function(start_pos) { //function to return comment content in its entirety
                // this is will have very poor perf, but will work for now.
                var comment = '',
                    delimiter = '>',
                    matched = false;

                this.pos = start_pos;
                var input_char = this.input.charAt(this.pos);
                this.pos++;

                while (this.pos <= this.input.length) {
                    comment += input_char;

                    // only need to check for the delimiter if the last chars match
                    if (comment.charAt(comment.length - 1) === delimiter.charAt(delimiter.length - 1) &&
                        comment.indexOf(delimiter) !== -1) {
                        break;
                    }

                    // only need to search for custom delimiter for the first few characters
                    if (!matched && comment.length < 10) {
                        if (comment.indexOf('<![if') === 0) { //peek for <![if conditional comment
                            delimiter = '<![endif]>';
                            matched = true;
                        } else if (comment.indexOf('<![cdata[') === 0) { //if it's a <[cdata[ comment...
                            delimiter = ']]>';
                            matched = true;
                        } else if (comment.indexOf('<![') === 0) { // some other ![ comment? ...
                            delimiter = ']>';
                            matched = true;
                        } else if (comment.indexOf('<!--') === 0) { // <!-- comment ...
                            delimiter = '-->';
                            matched = true;
                        } else if (comment.indexOf('{{!') === 0) { // {{! handlebars comment
                            delimiter = '}}';
                            matched = true;
                        } else if (comment.indexOf('<?') === 0) { // {{! handlebars comment
                            delimiter = '?>';
                            matched = true;
                        } else if (comment.indexOf('<%') === 0) { // {{! handlebars comment
                            delimiter = '%>';
                            matched = true;
                        }
                    }

                    input_char = this.input.charAt(this.pos);
                    this.pos++;
                }

                return comment;
            };

            function tokenMatcher(delimiter) {
              var token = '';

              var add = function (str) {
                var newToken = token + str.toLowerCase();
                token = newToken.length <= delimiter.length ? newToken : newToken.substr(newToken.length - delimiter.length, delimiter.length);
              };

              var doesNotMatch = function () {
                return token.indexOf(delimiter) === -1;
              };

              return {
                add: add,
                doesNotMatch: doesNotMatch
              };
            }

            this.get_unformatted = function(delimiter, orig_tag) { //function to return unformatted content in its entirety
                if (orig_tag && orig_tag.toLowerCase().indexOf(delimiter) !== -1) {
                    return '';
                }
                var input_char = '';
                var content = '';
                var space = true;

                var delimiterMatcher = tokenMatcher(delimiter);

                do {

                    if (this.pos >= this.input.length) {
                        return content;
                    }

                    input_char = this.input.charAt(this.pos);
                    this.pos++;

                    if (this.Utils.in_array(input_char, this.Utils.whitespace)) {
                        if (!space) {
                            this.line_char_count--;
                            continue;
                        }
                        if (input_char === '\n' || input_char === '\r') {
                            content += '\n';
                            /*  Don't change tab indention for unformatted blocks.  If using code for html editing, this will greatly affect <pre> tags if they are specified in the 'unformatted array'
                for (var i=0; i<this.indent_level; i++) {
                  content += this.indent_string;
                }
                space = false; //...and make sure other indentation is erased
                */
                            this.line_char_count = 0;
                            continue;
                        }
                    }
                    content += input_char;
                    delimiterMatcher.add(input_char);
                    this.line_char_count++;
                    space = true;

                    if (indent_handlebars && input_char === '{' && content.length && content.charAt(content.length - 2) === '{') {
                        // Handlebars expressions in strings should also be unformatted.
                        content += this.get_unformatted('}}');
                        // Don't consider when stopping for delimiters.
                    }
                } while (delimiterMatcher.doesNotMatch());

                return content;
            };

            this.get_token = function() { //initial handler for token-retrieval
                var token;

                if (this.last_token === 'TK_TAG_SCRIPT' || this.last_token === 'TK_TAG_STYLE') { //check if we need to format javascript
                    var type = this.last_token.substr(7);
                    token = this.get_contents_to(type);
                    if (typeof token !== 'string') {
                        return token;
                    }
                    return [token, 'TK_' + type];
                }
                if (this.current_mode === 'CONTENT') {
                    token = this.get_content();
                    if (typeof token !== 'string') {
                        return token;
                    } else {
                        return [token, 'TK_CONTENT'];
                    }
                }

                if (this.current_mode === 'TAG') {
                    token = this.get_tag();
                    if (typeof token !== 'string') {
                        return token;
                    } else {
                        var tag_name_type = 'TK_TAG_' + this.tag_type;
                        return [token, tag_name_type];
                    }
                }
            };

            this.get_full_indent = function(level) {
                level = this.indent_level + level || 0;
                if (level < 1) {
                    return '';
                }

                return Array(level + 1).join(this.indent_string);
            };

            this.is_unformatted = function(tag_check, unformatted) {
                //is this an HTML5 block-level link?
                if (!this.Utils.in_array(tag_check, unformatted)) {
                    return false;
                }

                if (tag_check.toLowerCase() !== 'a' || !this.Utils.in_array('a', unformatted)) {
                    return true;
                }

                //at this point we have an  tag; is its first child something we want to remain
                //unformatted?
                var next_tag = this.get_tag(true /* peek. */ );

                // test next_tag to see if it is just html tag (no external content)
                var tag = (next_tag || "").match(/^\s*<\s*\/?([a-z]*)\s*[^>]*>\s*$/);

                // if next_tag comes back but is not an isolated tag, then
                // let's treat the 'a' tag as having content
                // and respect the unformatted option
                if (!tag || this.Utils.in_array(tag, unformatted)) {
                    return true;
                } else {
                    return false;
                }
            };

            this.printer = function(js_source, indent_character, indent_size, wrap_line_length, brace_style) { //handles input/output and some other printing functions

                this.input = js_source || ''; //gets the input for the Parser

                // HACK: newline parsing inconsistent. This brute force normalizes the input.
                this.input = this.input.replace(/\r\n|[\r\u2028\u2029]/g, '\n')

                this.output = [];
                this.indent_character = indent_character;
                this.indent_string = '';
                this.indent_size = indent_size;
                this.brace_style = brace_style;
                this.indent_level = 0;
                this.wrap_line_length = wrap_line_length;
                this.line_char_count = 0; //count to see if wrap_line_length was exceeded

                for (var i = 0; i < this.indent_size; i++) {
                    this.indent_string += this.indent_character;
                }

                this.print_newline = function(force, arr) {
                    this.line_char_count = 0;
                    if (!arr || !arr.length) {
                        return;
                    }
                    if (force || (arr[arr.length - 1] !== '\n')) { //we might want the extra line
                        if ((arr[arr.length - 1] !== '\n')) {
                            arr[arr.length - 1] = rtrim(arr[arr.length - 1]);
                        }
                        arr.push('\n');
                    }
                };

                this.print_indentation = function(arr) {
                    for (var i = 0; i < this.indent_level; i++) {
                        arr.push(this.indent_string);
                        this.line_char_count += this.indent_string.length;
                    }
                };

                this.print_token = function(text) {
                    // Avoid printing initial whitespace.
                    if (this.is_whitespace(text) && !this.output.length) {
                        return;
                    }
                    if (text || text !== '') {
                        if (this.output.length && this.output[this.output.length - 1] === '\n') {
                            this.print_indentation(this.output);
                            text = ltrim(text);
                        }
                    }
                    this.print_token_raw(text);
                };

                this.print_token_raw = function(text) {
                    // If we are going to print newlines, truncate trailing
                    // whitespace, as the newlines will represent the space.
                    if (this.newlines > 0) {
                        text = rtrim(text);
                    }

                    if (text && text !== '') {
                        if (text.length > 1 && text.charAt(text.length - 1) === '\n') {
                            // unformatted tags can grab newlines as their last character
                            this.output.push(text.slice(0, -1));
                            this.print_newline(false, this.output);
                        } else {
                            this.output.push(text);
                        }
                    }

                    for (var n = 0; n < this.newlines; n++) {
                        this.print_newline(n > 0, this.output);
                    }
                    this.newlines = 0;
                };

                this.indent = function() {
                    this.indent_level++;
                };

                this.unindent = function() {
                    if (this.indent_level > 0) {
                        this.indent_level--;
                    }
                };
            };
            return this;
        }

        /*_____________________--------------------_____________________*/

        multi_parser = new Parser(); //wrapping functions Parser
        multi_parser.printer(html_source, indent_character, indent_size, wrap_line_length, brace_style); //initialize starting values

        while (true) {
            var t = multi_parser.get_token();
            multi_parser.token_text = t[0];
            multi_parser.token_type = t[1];

            if (multi_parser.token_type === 'TK_EOF') {
                break;
            }

            switch (multi_parser.token_type) {
                case 'TK_TAG_START':
                    multi_parser.print_newline(false, multi_parser.output);
                    multi_parser.print_token(multi_parser.token_text);
                    if (multi_parser.indent_content) {
                        multi_parser.indent();
                        multi_parser.indent_content = false;
                    }
                    multi_parser.current_mode = 'CONTENT';
                    break;
                case 'TK_TAG_STYLE':
                case 'TK_TAG_SCRIPT':
                    multi_parser.print_newline(false, multi_parser.output);
                    multi_parser.print_token(multi_parser.token_text);
                    multi_parser.current_mode = 'CONTENT';
                    break;
                case 'TK_TAG_END':
                    //Print new line only if the tag has no content and has child
                    if (multi_parser.last_token === 'TK_CONTENT' && multi_parser.last_text === '') {
                        var tag_name = multi_parser.token_text.match(/\w+/)[0];
                        var tag_extracted_from_last_output = null;
                        if (multi_parser.output.length) {
                            tag_extracted_from_last_output = multi_parser.output[multi_parser.output.length - 1].match(/(?:<|{{#)\s*(\w+)/);
                        }
                        if (tag_extracted_from_last_output === null ||
                            (tag_extracted_from_last_output[1] !== tag_name && !multi_parser.Utils.in_array(tag_extracted_from_last_output[1], unformatted))) {
                            multi_parser.print_newline(false, multi_parser.output);
                        }
                    }
                    multi_parser.print_token(multi_parser.token_text);
                    multi_parser.current_mode = 'CONTENT';
                    break;
                case 'TK_TAG_SINGLE':
                    // Don't add a newline before elements that should remain unformatted.
                    var tag_check = multi_parser.token_text.match(/^\s*<([a-z-]+)/i);
                    if (!tag_check || !multi_parser.Utils.in_array(tag_check[1], unformatted)) {
                        multi_parser.print_newline(false, multi_parser.output);
                    }
                    multi_parser.print_token(multi_parser.token_text);
                    multi_parser.current_mode = 'CONTENT';
                    break;
                case 'TK_TAG_HANDLEBARS_ELSE':
                    // Don't add a newline if opening {{#if}} tag is on the current line
                    var foundIfOnCurrentLine = false;
                    for (var lastCheckedOutput=multi_parser.output.length-1; lastCheckedOutput>=0; lastCheckedOutput--) {
		        if (multi_parser.output[lastCheckedOutput] === '\n') {
		            break;
                        } else {
                            if (multi_parser.output[lastCheckedOutput].match(/{{#if/)) {
                                foundIfOnCurrentLine = true;
                                break;
                            }
                        }
                    }
                    if (!foundIfOnCurrentLine) {
                        multi_parser.print_newline(false, multi_parser.output);
                    }
                    multi_parser.print_token(multi_parser.token_text);
                    if (multi_parser.indent_content) {
                        multi_parser.indent();
                        multi_parser.indent_content = false;
                    }
                    multi_parser.current_mode = 'CONTENT';
                    break;
                case 'TK_TAG_HANDLEBARS_COMMENT':
                    multi_parser.print_token(multi_parser.token_text);
                    multi_parser.current_mode = 'TAG';
                    break;
                case 'TK_CONTENT':
                    multi_parser.print_token(multi_parser.token_text);
                    multi_parser.current_mode = 'TAG';
                    break;
                case 'TK_STYLE':
                case 'TK_SCRIPT':
                    if (multi_parser.token_text !== '') {
                        multi_parser.print_newline(false, multi_parser.output);
                        var text = multi_parser.token_text,
                            _beautifier,
                            script_indent_level = 1;
                        if (multi_parser.token_type === 'TK_SCRIPT') {
                            _beautifier = typeof js_beautify === 'function' && js_beautify;
                        } else if (multi_parser.token_type === 'TK_STYLE') {
                            _beautifier = typeof css_beautify === 'function' && css_beautify;
                        }

                        if (options.indent_scripts === "keep") {
                            script_indent_level = 0;
                        } else if (options.indent_scripts === "separate") {
                            script_indent_level = -multi_parser.indent_level;
                        }

                        var indentation = multi_parser.get_full_indent(script_indent_level);
                        if (_beautifier) {

                            // call the Beautifier if avaliable
                            var Child_options = function() {
                                this.eol = '\n';
                            };
                            Child_options.prototype = options;
                            var child_options = new Child_options();
                            text = _beautifier(text.replace(/^\s*/, indentation), child_options);
                        } else {
                            // simply indent the string otherwise
                            var white = text.match(/^\s*/)[0];
                            var _level = white.match(/[^\n\r]*$/)[0].split(multi_parser.indent_string).length - 1;
                            var reindent = multi_parser.get_full_indent(script_indent_level - _level);
                            text = text.replace(/^\s*/, indentation)
                                .replace(/\r\n|\r|\n/g, '\n' + reindent)
                                .replace(/\s+$/, '');
                        }
                        if (text) {
                            multi_parser.print_token_raw(text);
                            multi_parser.print_newline(true, multi_parser.output);
                        }
                    }
                    multi_parser.current_mode = 'TAG';
                    break;
                default:
                    // We should not be getting here but we don't want to drop input on the floor
                    // Just output the text and move on
                    if (multi_parser.token_text !== '') {
                        multi_parser.print_token(multi_parser.token_text);
                    }
                    break;
            }
            multi_parser.last_token = multi_parser.token_type;
            multi_parser.last_text = multi_parser.token_text;
        }
        var sweet_code = multi_parser.output.join('').replace(/[\r\n\t ]+$/, '');

        // establish end_with_newline
        if (end_with_newline) {
            sweet_code += '\n';
        }

        if (eol != '\n') {
            sweet_code = sweet_code.replace(/[\n]/g, eol);
        }

        return sweet_code;
    }

    if (typeof define === "function" && define.amd) {
        // Add support for AMD ( https://github.com/amdjs/amdjs-api/wiki/AMD#defineamd-property- )
        define(["require", "./beautify", "./beautify-css"], function(requireamd) {
            var js_beautify =  requireamd("./beautify");
            var css_beautify =  requireamd("./beautify-css");

            return {
              html_beautify: function(html_source, options) {
                return style_html(html_source, options, js_beautify.js_beautify, css_beautify.css_beautify);
              }
            };
        });
    } else if (typeof exports !== "undefined") {
        // Add support for CommonJS. Just put this file somewhere on your require.paths
        // and you will be able to `var html_beautify = require("beautify").html_beautify`.
        var js_beautify = require('./beautify.js');
        var css_beautify = require('./beautify-css.js');

        exports.html_beautify = function(html_source, options) {
            return style_html(html_source, options, js_beautify.js_beautify, css_beautify.css_beautify);
        };
    } else if (typeof window !== "undefined") {
        // If we're running a web page and don't have either of the above, add our one global
        window.html_beautify = function(html_source, options) {
            return style_html(html_source, options, window.js_beautify, window.css_beautify);
        };
    } else if (typeof global !== "undefined") {
        // If we don't even have window, try global.
        global.html_beautify = function(html_source, options) {
            return style_html(html_source, options, global.js_beautify, global.css_beautify);
        };
    }

}());

}).call(this,typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {})
},{"./beautify-css.js":43,"./beautify.js":45}],45:[function(require,module,exports){
(function (global){
/*jshint curly:true, eqeqeq:true, laxbreak:true, noempty:false */
/*

  The MIT License (MIT)

  Copyright (c) 2007-2013 Einar Lielmanis and contributors.

  Permission is hereby granted, free of charge, to any person
  obtaining a copy of this software and associated documentation files
  (the "Software"), to deal in the Software without restriction,
  including without limitation the rights to use, copy, modify, merge,
  publish, distribute, sublicense, and/or sell copies of the Software,
  and to permit persons to whom the Software is furnished to do so,
  subject to the following conditions:

  The above copyright notice and this permission notice shall be
  included in all copies or substantial portions of the Software.

  THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
  EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
  MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND
  NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS
  BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN
  ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN
  CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
  SOFTWARE.

 JS Beautifier
---------------


  Written by Einar Lielmanis, <einar@jsbeautifier.org>
      http://jsbeautifier.org/

  Originally converted to javascript by Vital, <vital76@gmail.com>
  "End braces on own line" added by Chris J. Shull, <chrisjshull@gmail.com>
  Parsing improvements for brace-less statements by Liam Newman <bitwiseman@gmail.com>


  Usage:
    js_beautify(js_source_text);
    js_beautify(js_source_text, options);

  The options are:
    indent_size (default 4)          - indentation size,
    indent_char (default space)      - character to indent with,
    preserve_newlines (default true) - whether existing line breaks should be preserved,
    max_preserve_newlines (default unlimited) - maximum number of line breaks to be preserved in one chunk,

    jslint_happy (default false) - if true, then jslint-stricter mode is enforced.

            jslint_happy        !jslint_happy
            ---------------------------------
            function ()         function()

            switch () {         switch() {
            case 1:               case 1:
              break;                break;
            }                   }

    space_after_anon_function (default false) - should the space before an anonymous function's parens be added, "function()" vs "function ()",
          NOTE: This option is overriden by jslint_happy (i.e. if jslint_happy is true, space_after_anon_function is true by design)

    brace_style (default "collapse") - "collapse-preserve-inline" | "collapse" | "expand" | "end-expand" | "none"
            put braces on the same line as control statements (default), or put braces on own line (Allman / ANSI style), or just put end braces on own line, or attempt to keep them where they are.

    space_before_conditional (default true) - should the space before conditional statement be added, "if(true)" vs "if (true)",

    unescape_strings (default false) - should printable characters in strings encoded in \xNN notation be unescaped, "example" vs "\x65\x78\x61\x6d\x70\x6c\x65"

    wrap_line_length (default unlimited) - lines should wrap at next opportunity after this number of characters.
          NOTE: This is not a hard limit. Lines will continue until a point where a newline would
                be preserved if it were present.

    end_with_newline (default false)  - end output with a newline


    e.g

    js_beautify(js_source_text, {
      'indent_size': 1,
      'indent_char': '\t'
    });

*/

(function() {

    var acorn = {};
    (function (exports) {
      // This section of code is taken from acorn.
      //
      // Acorn was written by Marijn Haverbeke and released under an MIT
      // license. The Unicode regexps (for identifiers and whitespace) were
      // taken from [Esprima](http://esprima.org) by Ariya Hidayat.
      //
      // Git repositories for Acorn are available at
      //
      //     http://marijnhaverbeke.nl/git/acorn
      //     https://github.com/marijnh/acorn.git

      // ## Character categories

      // Big ugly regular expressions that match characters in the
      // whitespace, identifier, and identifier-start categories. These
      // are only applied when a character is found to actually have a
      // code point above 128.

      var nonASCIIwhitespace = /[\u1680\u180e\u2000-\u200a\u202f\u205f\u3000\ufeff]/;
      var nonASCIIidentifierStartChars = "\xaa\xb5\xba\xc0-\xd6\xd8-\xf6\xf8-\u02c1\u02c6-\u02d1\u02e0-\u02e4\u02ec\u02ee\u0370-\u0374\u0376\u0377\u037a-\u037d\u0386\u0388-\u038a\u038c\u038e-\u03a1\u03a3-\u03f5\u03f7-\u0481\u048a-\u0527\u0531-\u0556\u0559\u0561-\u0587\u05d0-\u05ea\u05f0-\u05f2\u0620-\u064a\u066e\u066f\u0671-\u06d3\u06d5\u06e5\u06e6\u06ee\u06ef\u06fa-\u06fc\u06ff\u0710\u0712-\u072f\u074d-\u07a5\u07b1\u07ca-\u07ea\u07f4\u07f5\u07fa\u0800-\u0815\u081a\u0824\u0828\u0840-\u0858\u08a0\u08a2-\u08ac\u0904-\u0939\u093d\u0950\u0958-\u0961\u0971-\u0977\u0979-\u097f\u0985-\u098c\u098f\u0990\u0993-\u09a8\u09aa-\u09b0\u09b2\u09b6-\u09b9\u09bd\u09ce\u09dc\u09dd\u09df-\u09e1\u09f0\u09f1\u0a05-\u0a0a\u0a0f\u0a10\u0a13-\u0a28\u0a2a-\u0a30\u0a32\u0a33\u0a35\u0a36\u0a38\u0a39\u0a59-\u0a5c\u0a5e\u0a72-\u0a74\u0a85-\u0a8d\u0a8f-\u0a91\u0a93-\u0aa8\u0aaa-\u0ab0\u0ab2\u0ab3\u0ab5-\u0ab9\u0abd\u0ad0\u0ae0\u0ae1\u0b05-\u0b0c\u0b0f\u0b10\u0b13-\u0b28\u0b2a-\u0b30\u0b32\u0b33\u0b35-\u0b39\u0b3d\u0b5c\u0b5d\u0b5f-\u0b61\u0b71\u0b83\u0b85-\u0b8a\u0b8e-\u0b90\u0b92-\u0b95\u0b99\u0b9a\u0b9c\u0b9e\u0b9f\u0ba3\u0ba4\u0ba8-\u0baa\u0bae-\u0bb9\u0bd0\u0c05-\u0c0c\u0c0e-\u0c10\u0c12-\u0c28\u0c2a-\u0c33\u0c35-\u0c39\u0c3d\u0c58\u0c59\u0c60\u0c61\u0c85-\u0c8c\u0c8e-\u0c90\u0c92-\u0ca8\u0caa-\u0cb3\u0cb5-\u0cb9\u0cbd\u0cde\u0ce0\u0ce1\u0cf1\u0cf2\u0d05-\u0d0c\u0d0e-\u0d10\u0d12-\u0d3a\u0d3d\u0d4e\u0d60\u0d61\u0d7a-\u0d7f\u0d85-\u0d96\u0d9a-\u0db1\u0db3-\u0dbb\u0dbd\u0dc0-\u0dc6\u0e01-\u0e30\u0e32\u0e33\u0e40-\u0e46\u0e81\u0e82\u0e84\u0e87\u0e88\u0e8a\u0e8d\u0e94-\u0e97\u0e99-\u0e9f\u0ea1-\u0ea3\u0ea5\u0ea7\u0eaa\u0eab\u0ead-\u0eb0\u0eb2\u0eb3\u0ebd\u0ec0-\u0ec4\u0ec6\u0edc-\u0edf\u0f00\u0f40-\u0f47\u0f49-\u0f6c\u0f88-\u0f8c\u1000-\u102a\u103f\u1050-\u1055\u105a-\u105d\u1061\u1065\u1066\u106e-\u1070\u1075-\u1081\u108e\u10a0-\u10c5\u10c7\u10cd\u10d0-\u10fa\u10fc-\u1248\u124a-\u124d\u1250-\u1256\u1258\u125a-\u125d\u1260-\u1288\u128a-\u128d\u1290-\u12b0\u12b2-\u12b5\u12b8-\u12be\u12c0\u12c2-\u12c5\u12c8-\u12d6\u12d8-\u1310\u1312-\u1315\u1318-\u135a\u1380-\u138f\u13a0-\u13f4\u1401-\u166c\u166f-\u167f\u1681-\u169a\u16a0-\u16ea\u16ee-\u16f0\u1700-\u170c\u170e-\u1711\u1720-\u1731\u1740-\u1751\u1760-\u176c\u176e-\u1770\u1780-\u17b3\u17d7\u17dc\u1820-\u1877\u1880-\u18a8\u18aa\u18b0-\u18f5\u1900-\u191c\u1950-\u196d\u1970-\u1974\u1980-\u19ab\u19c1-\u19c7\u1a00-\u1a16\u1a20-\u1a54\u1aa7\u1b05-\u1b33\u1b45-\u1b4b\u1b83-\u1ba0\u1bae\u1baf\u1bba-\u1be5\u1c00-\u1c23\u1c4d-\u1c4f\u1c5a-\u1c7d\u1ce9-\u1cec\u1cee-\u1cf1\u1cf5\u1cf6\u1d00-\u1dbf\u1e00-\u1f15\u1f18-\u1f1d\u1f20-\u1f45\u1f48-\u1f4d\u1f50-\u1f57\u1f59\u1f5b\u1f5d\u1f5f-\u1f7d\u1f80-\u1fb4\u1fb6-\u1fbc\u1fbe\u1fc2-\u1fc4\u1fc6-\u1fcc\u1fd0-\u1fd3\u1fd6-\u1fdb\u1fe0-\u1fec\u1ff2-\u1ff4\u1ff6-\u1ffc\u2071\u207f\u2090-\u209c\u2102\u2107\u210a-\u2113\u2115\u2119-\u211d\u2124\u2126\u2128\u212a-\u212d\u212f-\u2139\u213c-\u213f\u2145-\u2149\u214e\u2160-\u2188\u2c00-\u2c2e\u2c30-\u2c5e\u2c60-\u2ce4\u2ceb-\u2cee\u2cf2\u2cf3\u2d00-\u2d25\u2d27\u2d2d\u2d30-\u2d67\u2d6f\u2d80-\u2d96\u2da0-\u2da6\u2da8-\u2dae\u2db0-\u2db6\u2db8-\u2dbe\u2dc0-\u2dc6\u2dc8-\u2dce\u2dd0-\u2dd6\u2dd8-\u2dde\u2e2f\u3005-\u3007\u3021-\u3029\u3031-\u3035\u3038-\u303c\u3041-\u3096\u309d-\u309f\u30a1-\u30fa\u30fc-\u30ff\u3105-\u312d\u3131-\u318e\u31a0-\u31ba\u31f0-\u31ff\u3400-\u4db5\u4e00-\u9fcc\ua000-\ua48c\ua4d0-\ua4fd\ua500-\ua60c\ua610-\ua61f\ua62a\ua62b\ua640-\ua66e\ua67f-\ua697\ua6a0-\ua6ef\ua717-\ua71f\ua722-\ua788\ua78b-\ua78e\ua790-\ua793\ua7a0-\ua7aa\ua7f8-\ua801\ua803-\ua805\ua807-\ua80a\ua80c-\ua822\ua840-\ua873\ua882-\ua8b3\ua8f2-\ua8f7\ua8fb\ua90a-\ua925\ua930-\ua946\ua960-\ua97c\ua984-\ua9b2\ua9cf\uaa00-\uaa28\uaa40-\uaa42\uaa44-\uaa4b\uaa60-\uaa76\uaa7a\uaa80-\uaaaf\uaab1\uaab5\uaab6\uaab9-\uaabd\uaac0\uaac2\uaadb-\uaadd\uaae0-\uaaea\uaaf2-\uaaf4\uab01-\uab06\uab09-\uab0e\uab11-\uab16\uab20-\uab26\uab28-\uab2e\uabc0-\uabe2\uac00-\ud7a3\ud7b0-\ud7c6\ud7cb-\ud7fb\uf900-\ufa6d\ufa70-\ufad9\ufb00-\ufb06\ufb13-\ufb17\ufb1d\ufb1f-\ufb28\ufb2a-\ufb36\ufb38-\ufb3c\ufb3e\ufb40\ufb41\ufb43\ufb44\ufb46-\ufbb1\ufbd3-\ufd3d\ufd50-\ufd8f\ufd92-\ufdc7\ufdf0-\ufdfb\ufe70-\ufe74\ufe76-\ufefc\uff21-\uff3a\uff41-\uff5a\uff66-\uffbe\uffc2-\uffc7\uffca-\uffcf\uffd2-\uffd7\uffda-\uffdc";
      var nonASCIIidentifierChars = "\u0300-\u036f\u0483-\u0487\u0591-\u05bd\u05bf\u05c1\u05c2\u05c4\u05c5\u05c7\u0610-\u061a\u0620-\u0649\u0672-\u06d3\u06e7-\u06e8\u06fb-\u06fc\u0730-\u074a\u0800-\u0814\u081b-\u0823\u0825-\u0827\u0829-\u082d\u0840-\u0857\u08e4-\u08fe\u0900-\u0903\u093a-\u093c\u093e-\u094f\u0951-\u0957\u0962-\u0963\u0966-\u096f\u0981-\u0983\u09bc\u09be-\u09c4\u09c7\u09c8\u09d7\u09df-\u09e0\u0a01-\u0a03\u0a3c\u0a3e-\u0a42\u0a47\u0a48\u0a4b-\u0a4d\u0a51\u0a66-\u0a71\u0a75\u0a81-\u0a83\u0abc\u0abe-\u0ac5\u0ac7-\u0ac9\u0acb-\u0acd\u0ae2-\u0ae3\u0ae6-\u0aef\u0b01-\u0b03\u0b3c\u0b3e-\u0b44\u0b47\u0b48\u0b4b-\u0b4d\u0b56\u0b57\u0b5f-\u0b60\u0b66-\u0b6f\u0b82\u0bbe-\u0bc2\u0bc6-\u0bc8\u0bca-\u0bcd\u0bd7\u0be6-\u0bef\u0c01-\u0c03\u0c46-\u0c48\u0c4a-\u0c4d\u0c55\u0c56\u0c62-\u0c63\u0c66-\u0c6f\u0c82\u0c83\u0cbc\u0cbe-\u0cc4\u0cc6-\u0cc8\u0cca-\u0ccd\u0cd5\u0cd6\u0ce2-\u0ce3\u0ce6-\u0cef\u0d02\u0d03\u0d46-\u0d48\u0d57\u0d62-\u0d63\u0d66-\u0d6f\u0d82\u0d83\u0dca\u0dcf-\u0dd4\u0dd6\u0dd8-\u0ddf\u0df2\u0df3\u0e34-\u0e3a\u0e40-\u0e45\u0e50-\u0e59\u0eb4-\u0eb9\u0ec8-\u0ecd\u0ed0-\u0ed9\u0f18\u0f19\u0f20-\u0f29\u0f35\u0f37\u0f39\u0f41-\u0f47\u0f71-\u0f84\u0f86-\u0f87\u0f8d-\u0f97\u0f99-\u0fbc\u0fc6\u1000-\u1029\u1040-\u1049\u1067-\u106d\u1071-\u1074\u1082-\u108d\u108f-\u109d\u135d-\u135f\u170e-\u1710\u1720-\u1730\u1740-\u1750\u1772\u1773\u1780-\u17b2\u17dd\u17e0-\u17e9\u180b-\u180d\u1810-\u1819\u1920-\u192b\u1930-\u193b\u1951-\u196d\u19b0-\u19c0\u19c8-\u19c9\u19d0-\u19d9\u1a00-\u1a15\u1a20-\u1a53\u1a60-\u1a7c\u1a7f-\u1a89\u1a90-\u1a99\u1b46-\u1b4b\u1b50-\u1b59\u1b6b-\u1b73\u1bb0-\u1bb9\u1be6-\u1bf3\u1c00-\u1c22\u1c40-\u1c49\u1c5b-\u1c7d\u1cd0-\u1cd2\u1d00-\u1dbe\u1e01-\u1f15\u200c\u200d\u203f\u2040\u2054\u20d0-\u20dc\u20e1\u20e5-\u20f0\u2d81-\u2d96\u2de0-\u2dff\u3021-\u3028\u3099\u309a\ua640-\ua66d\ua674-\ua67d\ua69f\ua6f0-\ua6f1\ua7f8-\ua800\ua806\ua80b\ua823-\ua827\ua880-\ua881\ua8b4-\ua8c4\ua8d0-\ua8d9\ua8f3-\ua8f7\ua900-\ua909\ua926-\ua92d\ua930-\ua945\ua980-\ua983\ua9b3-\ua9c0\uaa00-\uaa27\uaa40-\uaa41\uaa4c-\uaa4d\uaa50-\uaa59\uaa7b\uaae0-\uaae9\uaaf2-\uaaf3\uabc0-\uabe1\uabec\uabed\uabf0-\uabf9\ufb20-\ufb28\ufe00-\ufe0f\ufe20-\ufe26\ufe33\ufe34\ufe4d-\ufe4f\uff10-\uff19\uff3f";
      var nonASCIIidentifierStart = new RegExp("[" + nonASCIIidentifierStartChars + "]");
      var nonASCIIidentifier = new RegExp("[" + nonASCIIidentifierStartChars + nonASCIIidentifierChars + "]");

      // Whether a single character denotes a newline.

      var newline = exports.newline = /[\n\r\u2028\u2029]/;

      // Matches a whole line break (where CRLF is considered a single
      // line break). Used to count lines.

      // in javascript, these two differ
      // in python they are the same, different methods are called on them
      var lineBreak = exports.lineBreak = /\r\n|[\n\r\u2028\u2029]/;
      var allLineBreaks = exports.allLineBreaks = new RegExp(lineBreak.source, 'g');


      // Test whether a given character code starts an identifier.

      var isIdentifierStart = exports.isIdentifierStart = function(code) {
        // permit $ (36) and @ (64). @ is used in ES7 decorators.
        if (code < 65) return code === 36 || code === 64;
        // 65 through 91 are uppercase letters.
        if (code < 91) return true;
        // permit _ (95).
        if (code < 97) return code === 95;
        // 97 through 123 are lowercase letters.
        if (code < 123)return true;
        return code >= 0xaa && nonASCIIidentifierStart.test(String.fromCharCode(code));
      };

      // Test whether a given character is part of an identifier.

      var isIdentifierChar = exports.isIdentifierChar = function(code) {
        if (code < 48) return code === 36;
        if (code < 58) return true;
        if (code < 65) return false;
        if (code < 91) return true;
        if (code < 97) return code === 95;
        if (code < 123)return true;
        return code >= 0xaa && nonASCIIidentifier.test(String.fromCharCode(code));
      };
    })(acorn);

    function in_array(what, arr) {
        for (var i = 0; i < arr.length; i += 1) {
            if (arr[i] === what) {
                return true;
            }
        }
        return false;
    }

    function trim(s) {
        return s.replace(/^\s+|\s+$/g, '');
    }

    function ltrim(s) {
        return s.replace(/^\s+/g, '');
    }

    function rtrim(s) {
        return s.replace(/\s+$/g, '');
    }

    function js_beautify(js_source_text, options) {
        "use strict";
        var beautifier = new Beautifier(js_source_text, options);
        return beautifier.beautify();
    }

    var MODE = {
            BlockStatement: 'BlockStatement', // 'BLOCK'
            Statement: 'Statement', // 'STATEMENT'
            ObjectLiteral: 'ObjectLiteral', // 'OBJECT',
            ArrayLiteral: 'ArrayLiteral', //'[EXPRESSION]',
            ForInitializer: 'ForInitializer', //'(FOR-EXPRESSION)',
            Conditional: 'Conditional', //'(COND-EXPRESSION)',
            Expression: 'Expression' //'(EXPRESSION)'
        };

    function Beautifier(js_source_text, options) {
        "use strict";
        var output
        var tokens = [], token_pos;
        var Tokenizer;
        var current_token;
        var last_type, last_last_text, indent_string;
        var flags, previous_flags, flag_store;
        var prefix;

        var handlers, opt;
        var baseIndentString = '';

        handlers = {
            'TK_START_EXPR': handle_start_expr,
            'TK_END_EXPR': handle_end_expr,
            'TK_START_BLOCK': handle_start_block,
            'TK_END_BLOCK': handle_end_block,
            'TK_WORD': handle_word,
            'TK_RESERVED': handle_word,
            'TK_SEMICOLON': handle_semicolon,
            'TK_STRING': handle_string,
            'TK_EQUALS': handle_equals,
            'TK_OPERATOR': handle_operator,
            'TK_COMMA': handle_comma,
            'TK_BLOCK_COMMENT': handle_block_comment,
            'TK_COMMENT': handle_comment,
            'TK_DOT': handle_dot,
            'TK_UNKNOWN': handle_unknown,
            'TK_EOF': handle_eof
        };

        function create_flags(flags_base, mode) {
            var next_indent_level = 0;
            if (flags_base) {
                next_indent_level = flags_base.indentation_level;
                if (!output.just_added_newline() &&
                    flags_base.line_indent_level > next_indent_level) {
                    next_indent_level = flags_base.line_indent_level;
                }
            }

            var next_flags = {
                mode: mode,
                parent: flags_base,
                last_text: flags_base ? flags_base.last_text : '', // last token text
                last_word: flags_base ? flags_base.last_word : '', // last 'TK_WORD' passed
                declaration_statement: false,
                declaration_assignment: false,
                multiline_frame: false,
                inline_frame: false,
                if_block: false,
                else_block: false,
                do_block: false,
                do_while: false,
                import_block: false,
                in_case_statement: false, // switch(..){ INSIDE HERE }
                in_case: false, // we're on the exact line with "case 0:"
                case_body: false, // the indented case-action block
                indentation_level: next_indent_level,
                line_indent_level: flags_base ? flags_base.line_indent_level : next_indent_level,
                start_line_index: output.get_line_number(),
                ternary_depth: 0
            };
            return next_flags;
        }

        // Some interpreters have unexpected results with foo = baz || bar;
        options = options ? options : {};
        opt = {};

        // compatibility
        if (options.braces_on_own_line !== undefined) { //graceful handling of deprecated option
            opt.brace_style = options.braces_on_own_line ? "expand" : "collapse";
        }
        opt.brace_style = options.brace_style ? options.brace_style : (opt.brace_style ? opt.brace_style : "collapse");

        // graceful handling of deprecated option
        if (opt.brace_style === "expand-strict") {
            opt.brace_style = "expand";
        }

        opt.indent_size = options.indent_size ? parseInt(options.indent_size, 10) : 4;
        opt.indent_char = options.indent_char ? options.indent_char : ' ';
        opt.eol = options.eol ? options.eol : 'auto';
        opt.preserve_newlines = (options.preserve_newlines === undefined) ? true : options.preserve_newlines;
        opt.break_chained_methods = (options.break_chained_methods === undefined) ? false : options.break_chained_methods;
        opt.max_preserve_newlines = (options.max_preserve_newlines === undefined) ? 0 : parseInt(options.max_preserve_newlines, 10);
        opt.space_in_paren = (options.space_in_paren === undefined) ? false : options.space_in_paren;
        opt.space_in_empty_paren = (options.space_in_empty_paren === undefined) ? false : options.space_in_empty_paren;
        opt.jslint_happy = (options.jslint_happy === undefined) ? false : options.jslint_happy;
        opt.space_after_anon_function = (options.space_after_anon_function === undefined) ? false : options.space_after_anon_function;
        opt.keep_array_indentation = (options.keep_array_indentation === undefined) ? false : options.keep_array_indentation;
        opt.space_before_conditional = (options.space_before_conditional === undefined) ? true : options.space_before_conditional;
        opt.unescape_strings = (options.unescape_strings === undefined) ? false : options.unescape_strings;
        opt.wrap_line_length = (options.wrap_line_length === undefined) ? 0 : parseInt(options.wrap_line_length, 10);
        opt.e4x = (options.e4x === undefined) ? false : options.e4x;
        opt.end_with_newline = (options.end_with_newline === undefined) ? false : options.end_with_newline;
        opt.comma_first = (options.comma_first === undefined) ? false : options.comma_first;

        // For testing of beautify ignore:start directive
        opt.test_output_raw = (options.test_output_raw === undefined) ? false : options.test_output_raw;

        // force opt.space_after_anon_function to true if opt.jslint_happy
        if(opt.jslint_happy) {
            opt.space_after_anon_function = true;
        }

        if(options.indent_with_tabs){
            opt.indent_char = '\t';
            opt.indent_size = 1;
        }

        if (opt.eol === 'auto') {
            opt.eol = '\n';
            if (js_source_text && acorn.lineBreak.test(js_source_text || '')) {
                opt.eol = js_source_text.match(acorn.lineBreak)[0];
            }
        }

        opt.eol = opt.eol.replace(/\\r/, '\r').replace(/\\n/, '\n')

        //----------------------------------
        indent_string = '';
        while (opt.indent_size > 0) {
            indent_string += opt.indent_char;
            opt.indent_size -= 1;
        }

        var preindent_index = 0;
        if(js_source_text && js_source_text.length) {
            while ( (js_source_text.charAt(preindent_index) === ' ' ||
                    js_source_text.charAt(preindent_index) === '\t')) {
                baseIndentString += js_source_text.charAt(preindent_index);
                preindent_index += 1;
            }
            js_source_text = js_source_text.substring(preindent_index);
        }

        last_type = 'TK_START_BLOCK'; // last token type
        last_last_text = ''; // pre-last token text
        output = new Output(indent_string, baseIndentString);

        // If testing the ignore directive, start with output disable set to true
        output.raw = opt.test_output_raw;


        // Stack of parsing/formatting states, including MODE.
        // We tokenize, parse, and output in an almost purely a forward-only stream of token input
        // and formatted output.  This makes the beautifier less accurate than full parsers
        // but also far more tolerant of syntax errors.
        //
        // For example, the default mode is MODE.BlockStatement. If we see a '{' we push a new frame of type
        // MODE.BlockStatement on the the stack, even though it could be object literal.  If we later
        // encounter a ":", we'll switch to to MODE.ObjectLiteral.  If we then see a ";",
        // most full parsers would die, but the beautifier gracefully falls back to
        // MODE.BlockStatement and continues on.
        flag_store = [];
        set_mode(MODE.BlockStatement);

        this.beautify = function() {

            /*jshint onevar:true */
            var local_token, sweet_code;
            Tokenizer = new tokenizer(js_source_text, opt, indent_string);
            tokens = Tokenizer.tokenize();
            token_pos = 0;

            while (local_token = get_token()) {
                for(var i = 0; i < local_token.comments_before.length; i++) {
                    // The cleanest handling of inline comments is to treat them as though they aren't there.
                    // Just continue formatting and the behavior should be logical.
                    // Also ignore unknown tokens.  Again, this should result in better behavior.
                    handle_token(local_token.comments_before[i]);
                }
                handle_token(local_token);

                last_last_text = flags.last_text;
                last_type = local_token.type;
                flags.last_text = local_token.text;

                token_pos += 1;
            }

            sweet_code = output.get_code();
            if (opt.end_with_newline) {
                sweet_code += '\n';
            }

            if (opt.eol != '\n') {
                sweet_code = sweet_code.replace(/[\n]/g, opt.eol);
            }

            return sweet_code;
        };

        function handle_token(local_token) {
            var newlines = local_token.newlines;
            var keep_whitespace = opt.keep_array_indentation && is_array(flags.mode);

            if (keep_whitespace) {
                for (i = 0; i < newlines; i += 1) {
                    print_newline(i > 0);
                }
            } else {
                if (opt.max_preserve_newlines && newlines > opt.max_preserve_newlines) {
                    newlines = opt.max_preserve_newlines;
                }

                if (opt.preserve_newlines) {
                    if (local_token.newlines > 1) {
                        print_newline();
                        for (var i = 1; i < newlines; i += 1) {
                            print_newline(true);
                        }
                    }
                }
            }

            current_token = local_token;
            handlers[current_token.type]();
        }

        // we could use just string.split, but
        // IE doesn't like returning empty strings
        function split_linebreaks(s) {
            //return s.split(/\x0d\x0a|\x0a/);

            s = s.replace(acorn.allLineBreaks, '\n');
            var out = [],
                idx = s.indexOf("\n");
            while (idx !== -1) {
                out.push(s.substring(0, idx));
                s = s.substring(idx + 1);
                idx = s.indexOf("\n");
            }
            if (s.length) {
                out.push(s);
            }
            return out;
        }

        var newline_restricted_tokens = ['break','contiue','return', 'throw'];
        function allow_wrap_or_preserved_newline(force_linewrap) {
            force_linewrap = (force_linewrap === undefined) ? false : force_linewrap;

            // Never wrap the first token on a line
            if (output.just_added_newline()) {
                return
            }

            if ((opt.preserve_newlines && current_token.wanted_newline) || force_linewrap) {
                print_newline(false, true);
            } else if (opt.wrap_line_length) {
                if (last_type === 'TK_RESERVED' && in_array(flags.last_text, newline_restricted_tokens)) {
                    // These tokens should never have a newline inserted
                    // between them and the following expression.
                    return
                }
                var proposed_line_length = output.current_line.get_character_count() + current_token.text.length +
                    (output.space_before_token ? 1 : 0);
                if (proposed_line_length >= opt.wrap_line_length) {
                    print_newline(false, true);
                }
            }
        }

        function print_newline(force_newline, preserve_statement_flags) {
            if (!preserve_statement_flags) {
                if (flags.last_text !== ';' && flags.last_text !== ',' && flags.last_text !== '=' && last_type !== 'TK_OPERATOR') {
                    while (flags.mode === MODE.Statement && !flags.if_block && !flags.do_block) {
                        restore_mode();
                    }
                }
            }

            if (output.add_new_line(force_newline)) {
                flags.multiline_frame = true;
            }
        }

        function print_token_line_indentation() {
            if (output.just_added_newline()) {
                if (opt.keep_array_indentation && is_array(flags.mode) && current_token.wanted_newline) {
                    output.current_line.push(current_token.whitespace_before);
                    output.space_before_token = false;
                } else if (output.set_indent(flags.indentation_level)) {
                    flags.line_indent_level = flags.indentation_level;
                }
            }
        }

        function print_token(printable_token) {
            if (output.raw) {
                output.add_raw_token(current_token)
                return;
            }

            if (opt.comma_first && last_type === 'TK_COMMA'
                && output.just_added_newline()) {
                if(output.previous_line.last() === ',') {
                    var popped = output.previous_line.pop();
                    // if the comma was already at the start of the line,
                    // pull back onto that line and reprint the indentation
                    if(output.previous_line.is_empty()) {
                         output.previous_line.push(popped);
                         output.trim(true);
                         output.current_line.pop();
                         output.trim();
                    }

                    // add the comma in front of the next token
                    print_token_line_indentation();
                    output.add_token(',');
                    output.space_before_token = true;
                }
            }

            printable_token = printable_token || current_token.text;
            print_token_line_indentation();
            output.add_token(printable_token);
        }

        function indent() {
            flags.indentation_level += 1;
        }

        function deindent() {
            if (flags.indentation_level > 0 &&
                ((!flags.parent) || flags.indentation_level > flags.parent.indentation_level))
                flags.indentation_level -= 1;
        }

        function set_mode(mode) {
            if (flags) {
                flag_store.push(flags);
                previous_flags = flags;
            } else {
                previous_flags = create_flags(null, mode);
            }

            flags = create_flags(previous_flags, mode);
        }

        function is_array(mode) {
            return mode === MODE.ArrayLiteral;
        }

        function is_expression(mode) {
            return in_array(mode, [MODE.Expression, MODE.ForInitializer, MODE.Conditional]);
        }

        function restore_mode() {
            if (flag_store.length > 0) {
                previous_flags = flags;
                flags = flag_store.pop();
                if (previous_flags.mode === MODE.Statement) {
                    output.remove_redundant_indentation(previous_flags);
                }
            }
        }

        function start_of_object_property() {
            return flags.parent.mode === MODE.ObjectLiteral && flags.mode === MODE.Statement && (
                (flags.last_text === ':' && flags.ternary_depth === 0) || (last_type === 'TK_RESERVED' && in_array(flags.last_text, ['get', 'set'])));
        }

        function start_of_statement() {
            if (
                    (last_type === 'TK_RESERVED' && in_array(flags.last_text, ['var', 'let', 'const']) && current_token.type === 'TK_WORD') ||
                    (last_type === 'TK_RESERVED' && flags.last_text === 'do') ||
                    (last_type === 'TK_RESERVED' && in_array(flags.last_text, ['return', 'throw']) && !current_token.wanted_newline) ||
                    (last_type === 'TK_RESERVED' && flags.last_text === 'else' && !(current_token.type === 'TK_RESERVED' && current_token.text === 'if')) ||
                    (last_type === 'TK_END_EXPR' && (previous_flags.mode === MODE.ForInitializer || previous_flags.mode === MODE.Conditional)) ||
                    (last_type === 'TK_WORD' && flags.mode === MODE.BlockStatement
                        && !flags.in_case
                        && !(current_token.text === '--' || current_token.text === '++')
                        && last_last_text !== 'function'
                        && current_token.type !== 'TK_WORD' && current_token.type !== 'TK_RESERVED') ||
                    (flags.mode === MODE.ObjectLiteral && (
                        (flags.last_text === ':' && flags.ternary_depth === 0) || (last_type === 'TK_RESERVED' && in_array(flags.last_text, ['get', 'set']))))
                ) {

                set_mode(MODE.Statement);
                indent();

                if (last_type === 'TK_RESERVED' && in_array(flags.last_text, ['var', 'let', 'const']) && current_token.type === 'TK_WORD') {
                    flags.declaration_statement = true;
                }

                // Issue #276:
                // If starting a new statement with [if, for, while, do], push to a new line.
                // if (a) if (b) if(c) d(); else e(); else f();
                if (!start_of_object_property()) {
                    allow_wrap_or_preserved_newline(
                        current_token.type === 'TK_RESERVED' && in_array(current_token.text, ['do', 'for', 'if', 'while']));
                }

                return true;
            }
            return false;
        }

        function all_lines_start_with(lines, c) {
            for (var i = 0; i < lines.length; i++) {
                var line = trim(lines[i]);
                if (line.charAt(0) !== c) {
                    return false;
                }
            }
            return true;
        }

        function each_line_matches_indent(lines, indent) {
            var i = 0,
                len = lines.length,
                line;
            for (; i < len; i++) {
                line = lines[i];
                // allow empty lines to pass through
                if (line && line.indexOf(indent) !== 0) {
                    return false;
                }
            }
            return true;
        }

        function is_special_word(word) {
            return in_array(word, ['case', 'return', 'do', 'if', 'throw', 'else']);
        }

        function get_token(offset) {
            var index = token_pos + (offset || 0);
            return (index < 0 || index >= tokens.length) ? null : tokens[index];
        }

        function handle_start_expr() {
            if (start_of_statement()) {
                // The conditional starts the statement if appropriate.
            }

            var next_mode = MODE.Expression;
            if (current_token.text === '[') {

                if (last_type === 'TK_WORD' || flags.last_text === ')') {
                    // this is array index specifier, break immediately
                    // a[x], fn()[x]
                    if (last_type === 'TK_RESERVED' && in_array(flags.last_text, Tokenizer.line_starters)) {
                        output.space_before_token = true;
                    }
                    set_mode(next_mode);
                    print_token();
                    indent();
                    if (opt.space_in_paren) {
                        output.space_before_token = true;
                    }
                    return;
                }

                next_mode = MODE.ArrayLiteral;
                if (is_array(flags.mode)) {
                    if (flags.last_text === '[' ||
                        (flags.last_text === ',' && (last_last_text === ']' || last_last_text === '}'))) {
                        // ], [ goes to new line
                        // }, [ goes to new line
                        if (!opt.keep_array_indentation) {
                            print_newline();
                        }
                    }
                }

            } else {
                if (last_type === 'TK_RESERVED' && flags.last_text === 'for') {
                    next_mode = MODE.ForInitializer;
                } else if (last_type === 'TK_RESERVED' && in_array(flags.last_text, ['if', 'while'])) {
                    next_mode = MODE.Conditional;
                } else {
                    // next_mode = MODE.Expression;
                }
            }

            if (flags.last_text === ';' || last_type === 'TK_START_BLOCK') {
                print_newline();
            } else if (last_type === 'TK_END_EXPR' || last_type === 'TK_START_EXPR' || last_type === 'TK_END_BLOCK' || flags.last_text === '.') {
                // TODO: Consider whether forcing this is required.  Review failing tests when removed.
                allow_wrap_or_preserved_newline(current_token.wanted_newline);
                // do nothing on (( and )( and ][ and ]( and .(
            } else if (!(last_type === 'TK_RESERVED' && current_token.text === '(') && last_type !== 'TK_WORD' && last_type !== 'TK_OPERATOR') {
                output.space_before_token = true;
            } else if ((last_type === 'TK_RESERVED' && (flags.last_word === 'function' || flags.last_word === 'typeof')) ||
                (flags.last_text === '*' && last_last_text === 'function')) {
                // function() vs function ()
                if (opt.space_after_anon_function) {
                    output.space_before_token = true;
                }
            } else if (last_type === 'TK_RESERVED' && (in_array(flags.last_text, Tokenizer.line_starters) || flags.last_text === 'catch')) {
                if (opt.space_before_conditional) {
                    output.space_before_token = true;
                }
            }

            // Should be a space between await and an IIFE
            if(current_token.text === '(' && last_type === 'TK_RESERVED' && flags.last_word === 'await'){
                output.space_before_token = true;
            }

            // Support of this kind of newline preservation.
            // a = (b &&
            //     (c || d));
            if (current_token.text === '(') {
                if (last_type === 'TK_EQUALS' || last_type === 'TK_OPERATOR') {
                    if (!start_of_object_property()) {
                        allow_wrap_or_preserved_newline();
                    }
                }
            }

            // Support preserving wrapped arrow function expressions
            // a.b('c',
            //     () => d.e
            // )
            if (current_token.text === '(' && last_type !== 'TK_WORD' && last_type !== 'TK_RESERVED') {
                allow_wrap_or_preserved_newline();
            }

            set_mode(next_mode);
            print_token();
            if (opt.space_in_paren) {
                output.space_before_token = true;
            }

            // In all cases, if we newline while inside an expression it should be indented.
            indent();
        }

        function handle_end_expr() {
            // statements inside expressions are not valid syntax, but...
            // statements must all be closed when their container closes
            while (flags.mode === MODE.Statement) {
                restore_mode();
            }

            if (flags.multiline_frame) {
                allow_wrap_or_preserved_newline(current_token.text === ']' && is_array(flags.mode) && !opt.keep_array_indentation);
            }

            if (opt.space_in_paren) {
                if (last_type === 'TK_START_EXPR' && ! opt.space_in_empty_paren) {
                    // () [] no inner space in empty parens like these, ever, ref #320
                    output.trim();
                    output.space_before_token = false;
                } else {
                    output.space_before_token = true;
                }
            }
            if (current_token.text === ']' && opt.keep_array_indentation) {
                print_token();
                restore_mode();
            } else {
                restore_mode();
                print_token();
            }
            output.remove_redundant_indentation(previous_flags);

            // do {} while () // no statement required after
            if (flags.do_while && previous_flags.mode === MODE.Conditional) {
                previous_flags.mode = MODE.Expression;
                flags.do_block = false;
                flags.do_while = false;

            }
        }

        function handle_start_block() {
            // Check if this is should be treated as a ObjectLiteral
            var next_token = get_token(1)
            var second_token = get_token(2)
            if (second_token && (
                    (in_array(second_token.text, [':', ',']) && in_array(next_token.type, ['TK_STRING', 'TK_WORD', 'TK_RESERVED']))
                    || (in_array(next_token.text, ['get', 'set']) && in_array(second_token.type, ['TK_WORD', 'TK_RESERVED']))
                )) {
                // We don't support TypeScript,but we didn't break it for a very long time.
                // We'll try to keep not breaking it.
                if (!in_array(last_last_text, ['class','interface'])) {
                    set_mode(MODE.ObjectLiteral);
                } else {
                    set_mode(MODE.BlockStatement);
                }
            } else if (last_type === 'TK_OPERATOR' && flags.last_text === '=>') {
                // arrow function: (param1, paramN) => { statements }
                set_mode(MODE.BlockStatement);
            } else if (in_array(last_type, ['TK_EQUALS', 'TK_START_EXPR', 'TK_COMMA', 'TK_OPERATOR']) ||
                (last_type === 'TK_RESERVED' && in_array(flags.last_text, ['return', 'throw', 'import']))
                ) {
                // Detecting shorthand function syntax is difficult by scanning forward,
                //     so check the surrounding context.
                // If the block is being returned, imported, passed as arg,
                //     assigned with = or assigned in a nested object, treat as an ObjectLiteral.
                set_mode(MODE.ObjectLiteral);
            } else {
                set_mode(MODE.BlockStatement);
            }

            var empty_braces = !next_token.comments_before.length &&  next_token.text === '}';
            var empty_anonymous_function = empty_braces && flags.last_word === 'function' &&
                last_type === 'TK_END_EXPR';


            if (opt.brace_style === "expand" ||
                (opt.brace_style === "none" && current_token.wanted_newline)) {
                if (last_type !== 'TK_OPERATOR' &&
                    (empty_anonymous_function ||
                        last_type === 'TK_EQUALS' ||
                        (last_type === 'TK_RESERVED' && is_special_word(flags.last_text) && flags.last_text !== 'else'))) {
                    output.space_before_token = true;
                } else {
                    print_newline(false, true);
                }
            } else { // collapse
                if (opt.brace_style === 'collapse-preserve-inline') {
                    // search forward for a newline wanted inside this block
                    var index = 0;
                    var check_token = null;
                    flags.inline_frame = true;
                    do {
                        index += 1;
                        check_token = get_token(index);
                        if (check_token.wanted_newline) {
                            flags.inline_frame = false;
                            break;
                        }
                    } while (check_token.type !== 'TK_EOF' &&
                          !(check_token.type === 'TK_END_BLOCK' && check_token.opened === current_token))
                }

                if (is_array(previous_flags.mode) && (last_type === 'TK_START_EXPR' || last_type === 'TK_COMMA')) {
                    // if we're preserving inline,
                    // allow newline between comma and next brace.
                    if (flags.inline_frame) {
                        allow_wrap_or_preserved_newline();
                        flags.inline_frame = true;
                        previous_flags.multiline_frame = previous_flags.multiline_frame || flags.multiline_frame;
                        flags.multiline_frame = false;
                    } else if (last_type === 'TK_COMMA') {
                        output.space_before_token = true;
                    }
                } else if (last_type !== 'TK_OPERATOR' && last_type !== 'TK_START_EXPR') {
                    if (last_type === 'TK_START_BLOCK') {
                        print_newline();
                    } else {
                        output.space_before_token = true;
                    }
                }
            }
            print_token();
            indent();
        }

        function handle_end_block() {
            // statements must all be closed when their container closes
            while (flags.mode === MODE.Statement) {
                restore_mode();
            }
            var empty_braces = last_type === 'TK_START_BLOCK';

            if (opt.brace_style === "expand") {
                if (!empty_braces) {
                    print_newline();
                }
            } else {
                // skip {}
                if (!empty_braces) {
                    if (flags.inline_frame) {
                        output.space_before_token = true;
                    } else if (is_array(flags.mode) && opt.keep_array_indentation) {
                        // we REALLY need a newline here, but newliner would skip that
                        opt.keep_array_indentation = false;
                        print_newline();
                        opt.keep_array_indentation = true;

                    } else {
                        print_newline();
                    }
                }
            }
            restore_mode();
            print_token();
        }

        function handle_word() {
            if (current_token.type === 'TK_RESERVED') {
                if (in_array(current_token.text, ['set', 'get']) && flags.mode !== MODE.ObjectLiteral) {
                    current_token.type = 'TK_WORD';
                } else if (in_array(current_token.text, ['as', 'from']) && !flags.import_block) {
                    current_token.type = 'TK_WORD';
                } else if (flags.mode === MODE.ObjectLiteral) {
                    var next_token = get_token(1);
                    if (next_token.text == ':') {
                        current_token.type = 'TK_WORD';
                    }
                }
            }

            if (start_of_statement()) {
                // The conditional starts the statement if appropriate.
            } else if (current_token.wanted_newline && !is_expression(flags.mode) &&
                (last_type !== 'TK_OPERATOR' || (flags.last_text === '--' || flags.last_text === '++')) &&
                last_type !== 'TK_EQUALS' &&
                (opt.preserve_newlines || !(last_type === 'TK_RESERVED' && in_array(flags.last_text, ['var', 'let', 'const', 'set', 'get'])))) {

                print_newline();
            }

            if (flags.do_block && !flags.do_while) {
                if (current_token.type === 'TK_RESERVED' && current_token.text === 'while') {
                    // do {} ## while ()
                    output.space_before_token = true;
                    print_token();
                    output.space_before_token = true;
                    flags.do_while = true;
                    return;
                } else {
                    // do {} should always have while as the next word.
                    // if we don't see the expected while, recover
                    print_newline();
                    flags.do_block = false;
                }
            }

            // if may be followed by else, or not
            // Bare/inline ifs are tricky
            // Need to unwind the modes correctly: if (a) if (b) c(); else d(); else e();
            if (flags.if_block) {
                if (!flags.else_block && (current_token.type === 'TK_RESERVED' && current_token.text === 'else')) {
                    flags.else_block = true;
                } else {
                    while (flags.mode === MODE.Statement) {
                        restore_mode();
                    }
                    flags.if_block = false;
                    flags.else_block = false;
                }
            }

            if (current_token.type === 'TK_RESERVED' && (current_token.text === 'case' || (current_token.text === 'default' && flags.in_case_statement))) {
                print_newline();
                if (flags.case_body || opt.jslint_happy) {
                    // switch cases following one another
                    deindent();
                    flags.case_body = false;
                }
                print_token();
                flags.in_case = true;
                flags.in_case_statement = true;
                return;
            }

            if (current_token.type === 'TK_RESERVED' && current_token.text === 'function') {
                if (in_array(flags.last_text, ['}', ';']) || (output.just_added_newline() && ! in_array(flags.last_text, ['[', '{', ':', '=', ',']))) {
                    // make sure there is a nice clean space of at least one blank line
                    // before a new function definition
                    if ( !output.just_added_blankline() && !current_token.comments_before.length) {
                        print_newline();
                        print_newline(true);
                    }
                }
                if (last_type === 'TK_RESERVED' || last_type === 'TK_WORD') {
                    if (last_type === 'TK_RESERVED' && in_array(flags.last_text, ['get', 'set', 'new', 'return', 'export', 'async'])) {
                        output.space_before_token = true;
                    } else if (last_type === 'TK_RESERVED' && flags.last_text === 'default' && last_last_text === 'export') {
                        output.space_before_token = true;
                    } else {
                        print_newline();
                    }
                } else if (last_type === 'TK_OPERATOR' || flags.last_text === '=') {
                    // foo = function
                    output.space_before_token = true;
                } else if (!flags.multiline_frame && (is_expression(flags.mode) || is_array(flags.mode))) {
                    // (function
                } else {
                    print_newline();
                }
            }

            if (last_type === 'TK_COMMA' || last_type === 'TK_START_EXPR' || last_type === 'TK_EQUALS' || last_type === 'TK_OPERATOR') {
                if (!start_of_object_property()) {
                    allow_wrap_or_preserved_newline();
                }
            }

            if (current_token.type === 'TK_RESERVED' &&  in_array(current_token.text, ['function', 'get', 'set'])) {
                print_token();
                flags.last_word = current_token.text;
                return;
            }

            prefix = 'NONE';

            if (last_type === 'TK_END_BLOCK') {

                if (!(current_token.type === 'TK_RESERVED' && in_array(current_token.text, ['else', 'catch', 'finally', 'from']))) {
                    prefix = 'NEWLINE';
                } else {
                    if (opt.brace_style === "expand" ||
                        opt.brace_style === "end-expand" ||
                        (opt.brace_style === "none" && current_token.wanted_newline)) {
                        prefix = 'NEWLINE';
                    } else {
                        prefix = 'SPACE';
                        output.space_before_token = true;
                    }
                }
            } else if (last_type === 'TK_SEMICOLON' && flags.mode === MODE.BlockStatement) {
                // TODO: Should this be for STATEMENT as well?
                prefix = 'NEWLINE';
            } else if (last_type === 'TK_SEMICOLON' && is_expression(flags.mode)) {
                prefix = 'SPACE';
            } else if (last_type === 'TK_STRING') {
                prefix = 'NEWLINE';
            } else if (last_type === 'TK_RESERVED' || last_type === 'TK_WORD' ||
                (flags.last_text === '*' && last_last_text === 'function')) {
                prefix = 'SPACE';
            } else if (last_type === 'TK_START_BLOCK') {
                if (flags.inline_frame) {
                    prefix = 'SPACE';
                } else {
                    prefix = 'NEWLINE';
                }
            } else if (last_type === 'TK_END_EXPR') {
                output.space_before_token = true;
                prefix = 'NEWLINE';
            }

            if (current_token.type === 'TK_RESERVED' && in_array(current_token.text, Tokenizer.line_starters) && flags.last_text !== ')') {
                if (flags.last_text === 'else' || flags.last_text === 'export') {
                    prefix = 'SPACE';
                } else {
                    prefix = 'NEWLINE';
                }

            }

            if (current_token.type === 'TK_RESERVED' && in_array(current_token.text, ['else', 'catch', 'finally'])) {
                if (!(last_type === 'TK_END_BLOCK' && previous_flags.mode === MODE.BlockStatement) ||
                    opt.brace_style === "expand" ||
                    opt.brace_style === "end-expand" ||
                    (opt.brace_style === "none" && current_token.wanted_newline)) {
                    print_newline();
                } else {
                    output.trim(true);
                    var line = output.current_line;
                    // If we trimmed and there's something other than a close block before us
                    // put a newline back in.  Handles '} // comment' scenario.
                    if (line.last() !== '}') {
                        print_newline();
                    }
                    output.space_before_token = true;
                }
            } else if (prefix === 'NEWLINE') {
                if (last_type === 'TK_RESERVED' && is_special_word(flags.last_text)) {
                    // no newline between 'return nnn'
                    output.space_before_token = true;
                } else if (last_type !== 'TK_END_EXPR') {
                    if ((last_type !== 'TK_START_EXPR' || !(current_token.type === 'TK_RESERVED' && in_array(current_token.text, ['var', 'let', 'const']))) && flags.last_text !== ':') {
                        // no need to force newline on 'var': for (var x = 0...)
                        if (current_token.type === 'TK_RESERVED' && current_token.text === 'if' && flags.last_text === 'else') {
                            // no newline for } else if {
                            output.space_before_token = true;
                        } else {
                            print_newline();
                        }
                    }
                } else if (current_token.type === 'TK_RESERVED' && in_array(current_token.text, Tokenizer.line_starters) && flags.last_text !== ')') {
                    print_newline();
                }
            } else if (flags.multiline_frame && is_array(flags.mode) && flags.last_text === ',' && last_last_text === '}') {
                print_newline(); // }, in lists get a newline treatment
            } else if (prefix === 'SPACE') {
                output.space_before_token = true;
            }
            print_token();
            flags.last_word = current_token.text;

            if (current_token.type === 'TK_RESERVED') {
                if (current_token.text === 'do') {
                    flags.do_block = true;
                } else if (current_token.text === 'if') {
                    flags.if_block = true;
                } else if (current_token.text === 'import') {
                    flags.import_block = true;
                } else if (flags.import_block && current_token.type === 'TK_RESERVED' && current_token.text === 'from') {
                    flags.import_block = false;
                }
            }
        }

        function handle_semicolon() {
            if (start_of_statement()) {
                // The conditional starts the statement if appropriate.
                // Semicolon can be the start (and end) of a statement
                output.space_before_token = false;
            }
            while (flags.mode === MODE.Statement && !flags.if_block && !flags.do_block) {
                restore_mode();
            }

            // hacky but effective for the moment
            if (flags.import_block) {
                flags.import_block = false;
            }
            print_token();
        }

        function handle_string() {
            if (start_of_statement()) {
                // The conditional starts the statement if appropriate.
                // One difference - strings want at least a space before
                output.space_before_token = true;
            } else if (last_type === 'TK_RESERVED' || last_type === 'TK_WORD' || flags.inline_frame) {
                output.space_before_token = true;
            } else if (last_type === 'TK_COMMA' || last_type === 'TK_START_EXPR' || last_type === 'TK_EQUALS' || last_type === 'TK_OPERATOR') {
                if (!start_of_object_property()) {
                    allow_wrap_or_preserved_newline();
                }
            } else {
                print_newline();
            }
            print_token();
        }

        function handle_equals() {
            if (start_of_statement()) {
                // The conditional starts the statement if appropriate.
            }

            if (flags.declaration_statement) {
                // just got an '=' in a var-line, different formatting/line-breaking, etc will now be done
                flags.declaration_assignment = true;
            }
            output.space_before_token = true;
            print_token();
            output.space_before_token = true;
        }

        function handle_comma() {
            print_token();
            output.space_before_token = true;
            if (flags.declaration_statement) {
                if (is_expression(flags.parent.mode)) {
                    // do not break on comma, for(var a = 1, b = 2)
                    flags.declaration_assignment = false;
                }

                if (flags.declaration_assignment) {
                    flags.declaration_assignment = false;
                    print_newline(false, true);
                } else if (opt.comma_first) {
                    // for comma-first, we want to allow a newline before the comma
                    // to turn into a newline after the comma, which we will fixup later
                    allow_wrap_or_preserved_newline();
                }
            } else if (flags.mode === MODE.ObjectLiteral ||
                (flags.mode === MODE.Statement && flags.parent.mode === MODE.ObjectLiteral)) {
                if (flags.mode === MODE.Statement) {
                    restore_mode();
                }

                if (!flags.inline_frame) {
                    print_newline();
                }
            } else if (opt.comma_first) {
                // EXPR or DO_BLOCK
                // for comma-first, we want to allow a newline before the comma
                // to turn into a newline after the comma, which we will fixup later
                allow_wrap_or_preserved_newline();
            }
        }

        function handle_operator() {
            if (start_of_statement()) {
                // The conditional starts the statement if appropriate.
            }

            if (last_type === 'TK_RESERVED' && is_special_word(flags.last_text)) {
                // "return" had a special handling in TK_WORD. Now we need to return the favor
                output.space_before_token = true;
                print_token();
                return;
            }

            // hack for actionscript's import .*;
            if (current_token.text === '*' && last_type === 'TK_DOT') {
                print_token();
                return;
            }

            if (current_token.text === ':' && flags.in_case) {
                flags.case_body = true;
                indent();
                print_token();
                print_newline();
                flags.in_case = false;
                return;
            }

            if (current_token.text === '::') {
                // no spaces around exotic namespacing syntax operator
                print_token();
                return;
            }

            // Allow line wrapping between operators
            if (last_type === 'TK_OPERATOR') {
                allow_wrap_or_preserved_newline();
            }

            var space_before = true;
            var space_after = true;

            if (in_array(current_token.text, ['--', '++', '!', '~']) || (in_array(current_token.text, ['-', '+']) && (in_array(last_type, ['TK_START_BLOCK', 'TK_START_EXPR', 'TK_EQUALS', 'TK_OPERATOR']) || in_array(flags.last_text, Tokenizer.line_starters) || flags.last_text === ','))) {
                // unary operators (and binary +/- pretending to be unary) special cases

                space_before = false;
                space_after = false;

                // http://www.ecma-international.org/ecma-262/5.1/#sec-7.9.1
                // if there is a newline between -- or ++ and anything else we should preserve it.
                if (current_token.wanted_newline && (current_token.text === '--' || current_token.text === '++')) {
                    print_newline(false, true);
                }

                if (flags.last_text === ';' && is_expression(flags.mode)) {
                    // for (;; ++i)
                    //        ^^^
                    space_before = true;
                }

                if (last_type === 'TK_RESERVED') {
                    space_before = true;
                } else if (last_type === 'TK_END_EXPR') {
                    space_before = !(flags.last_text === ']' && (current_token.text === '--' || current_token.text === '++'));
                } else if (last_type === 'TK_OPERATOR') {
                    // a++ + ++b;
                    // a - -b
                    space_before = in_array(current_token.text, ['--', '-', '++', '+']) && in_array(flags.last_text, ['--', '-', '++', '+']);
                    // + and - are not unary when preceeded by -- or ++ operator
                    // a-- + b
                    // a * +b
                    // a - -b
                    if (in_array(current_token.text, ['+', '-']) && in_array(flags.last_text, ['--', '++'])) {
                        space_after = true;
                    }
                }


                if (((flags.mode === MODE.BlockStatement && !flags.inline_frame) || flags.mode === MODE.Statement)
                    && (flags.last_text === '{' || flags.last_text === ';')) {
                    // { foo; --i }
                    // foo(); --bar;
                    print_newline();
                }
            } else if (current_token.text === ':') {
                if (flags.ternary_depth === 0) {
                    // Colon is invalid javascript outside of ternary and object, but do our best to guess what was meant.
                    space_before = false;
                } else {
                    flags.ternary_depth -= 1;
                }
            } else if (current_token.text === '?') {
                flags.ternary_depth += 1;
            } else if (current_token.text === '*' && last_type === 'TK_RESERVED' && flags.last_text === 'function') {
                space_before = false;
                space_after = false;
            }
            output.space_before_token = output.space_before_token || space_before;
            print_token();
            output.space_before_token = space_after;
        }

        function handle_block_comment() {
            if (output.raw) {
                output.add_raw_token(current_token)
                if (current_token.directives && current_token.directives['preserve'] === 'end') {
                    // If we're testing the raw output behavior, do not allow a directive to turn it off.
                    if (!opt.test_output_raw) {
                        output.raw = false;
                    }
                }
                return;
            }

            if (current_token.directives) {
                print_newline(false, true);
                print_token();
                if (current_token.directives['preserve'] === 'start') {
                    output.raw = true;
                }
                print_newline(false, true);
                return;
            }

            // inline block
            if (!acorn.newline.test(current_token.text) && !current_token.wanted_newline) {
                output.space_before_token = true;
                print_token();
                output.space_before_token = true;
                return;
            }

            var lines = split_linebreaks(current_token.text);
            var j; // iterator for this case
            var javadoc = false;
            var starless = false;
            var lastIndent = current_token.whitespace_before;
            var lastIndentLength = lastIndent.length;

            // block comment starts with a new line
            print_newline(false, true);
            if (lines.length > 1) {
                if (all_lines_start_with(lines.slice(1), '*')) {
                    javadoc = true;
                }
                else if (each_line_matches_indent(lines.slice(1), lastIndent)) {
                    starless = true;
                }
            }

            // first line always indented
            print_token(lines[0]);
            for (j = 1; j < lines.length; j++) {
                print_newline(false, true);
                if (javadoc) {
                    // javadoc: reformat and re-indent
                    print_token(' ' + ltrim(lines[j]));
                } else if (starless && lines[j].length > lastIndentLength) {
                    // starless: re-indent non-empty content, avoiding trim
                    print_token(lines[j].substring(lastIndentLength));
                } else {
                    // normal comments output raw
                    output.add_token(lines[j]);
                }
            }

            // for comments of more than one line, make sure there's a new line after
            print_newline(false, true);
        }

        function handle_comment() {
            if (current_token.wanted_newline) {
                print_newline(false, true);
            } else {
                output.trim(true);
            }

            output.space_before_token = true;
            print_token();
            print_newline(false, true);
        }

        function handle_dot() {
            if (start_of_statement()) {
                // The conditional starts the statement if appropriate.
            }

            if (last_type === 'TK_RESERVED' && is_special_word(flags.last_text)) {
                output.space_before_token = true;
            } else {
                // allow preserved newlines before dots in general
                // force newlines on dots after close paren when break_chained - for bar().baz()
                allow_wrap_or_preserved_newline(flags.last_text === ')' && opt.break_chained_methods);
            }

            print_token();
        }

        function handle_unknown() {
            print_token();

            if (current_token.text[current_token.text.length - 1] === '\n') {
                print_newline();
            }
        }

        function handle_eof() {
            // Unwind any open statements
            while (flags.mode === MODE.Statement) {
                restore_mode();
            }
        }
    }


    function OutputLine(parent) {
        var _character_count = 0;
        // use indent_count as a marker for lines that have preserved indentation
        var _indent_count = -1;

        var _items = [];
        var _empty = true;

        this.set_indent = function(level) {
            _character_count = parent.baseIndentLength + level * parent.indent_length
            _indent_count = level;
        }

        this.get_character_count = function() {
            return _character_count;
        }

        this.is_empty = function() {
            return _empty;
        }

        this.last = function() {
            if (!this._empty) {
              return _items[_items.length - 1];
            } else {
              return null;
            }
        }

        this.push = function(input) {
            _items.push(input);
            _character_count += input.length;
            _empty = false;
        }

        this.pop = function() {
            var item = null;
            if (!_empty) {
                item = _items.pop();
                _character_count -= item.length;
                _empty = _items.length === 0;
            }
            return item;
        }

        this.remove_indent = function() {
            if (_indent_count > 0) {
                _indent_count -= 1;
                _character_count -= parent.indent_length
            }
        }

        this.trim = function() {
            while (this.last() === ' ') {
                var item = _items.pop();
                _character_count -= 1;
            }
            _empty = _items.length === 0;
        }

        this.toString = function() {
            var result = '';
            if (!this._empty) {
                if (_indent_count >= 0) {
                    result = parent.indent_cache[_indent_count];
                }
                result += _items.join('')
            }
            return result;
        }
    }

    function Output(indent_string, baseIndentString) {
        baseIndentString = baseIndentString || '';
        this.indent_cache = [ baseIndentString ];
        this.baseIndentLength = baseIndentString.length;
        this.indent_length = indent_string.length;
        this.raw = false;

        var lines =[];
        this.baseIndentString = baseIndentString;
        this.indent_string = indent_string;
        this.previous_line = null;
        this.current_line = null;
        this.space_before_token = false;

        this.add_outputline = function() {
            this.previous_line = this.current_line;
            this.current_line = new OutputLine(this);
            lines.push(this.current_line);
        }

        // initialize
        this.add_outputline();


        this.get_line_number = function() {
            return lines.length;
        }

        // Using object instead of string to allow for later expansion of info about each line
        this.add_new_line = function(force_newline) {
            if (this.get_line_number() === 1 && this.just_added_newline()) {
                return false; // no newline on start of file
            }

            if (force_newline || !this.just_added_newline()) {
                if (!this.raw) {
                    this.add_outputline();
                }
                return true;
            }

            return false;
        }

        this.get_code = function() {
            var sweet_code = lines.join('\n').replace(/[\r\n\t ]+$/, '');
            return sweet_code;
        }

        this.set_indent = function(level) {
            // Never indent your first output indent at the start of the file
            if (lines.length > 1) {
                while(level >= this.indent_cache.length) {
                    this.indent_cache.push(this.indent_cache[this.indent_cache.length - 1] + this.indent_string);
                }

                this.current_line.set_indent(level);
                return true;
            }
            this.current_line.set_indent(0);
            return false;
        }

        this.add_raw_token = function(token) {
            for (var x = 0; x < token.newlines; x++) {
                this.add_outputline();
            }
            this.current_line.push(token.whitespace_before);
            this.current_line.push(token.text);
            this.space_before_token = false;
        }

        this.add_token = function(printable_token) {
            this.add_space_before_token();
            this.current_line.push(printable_token);
        }

        this.add_space_before_token = function() {
            if (this.space_before_token && !this.just_added_newline()) {
                this.current_line.push(' ');
            }
            this.space_before_token = false;
        }

        this.remove_redundant_indentation = function (frame) {
            // This implementation is effective but has some issues:
            //     - can cause line wrap to happen too soon due to indent removal
            //           after wrap points are calculated
            // These issues are minor compared to ugly indentation.

            if (frame.multiline_frame ||
                frame.mode === MODE.ForInitializer ||
                frame.mode === MODE.Conditional) {
                return;
            }

            // remove one indent from each line inside this section
            var index = frame.start_line_index;
            var line;

            var output_length = lines.length;
            while (index < output_length) {
                lines[index].remove_indent();
                index++;
            }
        }

        this.trim = function(eat_newlines) {
            eat_newlines = (eat_newlines === undefined) ? false : eat_newlines;

            this.current_line.trim(indent_string, baseIndentString);

            while (eat_newlines && lines.length > 1 &&
                this.current_line.is_empty()) {
                lines.pop();
                this.current_line = lines[lines.length - 1]
                this.current_line.trim();
            }

            this.previous_line = lines.length > 1 ? lines[lines.length - 2] : null;
        }

        this.just_added_newline = function() {
            return this.current_line.is_empty();
        }

        this.just_added_blankline = function() {
            if (this.just_added_newline()) {
                if (lines.length === 1) {
                    return true; // start of the file and newline = blank
                }

                var line = lines[lines.length - 2];
                return line.is_empty();
            }
            return false;
        }
    }


    var Token = function(type, text, newlines, whitespace_before, mode, parent) {
        this.type = type;
        this.text = text;
        this.comments_before = [];
        this.newlines = newlines || 0;
        this.wanted_newline = newlines > 0;
        this.whitespace_before = whitespace_before || '';
        this.parent = null;
        this.opened = null;
        this.directives = null;
    }

    function tokenizer(input, opts, indent_string) {

        var whitespace = "\n\r\t ".split('');
        var digit = /[0-9]/;
        var digit_bin = /[01]/;
        var digit_oct = /[01234567]/;
        var digit_hex = /[0123456789abcdefABCDEF]/;

        var punct = ('+ - * / % & ++ -- = += -= *= /= %= == === != !== > < >= <= >> << >>> >>>= >>= <<= && &= | || ! ~ , : ? ^ ^= |= :: => **').split(' ');
        // words which should always start on new line.
        this.line_starters = 'continue,try,throw,return,var,let,const,if,switch,case,default,for,while,break,function,import,export'.split(',');
        var reserved_words = this.line_starters.concat(['do', 'in', 'else', 'get', 'set', 'new', 'catch', 'finally', 'typeof', 'yield', 'async', 'await', 'from', 'as']);

        //  /* ... */ comment ends with nearest */ or end of file
        var block_comment_pattern = /([\s\S]*?)((?:\*\/)|$)/g;

        // comment ends just before nearest linefeed or end of file
        var comment_pattern = /([^\n\r\u2028\u2029]*)/g;

        var directives_block_pattern = /\/\* beautify( \w+[:]\w+)+ \*\//g;
        var directive_pattern = / (\w+)[:](\w+)/g;
        var directives_end_ignore_pattern = /([\s\S]*?)((?:\/\*\sbeautify\signore:end\s\*\/)|$)/g;

        var template_pattern = /((<\?php|<\?=)[\s\S]*?\?>)|(<%[\s\S]*?%>)/g

        var n_newlines, whitespace_before_token, in_html_comment, tokens, parser_pos;
        var input_length;

        this.tokenize = function() {
            // cache the source's length.
            input_length = input.length
            parser_pos = 0;
            in_html_comment = false
            tokens = [];

            var next, last;
            var token_values;
            var open = null;
            var open_stack = [];
            var comments = [];

            while (!(last && last.type === 'TK_EOF')) {
                token_values = tokenize_next();
                next = new Token(token_values[1], token_values[0], n_newlines, whitespace_before_token);
                while(next.type === 'TK_COMMENT' || next.type === 'TK_BLOCK_COMMENT' || next.type === 'TK_UNKNOWN') {
                    if (next.type === 'TK_BLOCK_COMMENT') {
                        next.directives = token_values[2];
                    }
                    comments.push(next);
                    token_values = tokenize_next();
                    next = new Token(token_values[1], token_values[0], n_newlines, whitespace_before_token);
                }

                if (comments.length) {
                    next.comments_before = comments;
                    comments = [];
                }

                if (next.type === 'TK_START_BLOCK' || next.type === 'TK_START_EXPR') {
                    next.parent = last;
                    open_stack.push(open);
                    open = next;
                }  else if ((next.type === 'TK_END_BLOCK' || next.type === 'TK_END_EXPR') &&
                    (open && (
                        (next.text === ']' && open.text === '[') ||
                        (next.text === ')' && open.text === '(') ||
                        (next.text === '}' && open.text === '{')))) {
                    next.parent = open.parent;
                    next.opened = open

                    open = open_stack.pop();
                }

                tokens.push(next);
                last = next;
            }

            return tokens;
        }

        function get_directives (text) {
            if (!text.match(directives_block_pattern)) {
                return null;
            }

            var directives = {};
            directive_pattern.lastIndex = 0;
            var directive_match = directive_pattern.exec(text);

            while (directive_match) {
                directives[directive_match[1]] = directive_match[2];
                directive_match = directive_pattern.exec(text);
            }

            return directives;
        }

        function tokenize_next() {
            var i, resulting_string;
            var whitespace_on_this_line = [];

            n_newlines = 0;
            whitespace_before_token = '';

            if (parser_pos >= input_length) {
                return ['', 'TK_EOF'];
            }

            var last_token;
            if (tokens.length) {
                last_token = tokens[tokens.length-1];
            } else {
                // For the sake of tokenizing we can pretend that there was on open brace to start
                last_token = new Token('TK_START_BLOCK', '{');
            }


            var c = input.charAt(parser_pos);
            parser_pos += 1;

            while (in_array(c, whitespace)) {

                if (acorn.newline.test(c)) {
                    if (!(c === '\n' && input.charAt(parser_pos-2) === '\r')) {
                        n_newlines += 1;
                        whitespace_on_this_line = [];
                    }
                } else {
                    whitespace_on_this_line.push(c);
                }

                if (parser_pos >= input_length) {
                    return ['', 'TK_EOF'];
                }

                c = input.charAt(parser_pos);
                parser_pos += 1;
            }

            if(whitespace_on_this_line.length) {
                whitespace_before_token = whitespace_on_this_line.join('');
            }

            if (digit.test(c) || (c === '.' && digit.test(input.charAt(parser_pos)))) {
                var allow_decimal = true;
                var allow_e = true;
                var local_digit = digit;

                if (c === '0' && parser_pos < input_length && /[XxOoBb]/.test(input.charAt(parser_pos))) {
                    // switch to hex/oct/bin number, no decimal or e, just hex/oct/bin digits
                    allow_decimal = false;
                    allow_e = false;
                    if ( /[Bb]/.test(input.charAt(parser_pos)) ) {
                        local_digit = digit_bin;
                    } else if ( /[Oo]/.test(input.charAt(parser_pos)) ) {
                        local_digit = digit_oct;
                    } else {
                        local_digit = digit_hex;
                    }
                    c += input.charAt(parser_pos);
                    parser_pos += 1;
                } else if (c === '.') {
                    // Already have a decimal for this literal, don't allow another
                    allow_decimal = false;
                } else {
                    // we know this first loop will run.  It keeps the logic simpler.
                    c = '';
                    parser_pos -= 1;
                }

                // Add the digits
                while (parser_pos < input_length && local_digit.test(input.charAt(parser_pos))) {
                    c += input.charAt(parser_pos);
                    parser_pos += 1;

                    if (allow_decimal && parser_pos < input_length && input.charAt(parser_pos) === '.') {
                        c += input.charAt(parser_pos);
                        parser_pos += 1;
                        allow_decimal = false;
                    } else if (allow_e && parser_pos < input_length && /[Ee]/.test(input.charAt(parser_pos))) {
                        c += input.charAt(parser_pos);
                        parser_pos += 1;

                        if (parser_pos < input_length && /[+-]/.test(input.charAt(parser_pos))) {
                            c += input.charAt(parser_pos);
                            parser_pos += 1;
                        }

                        allow_e = false;
                        allow_decimal = false;
                    }
                }

                return [c, 'TK_WORD'];
            }

            if (acorn.isIdentifierStart(input.charCodeAt(parser_pos-1))) {
                if (parser_pos < input_length) {
                    while (acorn.isIdentifierChar(input.charCodeAt(parser_pos))) {
                        c += input.charAt(parser_pos);
                        parser_pos += 1;
                        if (parser_pos === input_length) {
                            break;
                        }
                    }
                }

                if (!(last_token.type === 'TK_DOT' ||
                        (last_token.type === 'TK_RESERVED' && in_array(last_token.text, ['set', 'get'])))
                    && in_array(c, reserved_words)) {
                    if (c === 'in') { // hack for 'in' operator
                        return [c, 'TK_OPERATOR'];
                    }
                    return [c, 'TK_RESERVED'];
                }

                return [c, 'TK_WORD'];
            }

            if (c === '(' || c === '[') {
                return [c, 'TK_START_EXPR'];
            }

            if (c === ')' || c === ']') {
                return [c, 'TK_END_EXPR'];
            }

            if (c === '{') {
                return [c, 'TK_START_BLOCK'];
            }

            if (c === '}') {
                return [c, 'TK_END_BLOCK'];
            }

            if (c === ';') {
                return [c, 'TK_SEMICOLON'];
            }

            if (c === '/') {
                var comment = '';
                // peek for comment /* ... */
                if (input.charAt(parser_pos) === '*') {
                    parser_pos += 1;
                    block_comment_pattern.lastIndex = parser_pos;
                    var comment_match = block_comment_pattern.exec(input);
                    comment = '/*' + comment_match[0];
                    parser_pos += comment_match[0].length;
                    var directives = get_directives(comment);
                    if (directives && directives['ignore'] === 'start') {
                        directives_end_ignore_pattern.lastIndex = parser_pos;
                        comment_match = directives_end_ignore_pattern.exec(input)
                        comment += comment_match[0];
                        parser_pos += comment_match[0].length;
                    }
                    comment = comment.replace(acorn.allLineBreaks, '\n');
                    return [comment, 'TK_BLOCK_COMMENT', directives];
                }
                // peek for comment // ...
                if (input.charAt(parser_pos) === '/') {
                    parser_pos += 1;
                    comment_pattern.lastIndex = parser_pos;
                    var comment_match = comment_pattern.exec(input);
                    comment = '//' + comment_match[0];
                    parser_pos += comment_match[0].length;
                    return [comment, 'TK_COMMENT'];
                }

            }

            var startXmlRegExp = /^<([-a-zA-Z:0-9_.]+|{.+?}|!\[CDATA\[[\s\S]*?\]\])(\s+{.+?}|\s+[-a-zA-Z:0-9_.]+|\s+[-a-zA-Z:0-9_.]+\s*=\s*('[^']*'|"[^"]*"|{.+?}))*\s*(\/?)\s*>/

            if (c === '`' || c === "'" || c === '"' || // string
                (
                    (c === '/') || // regexp
                    (opts.e4x && c === "<" && input.slice(parser_pos - 1).match(startXmlRegExp)) // xml
                ) && ( // regex and xml can only appear in specific locations during parsing
                    (last_token.type === 'TK_RESERVED' && in_array(last_token.text , ['return', 'case', 'throw', 'else', 'do', 'typeof', 'yield'])) ||
                    (last_token.type === 'TK_END_EXPR' && last_token.text === ')' &&
                        last_token.parent && last_token.parent.type === 'TK_RESERVED' && in_array(last_token.parent.text, ['if', 'while', 'for'])) ||
                    (in_array(last_token.type, ['TK_COMMENT', 'TK_START_EXPR', 'TK_START_BLOCK',
                        'TK_END_BLOCK', 'TK_OPERATOR', 'TK_EQUALS', 'TK_EOF', 'TK_SEMICOLON', 'TK_COMMA'
                    ]))
                )) {

                var sep = c,
                    esc = false,
                    has_char_escapes = false;

                resulting_string = c;

                if (sep === '/') {
                    //
                    // handle regexp
                    //
                    var in_char_class = false;
                    while (parser_pos < input_length &&
                            ((esc || in_char_class || input.charAt(parser_pos) !== sep) &&
                            !acorn.newline.test(input.charAt(parser_pos)))) {
                        resulting_string += input.charAt(parser_pos);
                        if (!esc) {
                            esc = input.charAt(parser_pos) === '\\';
                            if (input.charAt(parser_pos) === '[') {
                                in_char_class = true;
                            } else if (input.charAt(parser_pos) === ']') {
                                in_char_class = false;
                            }
                        } else {
                            esc = false;
                        }
                        parser_pos += 1;
                    }
                } else if (opts.e4x && sep === '<') {
                    //
                    // handle e4x xml literals
                    //

                    var xmlRegExp = /<(\/?)([-a-zA-Z:0-9_.]+|{.+?}|!\[CDATA\[[\s\S]*?\]\])(\s+{.+?}|\s+[-a-zA-Z:0-9_.]+|\s+[-a-zA-Z:0-9_.]+\s*=\s*('[^']*'|"[^"]*"|{.+?}))*\s*(\/?)\s*>/g;
                    var xmlStr = input.slice(parser_pos - 1);
                    var match = xmlRegExp.exec(xmlStr);
                    if (match && match.index === 0) {
                        var rootTag = match[2];
                        var depth = 0;
                        while (match) {
                            var isEndTag = !! match[1];
                            var tagName = match[2];
                            var isSingletonTag = ( !! match[match.length - 1]) || (tagName.slice(0, 8) === "![CDATA[");
                            if (tagName === rootTag && !isSingletonTag) {
                                if (isEndTag) {
                                    --depth;
                                } else {
                                    ++depth;
                                }
                            }
                            if (depth <= 0) {
                                break;
                            }
                            match = xmlRegExp.exec(xmlStr);
                        }
                        var xmlLength = match ? match.index + match[0].length : xmlStr.length;
                        xmlStr = xmlStr.slice(0, xmlLength);
                        parser_pos += xmlLength - 1;
                        xmlStr = xmlStr.replace(acorn.allLineBreaks, '\n');
                        return [xmlStr, "TK_STRING"];
                    }
                } else {
                    //
                    // handle string
                    //
                    var parse_string = function(delimiter, allow_unescaped_newlines, start_sub) {
                        // Template strings can travers lines without escape characters.
                        // Other strings cannot
                        var current_char;
                        while (parser_pos < input_length) {
                            current_char = input.charAt(parser_pos);
                            if (!(esc || (current_char !== delimiter &&
                                (allow_unescaped_newlines || !acorn.newline.test(current_char))))) {
                                break;
                            }

                            // Handle \r\n linebreaks after escapes or in template strings
                            if ((esc || allow_unescaped_newlines) && acorn.newline.test(current_char)) {
                                if (current_char === '\r' && input.charAt(parser_pos + 1) === '\n') {
                                    parser_pos += 1;
                                    current_char = input.charAt(parser_pos);
                                }
                                resulting_string += '\n';
                            } else {
                                resulting_string += current_char;
                            }
                            if (esc) {
                                if (current_char === 'x' || current_char === 'u') {
                                    has_char_escapes = true;
                                }
                                esc = false;
                            } else {
                                esc = current_char === '\\';
                            }

                            parser_pos += 1;

                            if (start_sub && resulting_string.indexOf(start_sub, resulting_string.length - start_sub.length) !== -1) {
                                if (delimiter === '`') {
                                    parse_string('}', allow_unescaped_newlines, '`')
                                }  else {
                                    parse_string('`', allow_unescaped_newlines, '${')
                                }
                            }
                        }
                    }
                    if (sep === '`') {
                        parse_string('`', true, '${')
                    }  else {
                        parse_string(sep)
                    }
                }

                if (has_char_escapes && opts.unescape_strings) {
                    resulting_string = unescape_string(resulting_string);
                }

                if (parser_pos < input_length && input.charAt(parser_pos) === sep) {
                    resulting_string += sep;
                    parser_pos += 1;

                    if (sep === '/') {
                        // regexps may have modifiers /regexp/MOD , so fetch those, too
                        // Only [gim] are valid, but if the user puts in garbage, do what we can to take it.
                        while (parser_pos < input_length && acorn.isIdentifierStart(input.charCodeAt(parser_pos))) {
                            resulting_string += input.charAt(parser_pos);
                            parser_pos += 1;
                        }
                    }
                }
                return [resulting_string, 'TK_STRING'];
            }

            if (c === '#') {

                if (tokens.length === 0 && input.charAt(parser_pos) === '!') {
                    // shebang
                    resulting_string = c;
                    while (parser_pos < input_length && c !== '\n') {
                        c = input.charAt(parser_pos);
                        resulting_string += c;
                        parser_pos += 1;
                    }
                    return [trim(resulting_string) + '\n', 'TK_UNKNOWN'];
                }



                // Spidermonkey-specific sharp variables for circular references
                // https://developer.mozilla.org/En/Sharp_variables_in_JavaScript
                // http://mxr.mozilla.org/mozilla-central/source/js/src/jsscan.cpp around line 1935
                var sharp = '#';
                if (parser_pos < input_length && digit.test(input.charAt(parser_pos))) {
                    do {
                        c = input.charAt(parser_pos);
                        sharp += c;
                        parser_pos += 1;
                    } while (parser_pos < input_length && c !== '#' && c !== '=');
                    if (c === '#') {
                        //
                    } else if (input.charAt(parser_pos) === '[' && input.charAt(parser_pos + 1) === ']') {
                        sharp += '[]';
                        parser_pos += 2;
                    } else if (input.charAt(parser_pos) === '{' && input.charAt(parser_pos + 1) === '}') {
                        sharp += '{}';
                        parser_pos += 2;
                    }
                    return [sharp, 'TK_WORD'];
                }
            }

            if (c === '<' && (input.charAt(parser_pos) === '?' || input.charAt(parser_pos) === '%')) {
                template_pattern.lastIndex = parser_pos - 1;
                var template_match = template_pattern.exec(input);
                if(template_match) {
                    c = template_match[0];
                    parser_pos += c.length - 1;
                    c = c.replace(acorn.allLineBreaks, '\n');
                    return [c, 'TK_STRING'];
                }
            }

            if (c === '<' && input.substring(parser_pos - 1, parser_pos + 3) === '<!--') {
                parser_pos += 3;
                c = '<!--';
                while (!acorn.newline.test(input.charAt(parser_pos)) && parser_pos < input_length) {
                    c += input.charAt(parser_pos);
                    parser_pos++;
                }
                in_html_comment = true;
                return [c, 'TK_COMMENT'];
            }

            if (c === '-' && in_html_comment && input.substring(parser_pos - 1, parser_pos + 2) === '-->') {
                in_html_comment = false;
                parser_pos += 2;
                return ['-->', 'TK_COMMENT'];
            }

            if (c === '.') {
                return [c, 'TK_DOT'];
            }

            if (in_array(c, punct)) {
                while (parser_pos < input_length && in_array(c + input.charAt(parser_pos), punct)) {
                    c += input.charAt(parser_pos);
                    parser_pos += 1;
                    if (parser_pos >= input_length) {
                        break;
                    }
                }

                if (c === ',') {
                    return [c, 'TK_COMMA'];
                } else if (c === '=') {
                    return [c, 'TK_EQUALS'];
                } else {
                    return [c, 'TK_OPERATOR'];
                }
            }

            return [c, 'TK_UNKNOWN'];
        }


        function unescape_string(s) {
            var esc = false,
                out = '',
                pos = 0,
                s_hex = '',
                escaped = 0,
                c;

            while (esc || pos < s.length) {

                c = s.charAt(pos);
                pos++;

                if (esc) {
                    esc = false;
                    if (c === 'x') {
                        // simple hex-escape \x24
                        s_hex = s.substr(pos, 2);
                        pos += 2;
                    } else if (c === 'u') {
                        // unicode-escape, \u2134
                        s_hex = s.substr(pos, 4);
                        pos += 4;
                    } else {
                        // some common escape, e.g \n
                        out += '\\' + c;
                        continue;
                    }
                    if (!s_hex.match(/^[0123456789abcdefABCDEF]+$/)) {
                        // some weird escaping, bail out,
                        // leaving whole string intact
                        return s;
                    }

                    escaped = parseInt(s_hex, 16);

                    if (escaped >= 0x00 && escaped < 0x20) {
                        // leave 0x00...0x1f escaped
                        if (c === 'x') {
                            out += '\\x' + s_hex;
                        } else {
                            out += '\\u' + s_hex;
                        }
                        continue;
                    } else if (escaped === 0x22 || escaped === 0x27 || escaped === 0x5c) {
                        // single-quote, apostrophe, backslash - escape these
                        out += '\\' + String.fromCharCode(escaped);
                    } else if (c === 'x' && escaped > 0x7e && escaped <= 0xff) {
                        // we bail out on \x7f..\xff,
                        // leaving whole string escaped,
                        // as it's probably completely binary
                        return s;
                    } else {
                        out += String.fromCharCode(escaped);
                    }
                } else if (c === '\\') {
                    esc = true;
                } else {
                    out += c;
                }
            }
            return out;
        }

    }


    if (typeof define === "function" && define.amd) {
        // Add support for AMD ( https://github.com/amdjs/amdjs-api/wiki/AMD#defineamd-property- )
        define([], function() {
            return { js_beautify: js_beautify };
        });
    } else if (typeof exports !== "undefined") {
        // Add support for CommonJS. Just put this file somewhere on your require.paths
        // and you will be able to `var js_beautify = require("beautify").js_beautify`.
        exports.js_beautify = js_beautify;
    } else if (typeof window !== "undefined") {
        // If we're running a web page and don't have either of the above, add our one global
        window.js_beautify = js_beautify;
    } else if (typeof global !== "undefined") {
        // If we don't even have window, try global.
        global.js_beautify = js_beautify;
    }

}());

}).call(this,typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {})
},{}],46:[function(require,module,exports){
/* global MutationObserver */
var document = require('global/document')
var window = require('global/window')
var watch = Object.create(null)
var KEY_ID = 'onloadid' + (new Date() % 9e6).toString(36)
var KEY_ATTR = 'data-' + KEY_ID
var INDEX = 0

if (window && window.MutationObserver) {
  var observer = new MutationObserver(function (mutations) {
    if (Object.keys(watch).length < 1) return
    for (var i = 0; i < mutations.length; i++) {
      if (mutations[i].attributeName === KEY_ATTR) {
        eachAttr(mutations[i], turnon, turnoff)
        continue
      }
      eachMutation(mutations[i].removedNodes, turnoff)
      eachMutation(mutations[i].addedNodes, turnon)
    }
  })
  observer.observe(document.body, {
    childList: true,
    subtree: true,
    attributes: true,
    attributeOldValue: true,
    attributeFilter: [KEY_ATTR]
  })
}

module.exports = function onload (el, on, off, caller) {
  on = on || function () {}
  off = off || function () {}
  el.setAttribute(KEY_ATTR, 'o' + INDEX)
  watch['o' + INDEX] = [on, off, 0, caller || onload.caller]
  INDEX += 1
  return el
}

function turnon (index, el) {
  if (watch[index][0] && watch[index][2] === 0) {
    watch[index][0](el)
    watch[index][2] = 1
  }
}

function turnoff (index, el) {
  if (watch[index][1] && watch[index][2] === 1) {
    watch[index][1](el)
    watch[index][2] = 0
  }
}

function eachAttr (mutation, on, off) {
  var newValue = mutation.target.getAttribute(KEY_ATTR)
  if (sameOrigin(mutation.oldValue, newValue)) {
    watch[newValue] = watch[mutation.oldValue]
    return
  }
  if (watch[mutation.oldValue]) {
    off(mutation.oldValue, mutation.target)
  }
  if (watch[newValue]) {
    on(newValue, mutation.target)
  }
}

function sameOrigin (oldValue, newValue) {
  if (!oldValue || !newValue) return false
  return watch[oldValue][3] === watch[newValue][3]
}

function eachMutation (nodes, fn) {
  var keys = Object.keys(watch)
  for (var i = 0; i < nodes.length; i++) {
    if (nodes[i] && nodes[i].getAttribute && nodes[i].getAttribute(KEY_ATTR)) {
      var onloadid = nodes[i].getAttribute(KEY_ATTR)
      keys.forEach(function (k) {
        if (onloadid === k) {
          fn(k, nodes[i])
        }
      })
    }
    if (nodes[i].childNodes.length > 0) {
      eachMutation(nodes[i].childNodes, fn)
    }
  }
}

},{"global/document":36,"global/window":37}],47:[function(require,module,exports){
/**
 * This file automatically generated from `pre-publish.js`.
 * Do not manually edit.
 */

module.exports = {
  "area": true,
  "base": true,
  "br": true,
  "col": true,
  "embed": true,
  "hr": true,
  "img": true,
  "input": true,
  "keygen": true,
  "link": true,
  "menuitem": true,
  "meta": true,
  "param": true,
  "source": true,
  "track": true,
  "wbr": true
};

},{}],48:[function(require,module,exports){
var Buffer = require('buffer').Buffer
window.domconsole = require('..')
window.demo = domconsole()

console.log(new Buffer(5))

var x = { leaf: 'leaf' }
x['circular1'] = x
x.y = {}
x.y.circular2 = x.y
console.log(x)

console.log({a:'x', fn:function(x){return 5}})
console.log(new Date)
console.log({a:'b',c:[1,2,3],x:{y:{z:['a',{b:'c'}]}}})
console.log(null)
console.log(undefined)
console.log("hey")
console.log(false)
console.log(true)
console.log(function asdf () {})
console.log(12)
console.log(/asdf/)
console.log((function(){ return arguments })(1,true))
console.log([])
console.log(document.createElement('div'))
console.log(NaN)

console.log({a: '5'})
console.error({a: '5'})
console.log(document.createElement('div'))
console.error(document.createElement('div'))
var div = document.createElement('div')
div.innerHTML = '<div><div>asdf</div></div>'
console.log(div)
console.log('WWWWWWWWWW WWWWWWWWWW WWWWWWWWWW WWWWWWWWWW WWWWWWWWWW WWWWWWWWWW WWWWWWWWWW WWWWWWWWWW ')

console.info('it works :-)')

// api usage
api.toggle() // expand or minimize the dom-console
console.log(api.serialize()) // retrieve the log that was logged to the dom-console
api.clear() // clear the content of the dom-console

api.log('visible in devtools console & only this dom-console instance')
api.info('visible in devtools console & only this dom-console instance')
api.error('visible in devtools console & only this dom-console instance')

// also logs errors nicely
function test (p) { var x = JSON.parse(p) }
test(function(){})

console.log(new Error('Ups! Something wrong...'))
console.error(new Error('Ups! Something wrong...'))

},{"..":6,"buffer":3}]},{},[48]);